Here we take a snapshot from the current tip of the master branch of pypath, collect all functions from the pypath.inputs module and run them with an empty cache directory. Basic metrics about the returned values and errors are presented. This simple and automatized procedure is able to reveal the most common errors: if a server is down, if the URL, format or access restrictions changed, or pypath got broken in the recent developments. Note: this report is only about pypath, not about the data in the OmniPath web service; before we build the OmniPath database, we aim to fix the errors which could have an impact on its content.
Compiled between 2023-06-18 18:26:50 and 2023-06-18 21:33:47; pypath version: 0.15.4 (from git, installed by poetry; 7455e32 )
| Modules collected: | 169 |
|---|---|
| Modules failed to import: | 0 |
| Functions collected: | 568 |
| Functions run without error: | 356 |
| Functions returned empty value: | 22 |
| Functions skipped due to lack of arguments: | 165 |
| Functions run with error: | 47 |
| Function | Started | Finished | Elapsed (s) | Result type | Result repr | Result size | Error | Change since last time | Last succeeded | |
|---|---|---|---|---|---|---|---|---|---|---|
| ¶ | pypath.inputs.abs.abs_interactions | 2023-06-18 18:26:51 | 2023-06-18 18:26:51 | 0.37 | list | [['SRF', 'extracted04'], ['SRF', 'extracted04'], ['SRF', 'extracted04'], ['TEF1', 'extracted04'], ['SP1', 'extracted04'], ['TBP', 'extracted04'], ['SRF', 'X67686'], ['SRF', 'X67686'], ['SRF', 'X67686'], ['TEF1', 'X67686'], ['SP1', 'X67686'], ['TBP', 'X67686'], ['SRF', 'extracted05'], ['SRF', 'extrac...(truncated) | 650 | {} | 2023-06-18 18:26:51 | |
| ¶ | pypath.inputs.acsn.acsn_interactions | 2023-06-18 18:26:51 | 2023-06-18 18:26:52 | 0.56 | list | [AcsnInteraction(partner_a='FOXO3', partner_b='PIK3CA', mechanism='CATALYSIS', references='10783894;11094066;11154281;11994454;15509806;16288288;17646672;18644865;20673124'), AcsnInteraction(partner_a='FOXO3', partner_b='PIK3CB', mechanism='CATALYSIS', references='10783894;11094066;11154281;11994454...(truncated) | 37,725 | {} | 2023-06-18 18:26:51 | |
| ¶ | pypath.inputs.acsn.acsn_interactions_sif | 2023-06-18 18:26:52 | 2023-06-18 18:26:52 | 0.31 | list | [['ACHE', 'UNKNOWN_CATALYSIS', 'Cytochrome'], ['ACHE', 'UNKNOWN_CATALYSIS', 'APAF1'], ['E2F1', 'null', 'MIR17-3P'], ['E2F1', 'null', 'p14ARF'], ['E2F1', 'null', 'BAF250'], ['E2F1', 'null', 'HDAC1'], ['E2F1', 'null', 'HP1gamma'], ['E2F1', 'null', 'RB1'], ['E2F1', 'null', 'SUV39H1'], ['E2F1', 'null', ...(truncated) | 9,570 | {} | 2023-06-18 18:26:52 | |
| ¶ | pypath.inputs.adhesome.adhesome_annotations | 2023-06-18 18:26:52 | 2023-06-18 18:29:49 | 176.35 | dict | {'P12814': {AdhesomeAnnotation(mainclass='Actin regulation', intrinsic=True)}, 'P23528': {AdhesomeAnnotation(mainclass='Actin regulation', intrinsic=True)}, 'Q9BR76': {AdhesomeAnnotation(mainclass='Actin regulation', intrinsic=True)}, 'Q14247': {AdhesomeAnnotation(mainclass='Actin regulation', intri...(truncated) | 239 | {} | 2023-06-18 18:26:52 | |
| ¶ | pypath.inputs.adhesome.adhesome_interactions | 2023-06-18 18:29:49 | 2023-06-18 18:29:50 | 1.28 | list | [AdhesomeInteraction(source='LPXN', target='GIT1', effect='0', type='Binding', pmid='12674328'), AdhesomeInteraction(source='GIT1', target='ARF1', effect='_', type='Inhibition', pmid='10896954'), AdhesomeInteraction(source='ARPC2', target='CTTN', effect='0', type='Binding', pmid='11018051'), Adhesom...(truncated) | 6,542 | {} | 2023-06-18 18:29:49 | |
| ¶ | pypath.inputs.almen2009.almen2009_annotations | 2023-06-18 18:29:50 | 2023-06-18 18:29:52 | 1.94 | dict | {'P04839': {Almen2009Annotation(mainclass='Enzymes', classes=('1',), phobius_secreted=False, phobius_transmembrane=5, sosui_transmembrane=5, tmhmm_transmembrane=4)}, 'Q9Y5S8': {Almen2009Annotation(mainclass='Enzymes', classes=('1',), phobius_secreted=False, phobius_transmembrane=5, sosui_transmembra...(truncated) | 4,825 | {} | 2023-06-18 18:29:50 | |
| ¶ | pypath.inputs.baccin2019.baccin2019_annotations | 2023-06-18 18:29:52 | 2023-06-18 18:33:55 | 243.44 | dict | {'P01023': {Baccin2019Annotation(mainclass='ligand', subclass='other', location='secreted')}, 'Q07954': {Baccin2019Annotation(mainclass='receptor', subclass=None, location=None), Baccin2019Annotation(mainclass='receptor', subclass='growth_factor_receptor', location=None)}, 'P48960': {Baccin2019Annot...(truncated) | 1,059 | {} | 2023-06-18 18:29:52 | |
| ¶ | pypath.inputs.baccin2019.baccin2019_interactions | 2023-06-18 18:33:55 | 2023-06-18 18:33:56 | 0.52 | list | [Baccin2019Interaction(ligand='P01023', receptor='Q07954', correct='Correct', ligand_location='secreted', ligand_category='other', resources={'Baccin2019', 'Ramilowski2015'}, references={'10652313', '12194978', '1702392'}), Baccin2019Interaction(ligand='P48960', receptor='P08174', correct='Correct',...(truncated) | 1,720 | {} | 2023-06-18 18:33:55 | |
| ¶ | pypath.inputs.biogps.biogps_datasets | 2023-06-18 18:33:56 | 2023-06-18 18:33:56 | 0.00 | list | [BiogpsDataset(organism='human', label='human_gene_atlas_ave', url='http://plugins.biogps.org/download/gnf1h-gcrma.zip'), BiogpsDataset(organism='human', label='human_gene_atlas', url='http://plugins.biogps.org/download/gnf1h-gcrma-unaveraged.zip'), BiogpsDataset(organism='human', label='human_nci60...(truncated) | 9 | {} | 2023-06-18 18:33:56 | |
| ¶ | pypath.inputs.biogps.biogps_download |
Not calling `pypath.inputs.biogps.biogps_download`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.biogps.biogps_download_all | 2023-06-18 18:33:56 | 2023-06-18 18:34:31 | 34.74 | dict | {'human_gene_atlas_ave': probe B_lymphoblasts ... retina small_intestine 0 1007_s_at 137.00 ... 880.675 168.15 1 1053_at 81.75 ... 9.900 8.50 2 117_at 12.55 ...(truncated) | 9 | {} | 2023-06-18 18:33:56 | |
| ¶ | pypath.inputs.biogrid.biogrid_all_interactions | 2023-06-18 18:34:31 | 2023-06-18 18:35:37 | 65.80 | list | [BiogridInteraction(partner_a='APOB', partner_b='MTTP', pmid='9915855', experimental_system='Two-hybrid', experimental_system_type='physical', ltp=True, htp_score=None, multi_validated=True, tax_a='9606', tax_b='9606'), BiogridInteraction(partner_a='CAPN3', partner_b='TTN', pmid='9642272', experimen...(truncated) | 8,246 | {} | 2023-06-18 18:34:31 | |
| ¶ | pypath.inputs.biogrid.biogrid_interactions | 2023-06-18 18:35:37 | 2023-06-18 18:35:39 | 1.40 | list | [BiogridPhysicalInteraction(partner_a='APOB', partner_b='MTTP', pmid='9915855'), BiogridPhysicalInteraction(partner_a='CAPN3', partner_b='TTN', pmid='9642272'), BiogridPhysicalInteraction(partner_a='DOCK8', partner_b='CDC42', pmid='15304341'), BiogridPhysicalInteraction(partner_a='CDKN3', partner_b=...(truncated) | 7,004 | {} | 2023-06-18 18:35:37 | |
| ¶ | pypath.inputs.biomart.biomart_homology | 2023-06-18 18:35:39 | 2023-06-18 18:36:07 | 28.63 | list | [EnsemblRecord(ensembl_gene_id='ENSG00000198888', ensembl_transcript_id='ENST00000361390', ensembl_peptide_id='ENSP00000354687', mmusculus_homolog_ensembl_peptide='ENSMUSP00000080991', mmusculus_homolog_ensembl_gene='ENSMUSG00000064341', mmusculus_homolog_orthology_type='ortholog_one2one', mmusculus...(truncated) | 178,164 | {} | 2023-06-18 18:35:39 | |
| ¶ | pypath.inputs.biomart.biomart_microarray |
Not calling `pypath.inputs.biomart.biomart_microarray`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.biomart.biomart_microarray_types | 2023-06-18 18:36:08 | 2023-06-18 18:36:08 | 0.18 | list | [{'description': None, 'type': 'OLIGO', 'vendor': 'PHALANX', 'format': 'EXPRESSION', 'array': 'OneArray', 'label': 'PHALANX OneArray'}, {'description': None, 'type': 'OLIGO', 'vendor': 'CODELINK', 'format': 'EXPRESSION', 'array': 'CODELINK', 'label': 'CODELINK CODELINK'}, {'vendor': 'ILLUMINA', 'for...(truncated) | 35 | {} | 2023-06-18 18:36:08 | |
| ¶ | pypath.inputs.biomart.biomart_query |
Not calling `pypath.inputs.biomart.biomart_query`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.biomodels._get_biomodels | 2023-06-18 18:36:08 | 2023-06-18 18:36:08 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/biomodels.py", line 106, in _get_biomodels
loginurl = urls.urls['biomodels']['login'] % t
KeyError: 'login'
|
{} | 2023-06-12 18:37:15 | |||
| ¶ | pypath.inputs.biomodels.download_single_model |
Not calling `pypath.inputs.biomodels.download_single_model`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.biomodels.get_biomodels | 2023-06-18 18:36:08 | 2023-06-18 18:36:08 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/biomodels.py", line 165, in get_biomodels
c0.perform()
pycurl.error: (3, '')
|
{} | 2023-06-12 18:37:15 | |||
| ¶ | pypath.inputs.biomodels.get_biomodels_req | 2023-06-18 18:36:08 | 2023-06-18 18:36:09 | 0.78 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/biomodels.py", line 198, in get_biomodels_req
token = json.loads(r0.text)['token']
File "/usr/lib/python3.10/json/__init__.py", line 346, in loads
return _default_decoder.decode(s)
File "/usr/lib/python3.10/json/decoder.py", line 337, in decode
obj, end = self.raw_decode(s, idx=_w(s, 0).end())
File "/usr/lib/python3.10/json/decoder.py", line 355, in raw_decode
raise JSONDecodeError("Expecting value", s, err.value) from None
json.decoder.JSONDecodeError: Expecting value: line 1 column 1 (char 0)
|
{} | 2023-06-12 18:37:15 | |||
| ¶ | pypath.inputs.biomodels.get_single_model |
Not calling `pypath.inputs.biomodels.get_single_model`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ca1.ca1_interactions | 2023-06-18 18:36:09 | 2023-06-18 18:36:11 | 2.13 | list | [Ca1Interaction(genesymbol_source='GLYCINE', uniprot_source='NA', uniprot_mouse_source='NA', function_source='Ligand', location_source='Extracellular', genesymbol_target='NMDAR', uniprot_target='Q12879', uniprot_mouse_target='P35436', function_target='Receptor', location_target='Membrane', effect='+...(truncated) | 1,788 | {} | 2023-06-18 18:36:09 | |
| ¶ | pypath.inputs.cancercellmap.ccmap_interactions | 2023-06-18 18:36:11 | 2023-06-18 18:36:12 | 0.84 | list | [CancercellmapInteraction(source_uniprot='Q5VTT9', target_uniprot='Q96S28', directed=False, references='15262978'), CancercellmapInteraction(source_uniprot='Q5VTT9', target_uniprot='Q86YA7', directed=False, references='15262978'), CancercellmapInteraction(source_uniprot='Q5VTT9', target_uniprot='Q4T...(truncated) | 47,644 | {} | 2023-06-18 18:36:11 | |
| ¶ | pypath.inputs.cancerdrugsdb.cancerdrugsdb_annotations | 2023-06-18 18:36:12 | 2023-06-18 18:36:23 | 11.29 | dict | {'46220502': {CancerdrugsdbAnnotation(drug_label='Abemaciclib', ema_approved=True, fda_approved=True, european_national_approved=False, who_approved=False, generic=False, approval_year=2017, indications=('Advanced Breast Cancer', 'Metastatic Breast Cancer'))}, '132971': {CancerdrugsdbAnnotation(drug...(truncated) | 186 | {} | 2023-06-18 18:36:12 | |
| ¶ | pypath.inputs.cancerdrugsdb.cancerdrugsdb_download | 2023-06-18 18:36:23 | 2023-06-18 18:36:23 | 0.00 | list | [{'Product': 'Abemaciclib', 'EMA': 'Y', 'FDA': 'Y', 'EN': 'N', 'Other': '', 'WHO': 'N', 'Year': '2017', 'Generic': 'N', 'DrugBank ID': '<a href="https://go.drugbank.com/drugs/DB12001">DB12001</a>', 'ATC': 'L01EF03', 'ChEMBL': '<a href="https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL3301610"...(truncated) | 297 | {} | 2023-06-18 18:36:23 | |
| ¶ | pypath.inputs.cancerdrugsdb.cancerdrugsdb_interactions | 2023-06-18 18:36:23 | 2023-06-18 18:36:23 | 0.01 | list | [CancerdrugsdbInteraction(drug_pubchem='46220502', drug_chembl='CHEMBL3301610', drug_drugbank='DB12001', drug_label='Abemaciclib', target_uniprot='P51532', ema_approved=True, fda_approved=True, european_national_approved=False, who_approved=False, generic=False, approval_year=2017, indications=('Adv...(truncated) | 2,268 | {} | 2023-06-18 18:36:23 | |
| ¶ | pypath.inputs.cancersea.cancersea_annotations | 2023-06-18 18:36:23 | 2023-06-18 18:36:25 | 2.31 | dict | {'P37023': {CancerseaAnnotation(state='Angiogenesis')}, 'P78504': {CancerseaAnnotation(state='Inflammation'), CancerseaAnnotation(state='Metastasis'), CancerseaAnnotation(state='Angiogenesis')}, 'Q15389': {CancerseaAnnotation(state='Angiogenesis')}, 'O15123': {CancerseaAnnotation(state='Angiogenesis...(truncated) | 1,247 | {} | 2023-06-18 18:36:23 | |
| ¶ | pypath.inputs.cell.cell_supplementary |
Not calling `pypath.inputs.cell.cell_supplementary`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellcall.cellcall_annotations | 2023-06-18 18:36:25 | 2023-06-18 18:36:26 | 0.52 | dict | {'P09529': {CellcallAnnotation(role='ligand')}, 'P36896': {CellcallAnnotation(role='receptor')}, 'P47992': {CellcallAnnotation(role='ligand')}, 'P46094': {CellcallAnnotation(role='receptor')}, 'Q9Y6Y9': {CellcallAnnotation(role='ligand')}, 'O00206': {CellcallAnnotation(role='receptor')}, 'P13236': {...(truncated) | 460 | {} | 2023-06-18 18:36:25 | |
| ¶ | pypath.inputs.cellcall.cellcall_download | 2023-06-18 18:36:26 | 2023-06-18 18:36:26 | 0.04 | list | [{'Ligand_ID': '100506658', 'Receptor_ID': '100506658', 'TF_ID': '2626', 'Pathway': 'hsa04530_3,hsa04530_5', 'pathway_ID': 'hsa04530', 'Ligand_Symbol': 'OCLN', 'Receptor_Symbol': 'OCLN', 'TF_Symbol': 'GATA4'}, {'Ligand_ID': '100506658', 'Receptor_ID': '100506658', 'TF_ID': '8531', 'Pathway': 'hsa045...(truncated) | 19,144 | {} | 2023-06-18 18:36:26 | |
| ¶ | pypath.inputs.cellcall.cellcall_download_all | 2023-06-18 18:36:26 | 2023-06-18 18:36:29 | 2.96 | list | [{'Ligand_ID': '55985', 'Receptor_ID': '23832', 'TF_ID': '16150', 'Pathway': 'hsa04062_5', 'pathway_ID': 'hsa04062', 'Ligand_Symbol': 'Cxcl13', 'Receptor_Symbol': 'Xcr1', 'TF_Symbol': 'Ikbkb', 'extended': True, 'organism': 10090}, {'Ligand_ID': '55985', 'Receptor_ID': '23832', 'TF_ID': '18033', 'Pat...(truncated) | 38,645 | {} | 2023-06-18 18:36:26 | |
| ¶ | pypath.inputs.cellcall.cellcall_interactions | 2023-06-18 18:36:29 | 2023-06-18 18:36:29 | 0.11 | list | [CellcallInteraction(ligand_uniprot='P09529', receptor_uniprot='P36896', core=True), CellcallInteraction(ligand_uniprot='P47992', receptor_uniprot='P46094', core=True), CellcallInteraction(ligand_uniprot='Q9Y6Y9', receptor_uniprot='O00206', core=True), CellcallInteraction(ligand_uniprot='P13236', re...(truncated) | 797 | {} | 2023-06-18 18:36:29 | |
| ¶ | pypath.inputs.cellcellinteractions.cellcellinteractions_annotations | 2023-06-18 18:36:29 | 2023-06-18 18:36:30 | 0.77 | dict | {'Q8IVN8': {CellcellinteractionsAnnotation(mainclass='Ligand'), CellcellinteractionsAnnotation(mainclass='ECM'), CellcellinteractionsAnnotation(mainclass='Receptor')}, 'O95967': {CellcellinteractionsAnnotation(mainclass='Ligand'), CellcellinteractionsAnnotation(mainclass='ECM'), Cellcellinteractions...(truncated) | 3,425 | {} | 2023-06-18 18:36:29 | |
| ¶ | pypath.inputs.cellchatdb._cellchatdb_organism | 2023-06-18 18:36:30 | 2023-06-18 18:36:30 | 0.00 | int | 9606 | 0 | {} | 2023-06-18 18:36:30 | |
| ¶ | pypath.inputs.cellchatdb._cellchatdb_process_cofactors |
Not calling `pypath.inputs.cellchatdb._cellchatdb_process_cofactors`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellchatdb._cellchatdb_process_complexes |
Not calling `pypath.inputs.cellchatdb._cellchatdb_process_complexes`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellchatdb.cellchatdb_annotations | 2023-06-18 18:36:30 | 2023-06-18 18:36:38 | 8.51 | dict | {'P01137': {CellChatDBAnnotation(role='ligand', pathway='TGFb', category='Secreted Signaling')}, Complex TGFbR1_R2: COMPLEX:P36897_P37173: {CellChatDBAnnotation(role='receptor', pathway='TGFb', category='Secreted Signaling')}, 'P19883': {CellChatDBAnnotation(role='agonist', pathway='NODAL', category...(truncated) | 1,067 | {} | 2023-06-18 18:36:30 | |
| ¶ | pypath.inputs.cellchatdb.cellchatdb_cofactors | 2023-06-18 18:36:38 | 2023-06-18 18:36:44 | 5.40 | dict | {'ACTIVIN antagonist': {'P19883'}, 'ACTIVIN inhibition receptor': {'Q13145'}, 'ANGPT inhibition receptor 1': {'P35590'}, 'ANGPT inhibition receptor 2': {'P23467'}, 'BMP antagonist': {'P41271', 'Q9H2X0', 'Q13253', 'O75610', 'O00292', 'Q9H772', 'O60565', 'P12645'}, 'BMP inhibition receptor': {'Q13145'...(truncated) | 31 | {} | 2023-06-18 18:36:38 | |
| ¶ | pypath.inputs.cellchatdb.cellchatdb_complexes | 2023-06-18 18:36:44 | 2023-06-18 18:36:50 | 6.25 | dict | {'COMPLEX:P08476_P09529': Complex Activin AB: COMPLEX:P08476_P09529, 'COMPLEX:P05111_P08476': Complex Inhibin A: COMPLEX:P05111_P08476, 'COMPLEX:P05111_P09529': Complex Inhibin B: COMPLEX:P05111_P09529, 'COMPLEX:P29459_P29460': Complex IL12AB: COMPLEX:P29459_P29460, 'COMPLEX:P29460_Q9NPF7': Complex ...(truncated) | 153 | {} | 2023-06-18 18:36:44 | |
| ¶ | pypath.inputs.cellchatdb.cellchatdb_download | 2023-06-18 18:36:50 | 2023-06-18 18:36:56 | 5.64 | dict | {'interaction': interaction_name ... rownames TGFB1_TGFBR1_TGFBR2 TGFB1_TGFBR1_TGFBR2 ... TGFB1_TGFBR1_TGFBR2 TGFB2_TGFBR1_TGFBR2 TGFB2_TGFBR1_TGFBR2 ... TGFB2_TGFBR1_TGFBR2 TGFB3_TGFBR1_TGFBR2 TGFB3_TGFBR1_TGFBR2 ... TGFB3_TGFBR1_TGFBR2 TGFB1_ACVR1B_TGF...(truncated) | 4 | {} | 2023-06-18 18:36:50 | |
| ¶ | pypath.inputs.cellchatdb.cellchatdb_interactions | 2023-06-18 18:36:56 | 2023-06-18 18:37:01 | 5.67 | list | [CellChatDBInteraction(id_a='P01137', id_b=Complex TGFbR1_R2: COMPLEX:P36897_P37173, role_a='ligand', role_b='receptor', effect='unknown', pathway='TGFb', refs=[], category='Secreted Signaling'), CellChatDBInteraction(id_a='P19883', id_b='P01137', role_a='agonist', role_b='ligand', effect='stimulati...(truncated) | 11,113 | {} | 2023-06-18 18:36:56 | |
| ¶ | pypath.inputs.cellinker._cellinker_interactions_raw | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.33 | list | [{'Ligand_id': '1000', 'Ligand_symbol': 'CDH2', 'Ligand_location': 'Membrane', 'Receptor_id': '1000', 'Receptor_symbol': 'CDH2', 'Receptor.location': 'Membrane', 'Type': 'Cell adhesion', 'KEGG.pathway': 'hsa04514:Cell adhesion molecules (CAMs)', 'Pmubmed.ID': '32196115', 'Other.DB': '', 'LRID': 'LR0...(truncated) | 3,744 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker._cellinker_uniprots |
Not calling `pypath.inputs.cellinker._cellinker_uniprots`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellinker.cellinker_annotations | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.19 | dict | {'P08581': {CellinkerAnnotation(role='ligand', location='Membrane', type='Cell adhesion'), CellinkerAnnotation(role='receptor', location='Membrane', type='Cytokine-cytokine receptor interaction')}, 'P07949': {CellinkerAnnotation(role='receptor', location='Membrane', type='Secreted protein to recepto...(truncated) | 1,921 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_complex_annotations | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.06 | dict | {Complex: COMPLEX:O75581_Q9NPG1: {CellinkerAnnotation(role='receptor', location='Membrane', type='Secreted protein to receptor interaction')}, Complex: COMPLEX:O00144_O75197: {CellinkerAnnotation(role='receptor', location='Membrane', type='Secreted protein to receptor interaction')}, Complex: COMPLE...(truncated) | 134 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_complexes | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.00 | dict | {'COMPLEX:O75462_Q9UBD9': Complex: COMPLEX:O75462_Q9UBD9, 'COMPLEX:P14770_P40197': Complex: COMPLEX:P14770_P40197, 'COMPLEX:P01857_P0CG04': Complex: COMPLEX:P01857_P0CG04, 'COMPLEX:P29460_Q9NPF7': Complex: COMPLEX:P29460_Q9NPF7, 'COMPLEX:P29459_Q8NEV9': Complex: COMPLEX:P29459_Q8NEV9, 'COMPLEX:Q0477...(truncated) | 143 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_complexes_raw | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.00 | list | [CellinkerComplex(role='ligand', cellinker_id='CH0131', components=(CellinkerComplexComponent(genesymbol='CRLF1', entrez='9244'), CellinkerComplexComponent(genesymbol='CLCF1', entrez='23529')), location='Secreted'), CellinkerComplex(role='ligand', cellinker_id='CH0132', components=(CellinkerComplexC...(truncated) | 145 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_lr_interactions | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.05 | set | {CellinkerInteraction(ligand='P08581', receptor='P07949', ligand_location='Membrane', receptor_location='Membrane', resources=None, pmids='28536399', type='Cell adhesion'), CellinkerInteraction(ligand='P29279', receptor='O75581', ligand_location='Secreted', receptor_location='Membrane', resources=No...(truncated) | 3,812 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_lr_interactions_raw | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.01 | list | [{'Ligand_id': '1000', 'Ligand_symbol': 'CDH2', 'Ligand_location': 'Membrane', 'Receptor_id': '1000', 'Receptor_symbol': 'CDH2', 'Receptor.location': 'Membrane', 'Type': 'Cell adhesion', 'KEGG.pathway': 'hsa04514:Cell adhesion molecules (CAMs)', 'Pmubmed.ID': '32196115', 'Other.DB': '', 'LRID': 'LR0...(truncated) | 3,744 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_protein_annotations | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.06 | dict | {'P08581': {CellinkerAnnotation(role='ligand', location='Membrane', type='Cell adhesion'), CellinkerAnnotation(role='receptor', location='Membrane', type='Cytokine-cytokine receptor interaction')}, 'P07949': {CellinkerAnnotation(role='receptor', location='Membrane', type='Secreted protein to recepto...(truncated) | 1,787 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_smol_interactions | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.13 | set | {CellinkerInteraction(ligand='8629', receptor='Q13304', ligand_location=None, receptor_location='Membrane', resources='Guide2Pharma', pmids='20148890;16990797', type='sMOL-receptor interaction'), CellinkerInteraction(ligand='5202', receptor='P50406', ligand_location=None, receptor_location='Membrane...(truncated) | 314 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.cellinker_smol_interactions_raw | 2023-06-18 18:37:02 | 2023-06-18 18:37:02 | 0.00 | list | [{'ligand_pubchem_sid': '135651413', 'ligand_pubchem_cid': '5202', 'ligand name': '5-hydroxytryptamine', 'ligand_type': 'Metabolite', 'Receptor_id': '3350', 'Receptor_symbol': 'HTR1A', 'Receptor_uniprot': 'P08908', 'Receptor_location': 'Membrane', 'Type': 'sMOL-receptor interaction', 'target_species...(truncated) | 341 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellinker.components_to_complex |
Not calling `pypath.inputs.cellinker.components_to_complex`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellphonedb._cellphonedb_annotations |
Not calling `pypath.inputs.cellphonedb._cellphonedb_annotations`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellphonedb._cellphonedb_get_entity |
Not calling `pypath.inputs.cellphonedb._cellphonedb_get_entity`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellphonedb._cellphonedb_hla |
Not calling `pypath.inputs.cellphonedb._cellphonedb_hla`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cellphonedb.cellphonedb_complex_annotations | 2023-06-18 18:37:02 | 2023-06-18 18:37:04 | 1.24 | dict | {Complex Dehydroepiandrosterone_bySTS: COMPLEX:Q8TF42: CellPhoneDBAnnotation(receptor=False, receptor_class=(), peripheral=False, secreted=True, secreted_class=('secreted',), transmembrane=False, integrin=False), Complex DHEAsulfate_bySULT2B: COMPLEX:P50225: CellPhoneDBAnnotation(receptor=False, rec...(truncated) | 359 | {} | 2023-06-18 18:37:02 | |
| ¶ | pypath.inputs.cellphonedb.cellphonedb_complexes | 2023-06-18 18:37:04 | 2023-06-18 18:37:04 | 0.01 | dict | {'COMPLEX:Q8TF42': Complex Dehydroepiandrosterone_bySTS: COMPLEX:Q8TF42, 'COMPLEX:P50225': Complex DHEAsulfate_bySULT2B: COMPLEX:P50225, 'COMPLEX:Q9H8P0': Complex Dihydrotestosterone_bySRD5A3: COMPLEX:Q9H8P0, 'COMPLEX:P18405': Complex Dihydrotestosterone_bySRD5A1: COMPLEX:P18405, 'COMPLEX:P31213': C...(truncated) | 359 | {} | 2023-06-18 18:37:04 | |
| ¶ | pypath.inputs.cellphonedb.cellphonedb_interactions | 2023-06-18 18:37:04 | 2023-06-18 18:37:04 | 0.85 | list | [CellphonedbInteraction(id_a=Complex 12oxoLeukotrieneB4_byPTGR1: COMPLEX:Q14914, id_b='Q15722', sources='CellPhoneDB', references='', interaction_type='ligand-receptor', type_a='ligand', type_b='receptor'), CellphonedbInteraction(id_a=Complex 12oxoLeukotrieneB4_byPTGR1: COMPLEX:Q14914, id_b='Q9NPC1'...(truncated) | 2,915 | {} | 2023-06-18 18:37:04 | |
| ¶ | pypath.inputs.cellphonedb.cellphonedb_ligands_receptors | 2023-06-18 18:37:04 | 2023-06-18 18:37:05 | 0.03 | tuple | ({'P55773', 'Q01638', Complex Estradiol_byHSD17B1: COMPLEX:P14061, Complex GABA_byGAD1_and_SLC6A6: COMPLEX:P31641_Q99259, 'P18627', 'P04808', 'P01215', Complex LeukotrieneE4_byDPEP1: COMPLEX:P16444, 'P48067', 'P53985', 'P47992', 'P17931', 'Q9BQ51', 'Q9UBV4', 'Q07325', 'Q9BXY4', 'P05014', 'Q6UWQ7', '...(truncated) | 2 | {} | 2023-06-18 18:37:04 | |
| ¶ | pypath.inputs.cellphonedb.cellphonedb_protein_annotations | 2023-06-18 18:37:05 | 2023-06-18 18:37:05 | 0.02 | dict | {'P03372': CellPhoneDBAnnotation(receptor=True, receptor_class=('receptor',), peripheral=True, secreted=False, secreted_class=(), transmembrane=False, integrin=False), 'Q92753': CellPhoneDBAnnotation(receptor=True, receptor_class=('receptor',), peripheral=False, secreted=False, secreted_class=(), tr...(truncated) | 1,354 | {} | 2023-06-18 18:37:05 | |
| ¶ | pypath.inputs.celltalkdb.celltalkdb_annotations | 2023-06-18 18:37:05 | 2023-06-18 18:37:21 | 16.41 | dict | {'Q13275': {CellTalkDBAnnotation(role='ligand', pmid='26156437'), CellTalkDBAnnotation(role='ligand', pmid='9883722'), CellTalkDBAnnotation(role='ligand', pmid='15721238')}, 'P51805': {CellTalkDBAnnotation(role='receptor', pmid='32196115'), CellTalkDBAnnotation(role='receptor', pmid='15721238')}, 'Q...(truncated) | 1,598 | {} | 2023-06-18 18:37:05 | |
| ¶ | pypath.inputs.celltalkdb.celltalkdb_download | 2023-06-18 18:37:21 | 2023-06-18 18:37:21 | 0.00 | list | [CellTalkDbRecord(lr_pair='SEMA3F_PLXNA3', ligand_gene_symbol='SEMA3F', receptor_gene_symbol='PLXNA3', ligand_gene_id='6405', receptor_gene_id='55558', ligand_ensembl_protein_id='ENSP00000002829', receptor_ensembl_protein_id='ENSP00000358696', ligand_ensembl_gene_id='ENSG00000001617', receptor_ensem...(truncated) | 3,398 | {} | 2023-06-18 18:37:21 | |
| ¶ | pypath.inputs.celltalkdb.celltalkdb_interactions | 2023-06-18 18:37:21 | 2023-06-18 18:37:21 | 0.01 | list | [CellTalkDBInteraction(ligand_genesymbol='SEMA3F', receptor_genesymbol='PLXNA3', reference='15721238'), CellTalkDBInteraction(ligand_genesymbol='SEMA3F', receptor_genesymbol='PLXNA1', reference='26156437'), CellTalkDBInteraction(ligand_genesymbol='SEMA3F', receptor_genesymbol='NRP1', reference='9883...(truncated) | 3,398 | {} | 2023-06-18 18:37:21 | |
| ¶ | pypath.inputs.celltypist.celltypist_annotations | 2023-06-18 18:37:21 | 2023-06-18 18:37:21 | 0.29 | dict | {'P11836': {CelltypistAnnotation(cell_type='B cells', cell_subtype='B cells', cell_ontology='CL:0000236', marker_type='curated_marker', tissues=('Blood', 'Eye', 'Intestine', 'Kidney', 'Liver', 'Lung', 'Trachea'), datasets=('Braga et al. 2019', 'Martin et al. 2019', 'Miller et al. 2020', 'Popescu et ...(truncated) | 459 | {} | 2023-06-18 18:37:21 | |
| ¶ | pypath.inputs.chembl.chembl_activities |
Not calling `pypath.inputs.chembl.chembl_activities`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.chembl.chembl_documents | 2023-06-18 18:37:21 | 2023-06-18 18:38:38 | 77.05 | dict | {'CHEMBL1139451': 14695813, 'CHEMBL1148466': 14695814, 'CHEMBL1139452': 14695824, 'CHEMBL1139453': 14695825, 'CHEMBL1139454': 14695826, 'CHEMBL1139455': 14695827, 'CHEMBL1139456': 14695815, 'CHEMBL1139457': 14695828, 'CHEMBL1139458': 14695816, 'CHEMBL1148467': 14695833, 'CHEMBL1139459': 14695834, 'C...(truncated) | 80,293 | {} | 2023-06-18 18:37:21 | |
| ¶ | pypath.inputs.chembl.chembl_drug_indications | 2023-06-18 18:38:38 | 2023-06-18 18:39:32 | 53.19 | list | [ChemblIndication(efo_id='EFO:0000404', efo_term='diffuse scleroderma', max_phase=2.0, mesh_heading='Scleroderma, Diffuse', mesh_id='D045743', molecule_chembl='CHEMBL1201823'), ChemblIndication(efo_id='EFO:0000685', efo_term='rheumatoid arthritis', max_phase=4.0, mesh_heading='Arthritis, Rheumatoid'...(truncated) | 51,582 | {} | 2023-06-18 18:38:38 | |
| ¶ | pypath.inputs.chembl.chembl_mechanisms | 2023-06-18 18:39:32 | 2023-06-18 18:39:40 | 8.75 | list | [ChemblMechanism(action_type='INHIBITOR', direct_interaction=True, disease_efficacy=True, mechanism_of_action='Carbonic anhydrase VII inhibitor', chembl='CHEMBL19', target_chembl='CHEMBL2326'), ChemblMechanism(action_type='INHIBITOR', direct_interaction=True, disease_efficacy=True, mechanism_of_acti...(truncated) | 7,098 | {} | 2023-06-18 18:39:32 | |
| ¶ | pypath.inputs.chembl.chembl_targets | 2023-06-18 18:39:40 | 2023-06-18 18:41:40 | 119.53 | list | [ChemblTarget(accession='O43451', target_chembl_id='CHEMBL2074'), ChemblTarget(accession='O60706', target_chembl_id='CHEMBL1971'), ChemblTarget(accession='O76074', target_chembl_id='CHEMBL1827'), ChemblTarget(accession='O95180', target_chembl_id='CHEMBL1859'), ChemblTarget(accession='O96760', target...(truncated) | 15,398 | {} | 2023-06-18 18:39:40 | |
| ¶ | pypath.inputs.clinvar.clinvar_citations | 2023-06-18 18:41:40 | 2023-06-18 18:42:04 | 24.52 | list | [Citation(allele='2129094', variation_id='2067703', nsv='', citation_source='PubMed', citation_id='28492532'), Citation(allele='47949', variation_id='634351', nsv='', citation_source='PubMedCentral', citation_id='5474211'), Citation(allele='1623575', variation_id='1570259', nsv='', citation_source='...(truncated) | 2,715,961 | {} | 2023-06-18 18:41:40 | |
| ¶ | pypath.inputs.clinvar.clinvar_raw | 2023-06-18 18:42:08 | 2023-06-18 18:44:36 | 148.03 | list | [Variant(allele='302562', type='single nucleotide variant', variant='NM_000337.6(SGCD):c.*2604T>C', entrez='6444', genesymbol='SGCD', clinical_significance='Uncertain significance', review_status='criteria provided, multiple submitters, no conflicts', rs='541571525', phenotype_ids=('MONDO:MONDO:0016...(truncated) | 4,464,832 | {} | 2023-06-18 18:42:08 | |
| ¶ | pypath.inputs.collectri.collectri_interactions | 2023-06-18 18:56:16 | 2023-06-18 18:56:19 | 3.28 | list | [CollectriInteraction(tf='P01106', target='O14746', effect=1, tf_category='dbTF', resources='ExTRI;HTRI;TRRUST;TFactS;NTNU.Curated;Pavlidis2021;DoRothEA-A', pubmed='10022128;10491298;10606235;10637317;10723141;10786671;10914736;11274400;11279234;11287602;11435602;11606399;11916966;12044867;12646176;...(truncated) | 64,969 | {} | 2023-06-18 18:56:16 | |
| ¶ | pypath.inputs.collectri.collectri_raw | 2023-06-18 18:56:19 | 2023-06-18 18:56:20 | 0.09 | list | [CollectriRecord(tf='MYC', target='TERT', effect=1, tf_category='dbTF', resources='ExTRI;HTRI;TRRUST;TFactS;NTNU.Curated;Pavlidis2021;DoRothEA-A', pubmed='10022128;10491298;10606235;10637317;10723141;10786671;10914736;11274400;11279234;11287602;11435602;11606399;11916966;12044867;12646176;12695333;1...(truncated) | 43,416 | {} | 2023-06-18 18:56:19 | |
| ¶ | pypath.inputs.compleat.compleat_complexes | 2023-06-18 18:56:20 | 2023-06-18 18:56:21 | 1.08 | dict | {'COMPLEX:O00161_O14662_O15400_O43752_O75379_P0CG48_P46459_P51809_P54920_Q12846_Q15836_Q8N1B4_Q96AJ9_Q9BV40_Q9UNK0': Complex: COMPLEX:O00161_O14662_O15400_O43752_O75379_P0CG48_P46459_P51809_P54920_Q12846_Q15836_Q8N1B4_Q96AJ9_Q9BV40_Q9UNK0, 'COMPLEX:O43681_O75396_P0CG48_P11441_Q7L5D6_Q8NEP3_Q96DZ5_Q9...(truncated) | 9,693 | {'size': -1} | 2023-06-18 18:56:20 | |
| ¶ | pypath.inputs.compleat.compleat_raw | 2023-06-18 18:56:21 | 2023-06-18 18:56:21 | 0.05 | list | [{'compleat_id': 'HC4831', 'member_count': '15', 'predicted': 'Predicted', 'functions': 'protein transport', 'functions2': 'protein transport;cellular membrane fusion;Golgi vesicle transport;vesicle-mediated transport;intracellular transport', 'nothing': '', 'sources': 'NetworkBlast', 'name': '', 'm...(truncated) | 9,704 | {} | 2023-06-18 18:56:21 | |
| ¶ | pypath.inputs.complexportal.complexportal_complexes | 2023-06-18 18:56:21 | 2023-06-18 18:57:38 | 77.19 | dict | {'COMPLEX:P54274_Q15554_Q96AP0_Q9BSI4_Q9NUX5_Q9NYB0': Complex Shelterin complex: COMPLEX:P54274_Q15554_Q96AP0_Q9BSI4_Q9NUX5_Q9NYB0, 'COMPLEX:Q86XT2_Q99816_Q9NZ09_Q9UK41': Complex ESCRT-I complex, VPS37D-UBAP1 variant: COMPLEX:Q86XT2_Q99816_Q9NZ09_Q9UK41, 'COMPLEX:Q86XE3_Q8NE86_Q9BPX6_Q9H4I9': Comple...(truncated) | 1,620 | {} | 2023-06-18 18:56:21 | |
| ¶ | pypath.inputs.comppi.comppi_interaction_locations | 2023-06-18 18:57:38 | 2023-06-18 18:57:54 | 15.25 | list | [ComppiInteraction(id_a='Q8TES7', id_b='O75478', loc_a=(ComppiLocation(location='cytosol', score=0.8), ComppiLocation(location='nucleus', score=0.7)), loc_b=(ComppiLocation(location='nucleus', score=0.8),)), ComppiInteraction(id_a='Q8TES7', id_b='O75478', loc_a=(ComppiLocation(location='cytosol', sc...(truncated) | 589,097 | {} | 2023-06-18 18:57:38 | |
| ¶ | pypath.inputs.comppi.comppi_locations | 2023-06-18 18:57:54 | 2023-06-18 18:58:10 | 16.85 | dict | {'Q8TES7': {ComppiLocation(location='cytosol', score=0.8), ComppiLocation(location='membrane', score=0.96), ComppiLocation(location='nucleus', score=0.9099999999999999), ComppiLocation(location='cytosol', score=0.9099999999999999), ComppiLocation(location='cytosol', score=0.99997984), ComppiLocation...(truncated) | 18,254 | {} | 2023-06-18 18:57:54 | |
| ¶ | pypath.inputs.connectomedb.connectomedb_annotations | 2023-06-18 18:58:10 | 2023-06-18 18:58:12 | 1.85 | dict | {'P01023': {ConnectomedbAnnotation(role='ligand', location='secreted')}, 'Q07954': {ConnectomedbAnnotation(role='receptor', location='plasma membrane')}, 'Q16613': {ConnectomedbAnnotation(role='ligand', location='secreted')}, 'P48039': {ConnectomedbAnnotation(role='receptor', location='plasma membra...(truncated) | 1,428 | {} | 2023-06-18 18:58:10 | |
| ¶ | pypath.inputs.connectomedb.connectomedb_interactions | 2023-06-18 18:58:12 | 2023-06-18 18:58:12 | 0.01 | list | [ConnectomedbInteraction(ligand='A2M', ligand_location=['secreted'], receptor='LRP1', references=['1702392', '10652313', '12194978']), ConnectomedbInteraction(ligand='AANAT', ligand_location=['secreted'], receptor='MTNR1A', references=['12943195']), ConnectomedbInteraction(ligand='AANAT', ligand_loc...(truncated) | 2,293 | {} | 2023-06-18 18:58:12 | |
| ¶ | pypath.inputs.corum.corum_complexes | 2023-06-18 18:58:12 | 2023-06-18 18:58:13 | 0.57 | dict | {'COMPLEX:P41182_P56524': Complex BCL6-HDAC4 complex: COMPLEX:P41182_P56524, 'COMPLEX:P41182_Q9UQL6': Complex BCL6-HDAC5 complex: COMPLEX:P41182_Q9UQL6, 'COMPLEX:P41182_Q8WUI4': Complex BCL6-HDAC7 complex: COMPLEX:P41182_Q8WUI4, 'COMPLEX:Q09472_Q92793_Q92831_Q9Y6Q9': Complex Multisubunit ACTR coacti...(truncated) | 2,734 | {} | 2023-06-18 18:58:12 | |
| ¶ | pypath.inputs.cosmic.cancer_gene_census_annotations | 2023-06-18 18:58:13 | 2023-06-18 18:58:15 | 2.37 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cosmic.py", line 137, in cancer_gene_census_annotations
data = csv.DictReader(c.fileobj, delimiter = ',')
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 18:55:36 | |||
| ¶ | pypath.inputs.cpad.cpad_annotations | 2023-06-18 18:58:15 | 2023-06-18 18:58:21 | 5.65 | dict | {'Q16181': {CpadAnnotation(regulator_type='protein', effect_on_pathway='Upregulation', pathway='Actin cytoskeleton pathway', effect_on_cancer='Inhibiting', effect_on_cancer_outcome='inhibit glioma cell migration', cancer='Glioma', pathway_category='Regulation of actin cytoskeleton')}, 'MIMAT0000431'...(truncated) | 1,038 | {'size': 1} | 2023-06-18 18:58:15 | |
| ¶ | pypath.inputs.cpad.cpad_pathway_cancer | 2023-06-18 18:58:21 | 2023-06-18 18:58:21 | 0.05 | tuple | ({'Glioma': {CpadPathwayCancer(pathway='Mitochondrial dependent caspase pathway', cancer='Glioma', pathway_category='Apoptosis', effect_on_cancer='Activating', effect_on_cancer_outcome='attributable to apoptosis'), CpadPathwayCancer(pathway='Fanconi anemia signaling pathway', cancer='Glioma', pathwa...(truncated) | 2 | {} | 2023-06-18 18:58:21 | |
| ¶ | pypath.inputs.cpad.get_cpad | 2023-06-18 18:58:21 | 2023-06-18 18:58:21 | 0.04 | list | [{'Regulator': 'NULL', 'Regulator_Type': 'NULL', 'Pathway': '5-LO/LTA4 hydrolase pathway', 'Pathway_Category': 'Others', 'KEGG_ID': 'NULL', 'Regulation_Type': 'Inhibiting', 'Cancer': 'Glioma', 'ID': 'H00042', 'Outcome_Description': 'partial suppression of tumor growth', 'Description': 'We confirmed ...(truncated) | 4,709 | {} | 2023-06-18 18:58:21 | |
| ¶ | pypath.inputs.cpdb.cpdb_interactions | 2023-06-18 18:58:21 | 2023-06-18 18:58:28 | 6.65 | list | [['SUMF2_HUMAN', 'SUMF1_HUMAN', 'Reactome', ''], ['ANPRA_HUMAN', 'ANF_HUMAN', 'PhosphoPOINT,Reactome,HPRD,Spike,Biogrid', '1660465,16713569,12547834'], ['ANFC_HUMAN', 'ANPRB_HUMAN', 'HPRD,Reactome,PhosphoPOINT,Biogrid', '1660465,12709393,1672777,1309330'], ['STIM1_HUMAN', 'TRPC1_HUMAN', 'DIP,Reactom...(truncated) | 531,371 | {} | 2023-06-18 18:58:21 | |
| ¶ | pypath.inputs.cpdb.cpdb_interactions_ltp | 2023-06-18 18:58:28 | 2023-06-18 18:58:31 | 2.98 | list | [['SUMF2_HUMAN', 'SUMF1_HUMAN', 'Reactome', ''], ['ANPRA_HUMAN', 'ANF_HUMAN', 'PhosphoPOINT,Reactome,HPRD,Spike,Biogrid', '1660465,16713569,12547834'], ['ANFC_HUMAN', 'ANPRB_HUMAN', 'HPRD,Reactome,PhosphoPOINT,Biogrid', '1660465,12709393,1672777,1309330'], ['STIM1_HUMAN', 'TRPC1_HUMAN', 'DIP,Reactom...(truncated) | 482,222 | {} | 2023-06-18 18:58:28 | |
| ¶ | pypath.inputs.credentials.credentials |
Not calling `pypath.inputs.credentials.credentials`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cspa.cspa_annotations | 2023-06-18 18:58:31 | 2023-06-18 18:58:32 | 0.85 | dict | {'P08473': {CspaAnnotation(high_confidence=True, n_cell_types=29, tm=1, gpi=0, uniprot_cell_surface=True)}, 'Q92854': {CspaAnnotation(high_confidence=True, n_cell_types=26, tm=1, gpi=0, uniprot_cell_surface=True)}, 'Q93033': {CspaAnnotation(high_confidence=True, n_cell_types=6, tm=1, gpi=0, uniprot_...(truncated) | 1,446 | {} | 2023-06-18 18:58:31 | |
| ¶ | pypath.inputs.cspa.cspa_cell_type_annotations | 2023-06-18 18:58:32 | 2023-06-18 18:58:33 | 0.92 | dict | {'A1A5B4': {CspaCellType(cell_type='HDLM2', value=16.69533), CspaCellType(cell_type='CD4pCD25n_Tcells', value=18.59847), CspaCellType(cell_type='ZL55', value=18.74705), CspaCellType(cell_type='HBL1', value=17.03274), CspaCellType(cell_type='NK', value=16.32343), CspaCellType(cell_type='MedB1', value...(truncated) | 1,407 | {} | 2023-06-18 18:58:32 | |
| ¶ | pypath.inputs.cspa.cspa_cell_types | 2023-06-18 18:58:33 | 2023-06-18 18:58:34 | 0.71 | dict | {'A431': {'A1A5B4': 16.56885, 'A1A5C7': None, 'P0DN37': None, 'A0A0B4J2A2': None, 'A2RU67': None, 'A2VDJ0': None, 'A6NGN9': None, 'A6NI73': None, 'A6NKL6': None, 'A6NMZ7': 16.08666, 'A7MBM2': 15.11804, 'A8MVW0': None, 'A8MVW5': None, 'A8MWY0': None, 'A8TX70': None, 'O00116': None, 'O00206': 15.9843,...(truncated) | 47 | {} | 2023-06-18 18:58:33 | |
| ¶ | pypath.inputs.ctdbase._ctdbase_download |
Not calling `pypath.inputs.ctdbase._ctdbase_download`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ctdbase._map_keys |
Not calling `pypath.inputs.ctdbase._map_keys`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ctdbase._modify_dict |
Not calling `pypath.inputs.ctdbase._modify_dict`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ctdbase.ctdbase_relations |
Not calling `pypath.inputs.ctdbase.ctdbase_relations`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ctdbase.ctdbase_vocabulary |
Not calling `pypath.inputs.ctdbase.ctdbase_vocabulary`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.cytosig.cytosig_annotations | 2023-06-18 18:58:34 | 2023-06-18 18:58:37 | 3.02 | dict | {'Q9NPC4': {CytosigAnnotation(cytokine='P29965', score=0.0644523531588907, cytokine_genesymbol='CD40L', target_genesymbol='A4GALT'), CytosigAnnotation(cytokine='P05231', score=0.0084669266516721, cytokine_genesymbol='IL6', target_genesymbol='A4GALT'), CytosigAnnotation(cytokine='P23560', score=0.0, ...(truncated) | 4,889 | {} | 2023-06-18 18:58:34 | |
| ¶ | pypath.inputs.cytosig.cytosig_df | 2023-06-18 18:58:37 | 2023-06-18 18:58:37 | 0.04 | DataFrame | Activin A BDNF BMP2 ... TWEAK VEGFA WNT3A A4GALT -0.135495 0.000000 -0.018502 ... 0.019689 -0.102361 0.013743 AAGAB 0.307167 0.074810 -0.070991 ... 0.077434 -0.009463 -0.005953 AAK1 -0.120398 -0.076692 -0.003144 ... -0.025428 0.020631 -0.045658 AAMDC ...(truncated) | 4,881 | {} | 2023-06-18 18:58:37 | |
| ¶ | pypath.inputs.dbptm.dbptm_enzyme_substrate | 2023-06-18 18:58:37 | 2023-06-18 18:58:40 | 3.01 | list | [{'substrate': 'P30443', 'kinase': None, 'resnum': 110, 'resaa': 'N', 'start': 104, 'end': 116, 'instance': 'TLRGYYNQSEDGS', 'typ': 'n-linked glycosylation', 'source': 'Swiss-Prot', 'references': ['19159218']}, {'substrate': 'P01892', 'kinase': None, 'resnum': 110, 'resaa': 'N', 'start': 104, 'end':...(truncated) | 223,135 | {} | 2023-06-18 18:58:37 | |
| ¶ | pypath.inputs.dbptm.dbptm_enzyme_substrate_old | 2023-06-18 18:58:41 | 2023-06-18 18:58:43 | 2.16 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/dbptm.py", line 102, in dbptm_enzyme_substrate_old
for k, data in iteritems(extra):
File "/home/omnipath/.cache/pypoetry/virtualenvs/pypath-omnipath-n4bD4ZOW-py3.10/lib/python3.10/site-packages/future/utils/__init__.py", line 314, in iteritems
func = obj.items
AttributeError: 'NoneType' object has no attribute 'items'
|
{} | 2023-06-12 18:56:01 | |||
| ¶ | pypath.inputs.dbptm.dbptm_interactions | 2023-06-18 18:58:43 | 2023-06-18 18:58:44 | 1.41 | list | [['PKA', 'P63104', '11956222;12865427;15883165;16376338'], ['PKB', 'P63104', '11956222;12865427;15883165;16376338'], ['MAPK8', 'P63104', '15071501;15696159'], ['CDK1', 'P11171', '2171679;15525677;18220336;18669648'], ['MAPK1', 'Q13541', '12747827;17081983;17287340;18187866;18669648'], ['CK2', 'P0506...(truncated) | 2,071 | {} | 2023-06-18 18:58:43 | |
| ¶ | pypath.inputs.deathdomain.deathdomain_interactions | 2023-06-18 18:58:44 | 2023-06-18 18:58:45 | 0.84 | list | [] | 0 | {} | 2023-06-18 18:58:44 | |
| ¶ | pypath.inputs.deathdomain.deathdomain_interactions_rescued | 2023-06-18 18:58:45 | 2023-06-18 18:58:45 | 0.15 | list | [['Apaf1', 'Caspase9', 'GST fusion protein pull-down;In vitro purification protein assembly(Size-exclusion chromatography);Yeast two-hybrid;Co-immunoprecipitation;Size-exclusion chromatography;Structure;Gel filtration;β-galactosidase staining;DAPI staining;Caspase cleaved assay', '9390557;9922454;11...(truncated) | 184 | {} | 2023-06-18 18:58:45 | |
| ¶ | pypath.inputs.depod.depod_enzyme_substrate | 2023-06-18 18:58:45 | 2023-06-18 18:58:46 | 0.09 | list | [{'instance': None, 'kinase': 'P08575', 'resaa': 'Y', 'resnum': 1054, 'references': ['11201744'], 'substrate': 'P29597', 'start': None, 'end': None, 'typ': 'dephosphorylation'}, {'instance': None, 'kinase': 'P08575', 'resaa': 'Y', 'resnum': 1055, 'references': ['11201744'], 'substrate': 'P29597', 's...(truncated) | 537 | {} | 2023-06-18 18:58:45 | |
| ¶ | pypath.inputs.depod.depod_interactions | 2023-06-18 18:58:46 | 2023-06-18 18:58:46 | 0.01 | list | [('P15309', 'P04626', '11067847|9705354', '2', 'dephosphorylation reaction'), ('Q9BZG2', 'Q15303', '15219672', '1', 'dephosphorylation reaction'), ('P05186', 'P0C0S8', '6167574', '1', 'dephosphorylation reaction'), ('P05186', 'Q92934', 'PMC3005908', '1', 'dephosphorylation reaction'), ('P49593', 'Q1...(truncated) | 832 | {} | 2023-06-18 18:58:46 | |
| ¶ | pypath.inputs.dgidb.dgidb_annotations | 2023-06-18 18:58:46 | 2023-06-18 18:58:48 | 2.17 | dict | {'Q9BXS1': {DgidbAnnotation(category='ENZYME')}, 'Q9BZH6': {DgidbAnnotation(category='TRANSCRIPTION FACTOR')}, 'Q96Q89': {DgidbAnnotation(category='ENZYME')}, 'Q99470': {DgidbAnnotation(category='DRUGGABLE GENOME')}, 'Q9H211': {DgidbAnnotation(category='KINASE')}, 'O95069': {DgidbAnnotation(category...(truncated) | 10,494 | {} | 2023-06-18 18:58:46 | |
| ¶ | pypath.inputs.dgidb.dgidb_interactions | 2023-06-18 18:58:48 | 2023-06-18 18:58:53 | 5.15 | list | [DgidbInteraction(genesymbol='LHCGR', entrez='3973', resource='ChemblInteractions', type='agonist', drug_name='HUMAN LH', drug_chembl='chembl:CHEMBL1201697', score='5.3', pmid=None), DgidbInteraction(genesymbol='WRN', entrez='7486', resource='DTC', type=None, drug_name='EPIRUBICIN HYDROCHLORIDE', dr...(truncated) | 85,022 | {} | 2023-06-18 18:58:48 | |
| ¶ | pypath.inputs.dgidb.get_dgidb_old | 2023-06-18 18:58:53 | 2023-06-18 18:59:57 | 63.62 | set | {'Q8IZY2', 'Q9UKU6', 'P48067', 'Q01726', 'P36021', 'P58872', 'O75943', 'Q9BZJ8', 'Q8NBS3', 'P01008', 'Q13263', 'Q8TBP6', 'O94759', 'P63126', 'Q16674', 'Q15116', 'Q695T7', 'P47895', 'P09525', 'O95279', 'Q9UK80', 'Q15506', 'Q6PXP3', 'P04234', 'P16422', 'O75746', 'Q15466', 'P48764', 'Q9UNW8', 'Q9NYB5',...(truncated) | 5,907 | {} | 2023-06-18 18:58:53 | |
| ¶ | pypath.inputs.dip.dip_interactions | 2023-06-18 18:59:57 | 2023-06-18 18:59:57 | 0.60 | list | [['P01730', 'P01730', '9168119;9168119', 'direct interaction', 'x-ray crystallography;protein cross-linking with a bifunctional reagent', 'DIP-42E'], ['P29375', 'P06400', '8414517;22615382;22615382', 'physical interaction;physical association', 'biochemical;anti bait coimmunoprecipitation', 'DIP-214...(truncated) | 2,283 | {} | 2023-06-18 18:59:57 | |
| ¶ | pypath.inputs.dip.dip_login |
Not calling `pypath.inputs.dip.dip_login`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.disgenet.wrapper |
Not calling `pypath.inputs.disgenet.wrapper`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.disgenet.wrapper |
Not calling `pypath.inputs.disgenet.wrapper`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.disgenet.wrapper |
Not calling `pypath.inputs.disgenet.wrapper`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.domino.domino_ddi | 2023-06-18 18:59:57 | 2023-06-18 19:00:02 | 4.82 | list | [<pypath.internals.intera.DomainDomain object at 0x7f5e9f53e200>, <pypath.internals.intera.DomainDomain object at 0x7f5e9f53e6b0>, <pypath.internals.intera.DomainDomain object at 0x7f5e9f53e170>, <pypath.internals.intera.DomainDomain object at 0x7f5e9f53cd90>, <pypath.internals.intera.DomainDomain o...(truncated) | 1,294 | {} | 2023-06-18 18:59:57 | |
| ¶ | pypath.inputs.domino.domino_enzsub | 2023-06-18 19:00:02 | 2023-06-18 19:00:03 | 1.01 | dict | {'ddi': [<pypath.internals.intera.DomainDomain object at 0x7f5e9eae8be0>, <pypath.internals.intera.DomainDomain object at 0x7f5e9eaea890>, <pypath.internals.intera.DomainDomain object at 0x7f5e9eae8190>, <pypath.internals.intera.DomainDomain object at 0x7f5e9eae8280>, <pypath.internals.intera.Domain...(truncated) | 2 | {} | 2023-06-18 19:00:02 | |
| ¶ | pypath.inputs.domino.domino_interactions | 2023-06-18 19:00:03 | 2023-06-18 19:00:04 | 0.42 | list | [DominoRecord(uniprot_A='A4GZ26', uniprot_B='Q8BKX1', isoform_A='1', isoform_B='1', exp_method='two hybrid', references='10.1016/j.brainres.2008.11.061', taxon_A='10090', taxon_B='10090', role_A='physical association', role_B='unspecified role', binding_site_range_A='1424-1434', binding_site_range_B...(truncated) | 6,687 | {} | 2023-06-18 19:00:03 | |
| ¶ | pypath.inputs.domino.get_domino | 2023-06-18 19:00:04 | 2023-06-18 19:00:04 | 0.40 | list | [DominoRecord(uniprot_A='O00459', uniprot_B='', isoform_A='1', isoform_B='', exp_method='', references='', taxon_A='9606', taxon_B='', role_A='mint', role_B='neutral component', binding_site_range_A='4-80', binding_site_range_B='', domains_A='', domains_B='', ptm_residue_A='', ptm_residue_B='', ptm_...(truncated) | 14,539 | {} | 2023-06-18 19:00:04 | |
| ¶ | pypath.inputs.dorothea._process_resources |
Not calling `pypath.inputs.dorothea._process_resources`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.dorothea.dorothea_full_raw | 2023-06-18 19:00:04 | 2023-06-18 19:00:13 | 9.38 | DataFrame | tf target mor ... which_inferred which_tfbs pubmed_id 0 ADNP AASDH 0.0 ... gtex none - 1 ADNP AASDHPPT 0.0 ... gtex none - 2 ADNP ABCB10 0.0 ... gtex none - 3 ADN...(truncated) | 1,019,220 | {} | 2023-06-18 19:00:04 | |
| ¶ | pypath.inputs.dorothea.dorothea_interactions | 2023-06-18 19:00:14 | 2023-06-18 19:00:28 | 14.74 | list | [DorotheaInteraction(tf='ADNP', target='ABCC1', effect=0, level='D', curated=False, chipseq=True, predicted=False, coexp=False, curated_sources='', chipseq_sources='ReMap', predicted_sources='', coexp_sources='', all_sources='ReMap', pubmed='', kegg_pathways=''), DorotheaInteraction(tf='ADNP', targe...(truncated) | 309,009 | {} | 2023-06-18 19:00:14 | |
| ¶ | pypath.inputs.dorothea.dorothea_old_csv | 2023-06-18 19:00:28 | 2023-06-18 19:00:29 | 0.51 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 867, in test_input
for i, rec in enumerate(value_gen):
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/dorothea.py", line 214, in dorothea_old_csv
reader = csv.DictReader(c.result['database.csv'])
TypeError: 'NoneType' object is not subscriptable
|
{} | 2023-06-12 18:58:05 | |||
| ¶ | pypath.inputs.dorothea.dorothea_old_csv | 2023-06-18 19:00:29 | 2023-06-18 19:00:29 | 0.26 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 867, in test_input
for i, rec in enumerate(value_gen):
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/dorothea.py", line 214, in dorothea_old_csv
reader = csv.DictReader(c.result['database.csv'])
TypeError: 'NoneType' object is not subscriptable
|
{} | 2023-06-12 18:58:05 | |||
| ¶ | pypath.inputs.dorothea.dorothea_rda_raw | 2023-06-18 19:00:29 | 2023-06-18 19:00:32 | 2.80 | DataFrame | tf confidence target mor 0 ADNP D ATF7IP 1.0 1 ADNP D DYRK1A 1.0 2 ADNP D TLK1 1.0 3 ADNP D ZMYM4 1.0 4 ADNP D ABCC1 1.0 ... ... ... ... ... 454499 ZZZ3 D ZBTB20 1.0 4545...(truncated) | 454,504 | {} | 2023-06-18 19:00:29 | |
| ¶ | pypath.inputs.dorothea.get_dorothea_old | 2023-06-18 19:00:32 | 2023-06-18 19:00:32 | 0.32 | list | [['AHR', 'CYP1A1', '0', 'A', True, False, True, False, 'HTRIdb,trrust_signed', '', 'hocomoco_v11', '', 'HTRIdb,trrust_signed,hocomoco_v11'], ['AHR', 'CYP1A2', '0', 'A', True, False, False, False, 'HTRIdb,trrust_signed', '', '', '', 'HTRIdb,trrust_signed'], ['AHR', 'CYP1B1', '0', 'A', True, False, Tr...(truncated) | 14,260 | {} | 2023-06-18 19:00:32 | |
| ¶ | pypath.inputs.dorothea.dorothea_rda_raw | 2023-06-18 19:00:32 | 2023-06-18 19:00:33 | 1.24 | DataFrame | tf confidence target mor 0 ADNP D ATF7IP 1.0 1 ADNP D DYRK1A 1.0 2 ADNP D TLK1 1.0 3 ADNP D ZMYM4 1.0 4 ADNP D ABCC1 1.0 ... ... ... ... ... 454499 ZZZ3 D ZBTB20 1.0 4545...(truncated) | 454,504 | {} | 2023-06-18 19:00:32 | |
| ¶ | pypath.inputs.dorothea.dorothea_interactions | 2023-06-18 19:00:33 | 2023-06-18 19:00:48 | 14.27 | list | [DorotheaInteraction(tf='ADNP', target='ABCC1', effect=0, level='D', curated=False, chipseq=True, predicted=False, coexp=False, curated_sources='', chipseq_sources='ReMap', predicted_sources='', coexp_sources='', all_sources='ReMap', pubmed='', kegg_pathways=''), DorotheaInteraction(tf='ADNP', targe...(truncated) | 309,009 | {} | 2023-06-18 19:00:33 | |
| ¶ | pypath.inputs.dorothea.dorothea_old_csv | 2023-06-18 19:00:48 | 2023-06-18 19:00:48 | 0.09 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 867, in test_input
for i, rec in enumerate(value_gen):
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/dorothea.py", line 214, in dorothea_old_csv
reader = csv.DictReader(c.result['database.csv'])
TypeError: 'NoneType' object is not subscriptable
|
{} | 2023-06-12 18:58:05 | |||
| ¶ | pypath.inputs.drugbank._drugbank_credentials | 2023-06-18 19:00:48 | 2023-06-18 19:00:48 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/drugbank.py", line 55, in _drugbank_credentials
return credentials.credentials(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/credentials.py", line 120, in credentials
raise RuntimeError(msg)
RuntimeError: Failed to obtain credentials for resource `DrugBank`
|
{} | 2023-06-12 18:58:05 | |||
| ¶ | pypath.inputs.drugbank._drugbank_download |
Not calling `pypath.inputs.drugbank._drugbank_download`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.drugbank.drugbank_annotations | 2023-06-18 19:00:48 | 2023-06-18 19:00:48 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/drugbank.py", line 358, in drugbank_annotations
drugs = drugbank_drugs(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/drugbank.py", line 309, in drugbank_drugs
for dbid, struct in raw['structure'].items():
KeyError: 'structure'
|
{} | 2023-06-12 18:58:05 | |||
| ¶ | pypath.inputs.drugbank.drugbank_drugs | 2023-06-18 19:00:48 | 2023-06-18 19:00:48 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/drugbank.py", line 309, in drugbank_drugs
for dbid, struct in raw['structure'].items():
KeyError: 'structure'
|
{} | 2023-06-12 18:58:05 | |||
| ¶ | pypath.inputs.drugbank.drugbank_interactions | 2023-06-18 19:00:48 | 2023-06-18 19:00:48 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/drugbank.py", line 204, in drugbank_interactions
for d in drugbank_drugs(user = user, passwd = passwd)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/drugbank.py", line 309, in drugbank_drugs
for dbid, struct in raw['structure'].items():
KeyError: 'structure'
|
{} | 2023-06-12 18:58:05 | |||
| ¶ | pypath.inputs.drugbank.drugbank_mapping |
Not calling `pypath.inputs.drugbank.drugbank_mapping`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.drugbank.drugbank_raw_interactions | 2023-06-18 19:00:48 | 2023-06-18 19:00:48 | 0.00 | list | [] | 0 | {} | 2023-06-18 19:00:48 | |
| ¶ | pypath.inputs.drugcentral.drugcentral_drugs | 2023-06-18 19:00:48 | 2023-06-18 19:00:49 | 1.13 | list | [DrugcentralDrug(drugcentral='5392', inn='capmatinib', cas='1029712-80-8', smiles='CNC(=O)C1=C(C=C(C=C1)C2=NN3C(=CN=C3N=C2)CC4=CC5=C(C=C4)N=CC=C5)F', inchikey='LIOLIMKSCNQPLV-UHFFFAOYSA-N', inchi='InChI=1S/C23H17FN6O/c1-25-22(31)18-6-5-16(11-19(18)24)21-13-28-23-27-12-17(30(23)29-21)10-14-4-7-20-15(...(truncated) | 4,099 | {} | 2023-06-18 19:00:48 | |
| ¶ | pypath.inputs.drugcentral.drugcentral_interactions | 2023-06-18 19:00:49 | 2023-06-18 19:00:50 | 1.50 | list | [DrugcentralInteraction(drug=DrugcentralDrug(drugcentral='4', inn='levobupivacaine', cas='27262-47-1', smiles='CCCCN1CCCC[C@H]1C(=O)NC1=C(C)C=CC=C1C', inchikey='LEBVLXFERQHONN-INIZCTEOSA-N', inchi='InChI=1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,...(truncated) | 23,115 | {} | 2023-06-18 19:00:49 | |
| ¶ | pypath.inputs.drugcentral.drugcentral_mapping |
Not calling `pypath.inputs.drugcentral.drugcentral_mapping`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ebi.ebi_rest |
Not calling `pypath.inputs.ebi.ebi_rest`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.elm.elm_classes | 2023-06-18 19:00:51 | 2023-06-18 19:01:06 | 15.51 | dict | {'CLV_C14_Caspase3-7': ELMClass(accession='ELME000321', identifier='CLV_C14_Caspase3-7', functional_name='Caspase cleavage motif', description='Caspase-3 and Caspase-7 cleavage site.', regex='[DSTE][^P][^DEWHFYC]D[GSAN]', probability='0.00309374033071', n_instances='41', n_pdb='0'), 'CLV_MEL_PAP_1':...(truncated) | 321 | {} | 2023-06-18 19:00:51 | |
| ¶ | pypath.inputs.elm.elm_domains | 2023-06-18 19:01:06 | 2023-06-18 19:01:07 | 0.52 | dict | {'FZR_HUMAN': {'LIG_APCC_Dbox_1': [('218', '471')], 'LIG_APCC_KENbox_2': [('182', '480'), ('220', '471')]}, 'BIRC3_HUMAN': {'LIG_BIR_II_1': [('172', '236')], 'LIG_BIR_III_3': [('258', '323')], 'LIG_BIR_III_2': [('258', '323')], 'LIG_BIR_III_4': [('258', '323')], 'LIG_BIR_III_1': [('258', '323')]}, '...(truncated) | 604 | {} | 2023-06-18 19:01:06 | |
| ¶ | pypath.inputs.elm.elm_instances | 2023-06-18 19:01:07 | 2023-06-18 19:01:07 | 0.11 | list | [ELMInstance(accession='ELMI003774', type='CLV', identifier='CLV_C14_Caspase3-7', uniprot_id='A0A0H3NIK3_SALTS', uniprot='A0A0H3NIK3', synonyms='A0A0H3NIK3', start='483', end='487', references='20947770', methods='enzymatic reaction; mutation analysis; protease assay; western blot', logic='true posi...(truncated) | 3,977 | {} | 2023-06-18 19:01:07 | |
| ¶ | pypath.inputs.elm.elm_interactions | 2023-06-18 19:01:07 | 2023-06-18 19:01:07 | 0.09 | list | [ELMInteraction(motif_elm='CLV_Separin_Fungi', domain_pfam='PF03568', uniprot_motif='Q12158', uniprot_domain='Q03018', isoform_motif=1, isoform_domain=1, start_motif=175, end_motif=181, start_domain=1171, end_domain=1571, affinity_min=None, affinity_max=None, pubmeds=(10403247, 14585836), taxon_moti...(truncated) | 2,442 | {'fixed': True} | 2023-06-18 19:01:07 | |
| ¶ | pypath.inputs.embopress.embopress_supplementary |
Not calling `pypath.inputs.embopress.embopress_supplementary`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.embrace._embrace_id_translation |
Not calling `pypath.inputs.embrace._embrace_id_translation`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.embrace.embrace_annotations | 2023-06-18 19:01:07 | 2023-06-18 19:01:07 | 0.16 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 163, in embrace_annotations
for rec in embrace_translated(organism = organism):
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 87, in embrace_translated
raw = embrace_raw()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 42, in embrace_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:02:19 | |||
| ¶ | pypath.inputs.embrace.embrace_interactions | 2023-06-18 19:01:07 | 2023-06-18 19:01:07 | 0.12 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 129, in embrace_interactions
for rec in embrace_translated(organism = organism)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 87, in embrace_translated
raw = embrace_raw()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 42, in embrace_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:02:19 | |||
| ¶ | pypath.inputs.embrace.embrace_raw | 2023-06-18 19:01:07 | 2023-06-18 19:01:07 | 0.13 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 42, in embrace_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:02:19 | |||
| ¶ | pypath.inputs.embrace.embrace_translated | 2023-06-18 19:01:07 | 2023-06-18 19:01:07 | 0.12 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 87, in embrace_translated
raw = embrace_raw()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/embrace.py", line 42, in embrace_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:02:20 | |||
| ¶ | pypath.inputs.encode.encode_tf_mirna_interactions | 2023-06-18 19:01:07 | 2023-06-18 19:01:08 | 0.46 | list | [EncodeInteraction(tf_genesymbol='BDP1', mirna='hsa-miR-19b-1*'), EncodeInteraction(tf_genesymbol='RAD21', mirna='hsa-miR-92a-1*'), EncodeInteraction(tf_genesymbol='ESR1', mirna='hsa-miR-23b*'), EncodeInteraction(tf_genesymbol='BCL3', mirna='hsa-miR-19b-1*'), EncodeInteraction(tf_genesymbol='HEY1', ...(truncated) | 1,237 | {} | 2023-06-18 19:01:07 | |
| ¶ | pypath.inputs.ensembl.ensembl_organisms | 2023-06-18 19:01:08 | 2023-06-18 19:01:08 | 0.57 | list | [EnsemblOrganism(common_name='Abingdon island giant tortoise', scientific_name='Chelonoidis abingdonii', taxon_id=106734, ensembl_assembly='ASM359739v1', accession='GCA_003597395.1', genebuild_method='Full genebuild', variation_database='-', regulation_database='-', ensembl_name='cabingdonii'), Ense...(truncated) | 314 | {} | 2023-06-18 19:01:08 | |
| ¶ | pypath.inputs.exocarta._get_exocarta_vesiclepedia | 2023-06-18 19:01:08 | 2023-06-18 19:01:17 | 8.97 | list | [('967', 'CD63', 9606, ('11487543', (9606,), 'Intestinal epithelial cells')), ('1803', 'DPP4', 9606, ('11487543', (9606,), 'Intestinal epithelial cells')), ('79574', 'EPS8L3', 9606, ('11487543', (9606,), 'Intestinal epithelial cells')), ('55971', 'BAIAP2L1', 9606, ('11487543', (9606,), 'Intestinal e...(truncated) | 32,085 | {} | 2023-06-18 19:01:08 | |
| ¶ | pypath.inputs.exocarta.get_exocarta | 2023-06-18 19:01:17 | 2023-06-18 19:01:17 | 0.03 | list | [('967', 'CD63', 9606, ('11487543', (9606,), 'Intestinal epithelial cells')), ('1803', 'DPP4', 9606, ('11487543', (9606,), 'Intestinal epithelial cells')), ('79574', 'EPS8L3', 9606, ('11487543', (9606,), 'Intestinal epithelial cells')), ('55971', 'BAIAP2L1', 9606, ('11487543', (9606,), 'Intestinal e...(truncated) | 32,085 | {} | 2023-06-18 19:01:17 | |
| ¶ | pypath.inputs.exocarta.get_vesiclepedia | 2023-06-18 19:01:17 | 2023-06-18 19:02:10 | 52.36 | list | [('31848', 'His3.3B', 9606, ('16342139', (9606,), 'B cells', ('Microparticles',))), ('33736', 'His3.3A', 9606, ('16342139', (9606,), 'B cells', ('Microparticles',))), ('1', 'A1BG', 9606, ('19056867', (9606,), 'Urine', ('Exosomes',))), ('1', 'A1BG', 9606, ('21630462', (9606,), 'Ascites', ('Microvesic...(truncated) | 290,197 | {} | 2023-06-18 19:01:17 | |
| ¶ | pypath.inputs.genecards.genecards_datasheet |
Not calling `pypath.inputs.genecards.genecards_datasheet`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.genecards.genecards_soup |
Not calling `pypath.inputs.genecards.genecards_soup`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.genecards.genecards_summaries |
Not calling `pypath.inputs.genecards.genecards_summaries`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.go.get_go_desc |
Not calling `pypath.inputs.go.get_go_desc`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.go.get_go_quick | 2023-06-18 19:02:10 | 2023-06-18 19:03:51 | 101.68 | dict | {'terms': {'C': defaultdict(<class 'set'>, {'A0A023I7F4': {'GO:0016020', 'GO:0005743', 'GO:0070469', 'GO:0045275', 'GO:0005739'}, 'A0A023I7H2': {'GO:0070469', 'GO:0005743', 'GO:0005739', 'GO:0016020'}, 'A0A023I7H5': {'GO:0045263', 'GO:0005743', 'GO:0005739', 'GO:0016020'}, 'A0A023I7J4': {'GO:0070469...(truncated) | 2 | {} | 2023-06-18 19:02:10 | |
| ¶ | pypath.inputs.go.get_goslim | 2023-06-18 19:03:51 | 2023-06-18 19:03:52 | 0.78 | list | ['GO:0000228', 'GO:0000278', 'GO:0000910', 'GO:0001618', 'GO:0002181', 'GO:0002376', 'GO:0003012', 'GO:0003013', 'GO:0003014', 'GO:0003016', 'GO:0003677', 'GO:0003723', 'GO:0003774', 'GO:0003824', 'GO:0003924', 'GO:0005198', 'GO:0005215', 'GO:0005576', 'GO:0005615', 'GO:0005618', 'GO:0005634', 'GO:0...(truncated) | 141 | {} | 2023-06-18 19:03:51 | |
| ¶ | pypath.inputs.go.go_ancestors_quickgo | 2023-06-18 19:03:52 | 2023-06-18 19:19:53 | 960.98 | dict | {'C': {'GO:0016009': {('GO:0016007', 'is_a')}, 'GO:0016006': {('GO:0016007', 'is_a')}, 'GO:0016008': {('GO:0016007', 'is_a')}, 'GO:0016014': {('GO:0016010', 'part_of'), ('GO:0098797', 'is_a')}, 'GO:0016011': {('GO:0016010', 'part_of'), ('GO:0098797', 'is_a')}, 'GO:0016013': {('GO:0016010', 'part_of'...(truncated) | 3 | {} | 2023-06-18 19:03:52 | |
| ¶ | pypath.inputs.go.go_ancestors_goose | 2023-06-18 19:19:53 | 2023-06-18 19:19:53 | 0.09 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 211, in go_ancestors_goose
for l in c.result:
TypeError: 'NoneType' object is not iterable
|
{} | 2023-06-12 19:18:26 | |||
| ¶ | pypath.inputs.go.go_ancestors_quickgo | 2023-06-18 19:19:53 | 2023-06-18 19:19:58 | 4.35 | dict | {'C': {'GO:0016009': {('GO:0016007', 'is_a')}, 'GO:0016006': {('GO:0016007', 'is_a')}, 'GO:0016008': {('GO:0016007', 'is_a')}, 'GO:0016014': {('GO:0016010', 'part_of'), ('GO:0098797', 'is_a')}, 'GO:0016011': {('GO:0016010', 'part_of'), ('GO:0098797', 'is_a')}, 'GO:0016013': {('GO:0016010', 'part_of'...(truncated) | 3 | {} | 2023-06-18 19:19:53 | |
| ¶ | pypath.inputs.go.go_annotations_goa | 2023-06-18 19:19:58 | 2023-06-18 19:20:03 | 4.95 | dict | {'C': {'A0A024RBG1': {'GO:0005829', 'GO:0005737', 'GO:0005634'}, 'A0A075B6H5': {'GO:0005886'}, 'A0A075B6H7': {'GO:0005886', 'GO:0005615', 'GO:0019814'}, 'A0A075B6H8': {'GO:0005886', 'GO:0005615', 'GO:0019814'}, 'A0A075B6H9': {'GO:0005886', 'GO:0005615', 'GO:0019814'}, 'A0A075B6I0': {'GO:0005886', 'G...(truncated) | 3 | {} | 2023-06-18 19:19:58 | |
| ¶ | pypath.inputs.go.go_annotations_all | 2023-06-18 19:20:03 | 2023-06-18 19:20:09 | 5.80 | dict | {'A0A024RBG1': {GoAnnotation(db='UniProtKB', db_object_id='A0A024RBG1', db_object_symbol='NUDT4B', qualifier='is_active_in', go_id='GO:0005634', reference='PMID:21873635', evidence_code='IBA', with_or_from='FB:FBgn0036111|PANTHER:PTN000290326', aspect='C', db_object_name='Diphosphoinositol polyphosp...(truncated) | 19,625 | {} | 2023-06-18 19:20:03 | |
| ¶ | pypath.inputs.go.go_annotations_goa | 2023-06-18 19:20:10 | 2023-06-18 19:20:11 | 1.07 | dict | {'C': {'A0A024RBG1': {'GO:0005829', 'GO:0005737', 'GO:0005634'}, 'A0A075B6H5': {'GO:0005886'}, 'A0A075B6H7': {'GO:0005886', 'GO:0005615', 'GO:0019814'}, 'A0A075B6H8': {'GO:0005886', 'GO:0005615', 'GO:0019814'}, 'A0A075B6H9': {'GO:0005886', 'GO:0005615', 'GO:0019814'}, 'A0A075B6I0': {'GO:0005886', 'G...(truncated) | 3 | {} | 2023-06-18 19:20:10 | |
| ¶ | pypath.inputs.go.go_annotations_goose | 2023-06-18 19:20:12 | 2023-06-18 19:20:12 | 0.06 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 858, in go_annotations_goose
for l in c.result:
TypeError: 'NoneType' object is not iterable
|
{} | 2023-06-12 19:18:48 | |||
| ¶ | pypath.inputs.go.go_annotations_solr | 2023-06-18 19:20:12 | 2023-06-18 19:20:13 | 1.46 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 744, in go_annotations_solr
parser = etree.iterparse(c.fileobj, events = ('start', 'end'))
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:18:51 | |||
| ¶ | pypath.inputs.go.go_annotations_uniprot | 2023-06-18 19:20:13 | 2023-06-18 19:20:13 | 0.26 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 67, in go_annotations_uniprot
for x in [x.split('\t') for x in data.split('\n')]
AttributeError: 'NoneType' object has no attribute 'split'
|
{} | 2023-06-12 19:18:52 | |||
| ¶ | pypath.inputs.go.go_descendants_quickgo | 2023-06-18 19:20:13 | 2023-06-18 19:20:18 | 4.32 | dict | {'C': defaultdict(<class 'set'>, {'GO:0016007': {('GO:0016009', 'is_a'), ('GO:0016006', 'is_a'), ('GO:0016008', 'is_a')}, 'GO:0016010': {('GO:0016014', 'part_of'), ('GO:0016011', 'part_of'), ('GO:0016013', 'part_of')}, 'GO:0016011': {('GO:0016012', 'part_of')}, 'GO:0043659': {('GO:0043660', 'is_a')}...(truncated) | 3 | {} | 2023-06-18 19:20:13 | |
| ¶ | pypath.inputs.go.go_descendants_goose | 2023-06-18 19:20:18 | 2023-06-18 19:20:18 | 0.04 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 289, in go_descendants_goose
anc = go_ancestors_goose(aspects = aspects)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 211, in go_ancestors_goose
for l in c.result:
TypeError: 'NoneType' object is not iterable
|
{} | 2023-06-12 19:18:57 | |||
| ¶ | pypath.inputs.go.go_descendants_quickgo | 2023-06-18 19:20:18 | 2023-06-18 19:20:22 | 4.39 | dict | {'C': defaultdict(<class 'set'>, {'GO:0016007': {('GO:0016009', 'is_a'), ('GO:0016006', 'is_a'), ('GO:0016008', 'is_a')}, 'GO:0016010': {('GO:0016014', 'part_of'), ('GO:0016011', 'part_of'), ('GO:0016013', 'part_of')}, 'GO:0016011': {('GO:0016012', 'part_of')}, 'GO:0043659': {('GO:0043660', 'is_a')}...(truncated) | 3 | {} | 2023-06-18 19:20:18 | |
| ¶ | pypath.inputs.go.go_descendants_to_ancestors |
Not calling `pypath.inputs.go.go_descendants_to_ancestors`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.go.go_terms_quickgo | 2023-06-18 19:20:22 | 2023-06-18 19:20:26 | 3.33 | dict | {'C': {'GO:0016007': 'mitochondrial derivative', 'GO:0043626': 'PCNA complex', 'GO:0016008': 'major mitochondrial derivative', 'GO:0043625': 'delta DNA polymerase complex', 'GO:0016009': 'minor mitochondrial derivative', 'GO:0016010': 'dystrophin-associated glycoprotein complex', 'GO:0016011': 'dyst...(truncated) | 3 | {} | 2023-06-18 19:20:22 | |
| ¶ | pypath.inputs.go.go_terms_goose | 2023-06-18 19:20:26 | 2023-06-18 19:20:26 | 0.06 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 584, in go_terms_goose
for l in c.result:
TypeError: 'NoneType' object is not iterable
|
{} | 2023-06-12 19:19:08 | |||
| ¶ | pypath.inputs.go.go_terms_quickgo | 2023-06-18 19:20:26 | 2023-06-18 19:20:29 | 3.50 | dict | {'C': {'GO:0016007': 'mitochondrial derivative', 'GO:0043626': 'PCNA complex', 'GO:0016008': 'major mitochondrial derivative', 'GO:0043625': 'delta DNA polymerase complex', 'GO:0016009': 'minor mitochondrial derivative', 'GO:0016010': 'dystrophin-associated glycoprotein complex', 'GO:0016011': 'dyst...(truncated) | 3 | {} | 2023-06-18 19:20:26 | |
| ¶ | pypath.inputs.go.go_terms_solr | 2023-06-18 19:20:29 | 2023-06-18 19:20:30 | 0.61 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/go.py", line 442, in go_terms_solr
parser = etree.iterparse(c.fileobj, events = ('start', 'end'))
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:19:15 | |||
| ¶ | pypath.inputs.gpcrdb.gpcrdb_annotations | 2023-06-18 19:20:30 | 2023-06-18 19:20:30 | 0.49 | dict | {'P08908': {GpcrdbAnnotation(gpcr_class='Class A (Rhodopsin)', family='Aminergic receptors', subfamily='5-Hydroxytryptamine receptors')}, 'P28222': {GpcrdbAnnotation(gpcr_class='Class A (Rhodopsin)', family='Aminergic receptors', subfamily='5-Hydroxytryptamine receptors')}, 'P28221': {GpcrdbAnnotati...(truncated) | 424 | {} | 2023-06-18 19:20:30 | |
| ¶ | pypath.inputs.graphviz.graphviz_attrs | 2023-06-18 19:20:30 | 2023-06-18 19:20:32 | 1.49 | tuple | ({'_background': {'type': 'xdot', 'default': '<none>', 'min': '', 'notes': 'A string in the xdot format specifying an arbitrary background.'}, 'bb': {'type': 'rect', 'default': '', 'min': '', 'notes': 'Bounding box of drawing in points. \n write only.'}, 'beautify': {'type': 'bool', 'default': 'fal...(truncated) | 3 | {} | 2023-06-18 19:20:30 | |
| ¶ | pypath.inputs.guide2pharma.guide2pharma_complexes |
Not calling `pypath.inputs.guide2pharma.guide2pharma_complexes`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.guide2pharma.guide2pharma_download | 2023-06-18 19:20:32 | 2023-06-18 19:20:34 | 2.71 | tuple | ([GuideToPharmacologyInteraction(ligand='TNFSF9', ligand_id_type='genesymbol', target='Q07011', target_id_type='uniprot', target_is_ligand=False, ligand_organism=('TNFSF9', 9606), target_organism=9606, effect=0, ligand_location=None, target_type=None, ligand_endogenous=False, pubmed_ids=[]), GuideTo...(truncated) | 2 | {} | 2023-06-18 19:20:32 | |
| ¶ | pypath.inputs.guide2pharma.guide2pharma_interactions |
Not calling `pypath.inputs.guide2pharma.guide2pharma_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.havugimana.get_havugimana | 2023-06-18 19:20:34 | 2023-06-18 19:20:35 | 0.13 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/havugimana.py", line 44, in get_havugimana
path = cell_input.cell_supplementary(supp_url, article_url)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:19:20 | |||
| ¶ | pypath.inputs.havugimana.havugimana_complexes | 2023-06-18 19:20:35 | 2023-06-18 19:20:35 | 0.13 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/havugimana.py", line 59, in havugimana_complexes
for rec in get_havugimana():
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/havugimana.py", line 44, in get_havugimana
path = cell_input.cell_supplementary(supp_url, article_url)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:19:20 | |||
| ¶ | pypath.inputs.hgnc.hgnc_genegroups | 2023-06-18 19:20:35 | 2023-06-18 19:20:38 | 3.09 | dict | {'P04217': {HGNCGeneGroupAnnotation(mainclass='Immunoglobulin like domain containing')}, 'Q9NQ94': {HGNCGeneGroupAnnotation(mainclass='RNA binding motif containing')}, 'P01023': {HGNCGeneGroupAnnotation(mainclass='Alpha-2-macroglobulin family')}, 'A8K2U0': {HGNCGeneGroupAnnotation(mainclass='Alpha-2...(truncated) | 15,145 | {} | 2023-06-18 19:20:35 | |
| ¶ | pypath.inputs.hippie.hippie_interactions | 2023-06-18 19:20:38 | 2023-06-18 19:21:05 | 27.42 | list | [HippieInteraction(id_a='P43115', id_b='Q8N3P4', score=0.82, methods=None, references=('26186194', '28514442'), sources=None, organisms=None), HippieInteraction(id_a='Q9UNK0', id_b='Q9BV40', score=0.96, methods=None, references=('11101518', '19557002', '33961781'), sources=None, organisms=None), Hip...(truncated) | 102,282 | {} | 2023-06-18 19:20:38 | |
| ¶ | pypath.inputs.homologene.get_homologene | 2023-06-18 19:21:06 | 2023-06-18 19:21:06 | 0.04 | list | ['3\t9606\t34\tACADM\t4557231\tNP_000007.1\n', '3\t9598\t469356\tACADM\t160961497\tNP_001104286.1\n', '3\t9544\t705168\tACADM\t109008502\tXP_001101274.1\n', '3\t9615\t490207\tACADM\t545503811\tXP_005622188.1\n', '3\t9913\t505968\tACADM\t115497690\tNP_001068703.1\n', '3\t10090\t11364\tAcadm\t6680618\...(truncated) | 275,237 | {} | 2023-06-18 19:21:06 | |
| ¶ | pypath.inputs.homologene.homologene_dict |
Not calling `pypath.inputs.homologene.homologene_dict`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.homologene.homologene_uniprot_dict |
Not calling `pypath.inputs.homologene.homologene_uniprot_dict`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.hpmr.get_hpmr | 2023-06-18 19:21:06 | 2023-06-18 19:21:06 | 0.00 | dict | {'interactions': [['P26992', 'Receptor', 'P40189', '15051883'], ['P26992', 'Receptor', 'P42702', '15051883'], ['P26992', 'Ligand', 'P00491', '15051883'], ['O75462', 'Receptor', 'P26992', '10966616'], ['O75462', 'Receptor', 'P40189', '10966616'], ['O75462', 'Receptor', 'P42702', '10966616'], ['O75462...(truncated) | 3 | {} | 2023-06-18 19:21:06 | |
| ¶ | pypath.inputs.hpmr.hpmr_annotations | 2023-06-18 19:21:06 | 2023-06-18 19:21:06 | 0.00 | dict | {'P26992': {HPMRAnnotation(role='Receptor', mainclass='Cytokine Type 1 receptors', subclass='CICYTR (Cytokine Type 1 receptors)', subsubclass=None)}, 'P40189': {HPMRAnnotation(role='Receptor', mainclass='Cytokine Type 1 receptors', subclass='OSMR(Cytokine Type 1 receptors)', subsubclass=None)}, 'P42...(truncated) | 1,141 | {} | 2023-06-18 19:21:06 | |
| ¶ | pypath.inputs.hpmr.hpmr_complexes | 2023-06-18 19:21:06 | 2023-06-18 19:21:06 | 0.00 | dict | {} | 0 | {} | 2023-06-18 19:21:06 | |
| ¶ | pypath.inputs.hpmr.hpmr_interactions | 2023-06-18 19:21:06 | 2023-06-18 19:21:06 | 0.00 | list | [['P26992', 'Receptor', 'P40189', '15051883'], ['P26992', 'Receptor', 'P42702', '15051883'], ['P26992', 'Ligand', 'P00491', '15051883'], ['O75462', 'Receptor', 'P26992', '10966616'], ['O75462', 'Receptor', 'P40189', '10966616'], ['O75462', 'Receptor', 'P42702', '10966616'], ['O75462', 'Ligand', 'P26...(truncated) | 619 | {} | 2023-06-18 19:21:06 | |
| ¶ | pypath.inputs.hpo.hpo_annotations | 2023-06-18 19:21:06 | 2023-06-18 19:21:08 | 2.27 | defaultdict | defaultdict(<class 'set'>, {'P11245': {HPOAnnotations(entrez_gene_id='10', entrez_gene_symbol='NAT2', hpo_id='HP:0001939'), HPOAnnotations(entrez_gene_id='10', entrez_gene_symbol='NAT2', hpo_id='HP:0000007')}, 'P49588': {HPOAnnotations(entrez_gene_id='16', entrez_gene_symbol='AARS1', hpo_id='HP:0000...(truncated) | 4,882 | {'size': 24} | 2023-06-18 19:21:06 | |
| ¶ | pypath.inputs.hpo.hpo_diseases | 2023-06-18 19:21:08 | 2023-06-18 19:21:10 | 2.41 | dict | {'hpo_id': {HpoDisease(omim='database_id', name='disease_name', pmid=None, qualifier='qualifier', evidence='evidence', onset='onset', frequency='frequency', sex='sex', modifier='modifier', aspect='aspect')}, 'HP:0011097': {HpoDisease(omim='OMIM:619317', name='Developmental and epileptic encephalopat...(truncated) | 10,658 | {'size': 14} | 2023-06-18 19:21:08 | |
| ¶ | pypath.inputs.hpo.hpo_ontology | 2023-06-18 19:21:11 | 2023-06-18 19:21:18 | 7.16 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/hpo.py", line 166, in hpo_ontology
name = (r.name.value, r.name.modifiers)
AttributeError: 'NoneType' object has no attribute 'value'
|
{'broke': True} | 2023-06-17 19:19:27 | |||
| ¶ | pypath.inputs.hpo.hpo_terms | 2023-06-18 19:21:18 | 2023-06-18 19:21:19 | 0.80 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/hpo.py", line 79, in hpo_terms
return hpo_ontology()['terms']
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/hpo.py", line 166, in hpo_ontology
name = (r.name.value, r.name.modifiers)
AttributeError: 'NoneType' object has no attribute 'value'
|
{'broke': True} | 2023-06-17 19:19:29 | |||
| ¶ | pypath.inputs.hprd.get_hprd | 2023-06-18 19:21:19 | 2023-06-18 19:21:23 | 4.11 | list | [['00001', 'ALDH1A1', '00001_1', 'NP_000680.2', '128', 'K', '-', '-', 'Acetylation', 'in vivo', '19608861'], ['00001', 'ALDH1A1', '00001_1', 'NP_000680.2', '91', 'K', '-', '-', 'Acetylation', 'in vivo', '19608861'], ['00001', 'ALDH1A1', '00001_1', 'NP_000680.2', '353', 'K', '-', '-', 'Acetylation', ...(truncated) | 86,981 | {} | 2023-06-18 19:21:19 | |
| ¶ | pypath.inputs.hprd.hprd_enzyme_substrate | 2023-06-18 19:21:23 | 2023-06-18 19:21:25 | 1.83 | list | [{'resaa': 'Y', 'resnum': 12, 'typ': 'dephosphorylation', 'references': ['16291744'], 'kinase': 'PTPN1', 'substrate_refseqp': 'NP_001093.1', 'substrate': 'ACTN1', 'start': 5, 'end': 19, 'instance': None}, {'resaa': 'Y', 'resnum': 705, 'typ': 'phosphorylation', 'references': ['11940572', '11294897', ...(truncated) | 4,671 | {} | 2023-06-18 19:21:23 | |
| ¶ | pypath.inputs.hprd.hprd_interactions | 2023-06-18 19:21:25 | 2023-06-18 19:21:27 | 1.52 | list | [['00020', 'ACTN1', '00020_1', 'NP_001093.1', '12', 'Y', 'PTPN1', '01477', 'Dephosphorylation', 'in vitro;in vivo', '16291744'], ['00026', 'STAT3', '00026_1', 'NP_644805.1', '705', 'Y', 'FGFR3', '00624', 'Phosphorylation', 'in vivo', '11940572,11294897,10918587,12244095,11350938,12626508,8626374,125...(truncated) | 4,671 | {} | 2023-06-18 19:21:25 | |
| ¶ | pypath.inputs.hprd.hprd_interactions_htp | 2023-06-18 19:21:27 | 2023-06-18 19:21:28 | 1.43 | list | [['ALDH1A1', '00001', 'NP_000680.2', 'ALDH1A1', '00001', 'NP_000680.2', 'in vivo;yeast 2-hybrid', '12081471,16189514'], ['ITGA7', '02761', 'NP_001138468.1', 'CHRNA1', '00007', 'NP_001034612.1', 'in vivo', '10910772'], ['PPP1R9A', '16000', 'NP_060120.2', 'ACTG1', '00017', 'NP_001605.1', 'in vitro;in ...(truncated) | 39,241 | {} | 2023-06-18 19:21:27 | |
| ¶ | pypath.inputs.htri.htri_interactions | 2023-06-18 19:21:28 | 2023-06-18 19:21:31 | 2.60 | list | [HTRIInteraction(entrez_tf='142', genesymbol_tf='PARP1', entrez_target='675', genesymbol_target='BRCA2', pubmed='18990703'), HTRIInteraction(entrez_tf='142', genesymbol_tf='PARP1', entrez_target='675', genesymbol_target='BRCA2', pubmed='18990703'), HTRIInteraction(entrez_tf='196', genesymbol_tf='AHR...(truncated) | 18,630 | {} | 2023-06-18 19:21:28 | |
| ¶ | pypath.inputs.humancellmap.humancellmap_annotations | 2023-06-18 19:21:31 | 2023-06-18 19:21:32 | 1.45 | dict | {'Q9NRG9': {HumancellmapAnnotation(localization='mitochondrial outer membrane', method='NMF'), HumancellmapAnnotation(localization='nuclear outer membrane-ER membrane network', method='SAFE'), HumancellmapAnnotation(localization='peroxisome', method='NMF')}, 'Q2M2I8': {HumancellmapAnnotation(localiz...(truncated) | 4,371 | {} | 2023-06-18 19:21:31 | |
| ¶ | pypath.inputs.humap.humap2_complexes | 2023-06-18 19:21:32 | 2023-06-18 19:21:33 | 1.30 | dict | {'COMPLEX:O95900_Q9BQS8': Complex: COMPLEX:O95900_Q9BQS8, 'COMPLEX:P08133_P68402_Q15102_Q15797_Q99426_Q9H4M9': Complex: COMPLEX:P08133_P68402_Q15102_Q15797_Q99426_Q9H4M9, 'COMPLEX:A1KXE4_O43251_Q15038_Q15434_Q6ZRY4_Q93062_Q96S66_Q9NZC3_Q9UF11_Q9Y6M7': Complex: COMPLEX:A1KXE4_O43251_Q15038_Q15434_Q6Z...(truncated) | 6,944 | {} | 2023-06-18 19:21:32 | |
| ¶ | pypath.inputs.humap.humap_complexes | 2023-06-18 19:21:33 | 2023-06-18 19:21:34 | 0.92 | dict | {'COMPLEX:Q7L523_Q8NBW4_Q9HB90': Complex: COMPLEX:Q7L523_Q8NBW4_Q9HB90, 'COMPLEX:O75478_O75528_Q8IYH5_Q92830_Q92831_Q9H8E8_Q9ULM3': Complex: COMPLEX:O75478_O75528_Q8IYH5_Q92830_Q92831_Q9H8E8_Q9ULM3, 'COMPLEX:P31942_Q32P51': Complex: COMPLEX:P31942_Q32P51, 'COMPLEX:P35606_Q9NTJ5_Q9UBF2': Complex: COM...(truncated) | 4,508 | {} | 2023-06-18 19:21:33 | |
| ¶ | pypath.inputs.huri._huri_interactions |
Not calling `pypath.inputs.huri._huri_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.huri.hi_i_interactions | 2023-06-18 19:21:34 | 2023-06-18 19:21:36 | 1.43 | list | [HuriInteraction(uniprot_a='Q8IY31', uniprot_b='Q9BQD3', isoform_a=1, isoform_b=1, score=None), HuriInteraction(uniprot_a='P49902', uniprot_b='P49902', isoform_a=1, isoform_b=1, score=None), HuriInteraction(uniprot_a='Q9BVJ6', uniprot_b='Q8NHQ1', isoform_a=1, isoform_b=1, score=None), HuriInteractio...(truncated) | 5,630 | {} | 2023-06-18 19:21:34 | |
| ¶ | pypath.inputs.huri.hi_ii_interactions | 2023-06-18 19:21:36 | 2023-06-18 19:21:41 | 5.49 | list | [HuriInteraction(uniprot_a='Q9H2A7', uniprot_b='Q6UY14', isoform_a=1, isoform_b=1, score=None), HuriInteraction(uniprot_a='Q5SY16', uniprot_b='Q09666', isoform_a=1, isoform_b=2, score=None), HuriInteraction(uniprot_a='Q8TAB5', uniprot_b='Q96F24', isoform_a=1, isoform_b=1, score=None), HuriInteractio...(truncated) | 46,709 | {} | 2023-06-18 19:21:36 | |
| ¶ | pypath.inputs.huri.hi_iii_old | 2023-06-18 19:21:41 | 2023-06-18 19:21:41 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 867, in test_input
for i, rec in enumerate(value_gen):
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/huri.py", line 95, in hi_iii_old
url = urls.urls['hid']['hi-iii']
KeyError: 'hi-iii'
|
{} | 2023-06-12 19:20:23 | |||
| ¶ | pypath.inputs.huri.hi_union_interactions | 2023-06-18 19:21:41 | 2023-06-18 19:22:01 | 19.34 | list | [HuriInteraction(uniprot_a='Q68D86', uniprot_b='Q9HD26', isoform_a=1, isoform_b=2, score=0.83445807946), HuriInteraction(uniprot_a='Q13515', uniprot_b='Q9UJW9', isoform_a=1, isoform_b=1, score=0.902943684288), HuriInteraction(uniprot_a='P30049', uniprot_b='Q05519', isoform_a=1, isoform_b=2, score=0....(truncated) | 229,721 | {} | 2023-06-18 19:21:41 | |
| ¶ | pypath.inputs.huri.huri_interactions | 2023-06-18 19:22:01 | 2023-06-18 19:22:14 | 13.33 | list | [HuriInteraction(uniprot_a='Q68D86', uniprot_b='Q9HD26', isoform_a=1, isoform_b=2, score=0.83445807946), HuriInteraction(uniprot_a='Q13515', uniprot_b='Q9UJW9', isoform_a=1, isoform_b=1, score=0.902943684288), HuriInteraction(uniprot_a='P30049', uniprot_b='Q05519', isoform_a=1, isoform_b=2, score=0....(truncated) | 166,657 | {} | 2023-06-18 19:22:01 | |
| ¶ | pypath.inputs.huri.lit_bm_13_interactions | 2023-06-18 19:22:14 | 2023-06-18 19:22:15 | 0.87 | list | [LitBm13Interaction(entrez_a='4790', entrez_b='79155', genesymbol_a='NFKB1', genesymbol_b='TNIP2'), LitBm13Interaction(entrez_a='7879', entrez_b='83547', genesymbol_a='RAB7A', genesymbol_b='RILP'), LitBm13Interaction(entrez_a='3932', entrez_b='80306', genesymbol_a='LCK', genesymbol_b='MED28'), LitBm...(truncated) | 11,045 | {} | 2023-06-18 19:22:14 | |
| ¶ | pypath.inputs.huri.lit_bm_17_interactions | 2023-06-18 19:22:15 | 2023-06-18 19:22:16 | 1.18 | list | [LitBm17Interaction(id_a='P07359', id_b='P13224', pubmed='18789323', score=0.659), LitBm17Interaction(id_a='P07359', id_b='P13224', pubmed='18674540', score=0.659), LitBm17Interaction(id_a='P63104', id_b='P13224', pubmed='10627461', score=0.702), LitBm17Interaction(id_a='P63104', id_b='P13224', pubm...(truncated) | 48,796 | {} | 2023-06-18 19:22:15 | |
| ¶ | pypath.inputs.huri.lit_bm_interactions | 2023-06-18 19:22:16 | 2023-06-18 19:22:19 | 2.61 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 873, in test_input
size = i + 1
UnboundLocalError: local variable 'i' referenced before assignment
|
{} | 2023-06-12 19:20:59 | |||
| ¶ | pypath.inputs.huri.rolland_hi_ii_14 | 2023-06-18 19:22:19 | 2023-06-18 19:22:19 | 0.18 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 867, in test_input
for i, rec in enumerate(value_gen):
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/huri.py", line 43, in rolland_hi_ii_14
xlsname = cell.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:21:14 | |||
| ¶ | pypath.inputs.huri.vidal_hi_iii_old |
Not calling `pypath.inputs.huri.vidal_hi_iii_old`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.huri.yang2016_interactions | 2023-06-18 19:22:19 | 2023-06-18 19:22:20 | 1.05 | list | [HuriInteraction(uniprot_a='P07196', uniprot_b='Q9BQQ3', isoform_a=1, isoform_b=1, score=None), HuriInteraction(uniprot_a='O94989', uniprot_b='Q53EZ4', isoform_a=1, isoform_b=1, score=None), HuriInteraction(uniprot_a='Q8NHQ1', uniprot_b='Q9H7H0', isoform_a=1, isoform_b=1, score=None), HuriInteractio...(truncated) | 2,823 | {} | 2023-06-18 19:22:19 | |
| ¶ | pypath.inputs.huri.yu2011_interactions | 2023-06-18 19:22:20 | 2023-06-18 19:22:21 | 1.43 | list | [HuriInteraction(uniprot_a='Q5VUM1', uniprot_b='O43889', isoform_a=1, isoform_b=2, score=None), HuriInteraction(uniprot_a='P62166', uniprot_b='Q86UW9', isoform_a=1, isoform_b=1, score=None), HuriInteraction(uniprot_a='Q9NV12', uniprot_b='O43889', isoform_a=1, isoform_b=2, score=None), HuriInteractio...(truncated) | 7,326 | {} | 2023-06-18 19:22:20 | |
| ¶ | pypath.inputs.i3d.get_i3d | 2023-06-18 19:22:21 | 2023-06-18 19:22:29 | 8.26 | list | [{'A0A024RAV5': {'pfam': None, 'chain': 'B', 'seq': [[1, 185]]}, 'P02647': {'pfam': None, 'chain': 'A', 'seq': [[68, 265]]}, 'uniprots': ['A0A024RAV5', 'P02647'], 'source': 'I3D', 'pdb': ['2mse'], 'references': []}, {'A0A024RAV5': {'pfam': None, 'chain': 'B', 'seq': [[1, 185]]}, 'P10398': {'pfam': N...(truncated) | 15,984 | {} | 2023-06-18 19:22:21 | |
| ¶ | pypath.inputs.icellnet._icellnet_get_components |
Not calling `pypath.inputs.icellnet._icellnet_get_components`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.icellnet._icellnet_get_entity |
Not calling `pypath.inputs.icellnet._icellnet_get_entity`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.icellnet._icellnet_get_references |
Not calling `pypath.inputs.icellnet._icellnet_get_references`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.icellnet._icellnet_get_resources |
Not calling `pypath.inputs.icellnet._icellnet_get_resources`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.icellnet.icellnet_annotations | 2023-06-18 19:22:30 | 2023-06-18 19:22:31 | 1.85 | dict | {'Q13443': {IcellnetAnnotation(role='ligand', family='ECM', subfamily=None, classification=('Ecm',))}, Complex: COMPLEX:P05556_P56199: {IcellnetAnnotation(role='receptor', family=None, subfamily=None, classification=('Semaphorin',)), IcellnetAnnotation(role='receptor', family='ECM', subfamily=None, ...(truncated) | 853 | {} | 2023-06-18 19:22:30 | |
| ¶ | pypath.inputs.icellnet.icellnet_complexes | 2023-06-18 19:22:31 | 2023-06-18 19:22:31 | 0.03 | dict | {'COMPLEX:P05556_P56199': Complex: COMPLEX:P05556_P56199, 'COMPLEX:P05556_P26006': Complex: COMPLEX:P05556_P26006, 'COMPLEX:P05556_P23229': Complex: COMPLEX:P05556_P23229, 'COMPLEX:P05556_P06756': Complex: COMPLEX:P05556_P06756, 'COMPLEX:P06756_P18084': Complex: COMPLEX:P06756_P18084, 'COMPLEX:Q0477...(truncated) | 131 | {} | 2023-06-18 19:22:31 | |
| ¶ | pypath.inputs.icellnet.icellnet_interactions | 2023-06-18 19:22:31 | 2023-06-18 19:22:31 | 0.03 | list | [IcellnetRecord(ligand='Q13443', receptor=Complex: COMPLEX:P05556_P56199, family='ECM', subfamily=None, classification=['Ecm'], resources=None, references=['15361064']), IcellnetRecord(ligand='Q13443', receptor=Complex: COMPLEX:P05556_P26006, family='ECM', subfamily=None, classification=['Ecm'], res...(truncated) | 1,023 | {} | 2023-06-18 19:22:31 | |
| ¶ | pypath.inputs.ielm.get_ielm |
Not calling `pypath.inputs.ielm.get_ielm`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ielm.get_ielm_huge |
Not calling `pypath.inputs.ielm.get_ielm_huge`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.imweb._get_imweb | 2023-06-18 19:22:31 | 2023-06-18 19:22:33 | 1.93 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/imweb.py", line 77, in _get_imweb
hdrs.append('Cookie: access-token=%s' % json.loads(c0.result)['token'])
File "/usr/lib/python3.10/json/__init__.py", line 339, in loads
raise TypeError(f'the JSON object must be str, bytes or bytearray, '
TypeError: the JSON object must be str, bytes or bytearray, not NoneType
|
{} | 2023-06-12 19:21:27 | |||
| ¶ | pypath.inputs.imweb.get_imweb | 2023-06-18 19:22:33 | 2023-06-18 19:22:33 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/imweb.py", line 110, in get_imweb
c0.perform()
pycurl.error: (3, '')
|
{} | 2023-06-12 19:21:29 | |||
| ¶ | pypath.inputs.imweb.get_imweb_req | 2023-06-18 19:22:33 | 2023-06-18 19:22:34 | 0.64 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/imweb.py", line 143, in get_imweb_req
token = json.loads(r0.text)['token']
File "/usr/lib/python3.10/json/__init__.py", line 346, in loads
return _default_decoder.decode(s)
File "/usr/lib/python3.10/json/decoder.py", line 337, in decode
obj, end = self.raw_decode(s, idx=_w(s, 0).end())
File "/usr/lib/python3.10/json/decoder.py", line 355, in raw_decode
raise JSONDecodeError("Expecting value", s, err.value) from None
json.decoder.JSONDecodeError: Expecting value: line 1 column 1 (char 0)
|
{} | 2023-06-12 19:21:29 | |||
| ¶ | pypath.inputs.innatedb.innatedb_interactions | 2023-06-18 19:22:34 | 2023-06-18 19:22:36 | 1.63 | list | [InnatedbInteraction(source_uniprot='Q9Y6Y9', source_genesymbol='LY96', target_uniprot='O00206', target_genesymbol='TLR4', pmid='10359581'), InnatedbInteraction(source_uniprot='Q99836', source_genesymbol='MYD88', target_uniprot='O00206', target_genesymbol='TLR4', pmid='17228323'), InnatedbInteractio...(truncated) | 19,036 | {} | 2023-06-18 19:22:34 | |
| ¶ | pypath.inputs.instruct.get_instruct | 2023-06-18 19:22:36 | 2023-06-18 19:22:36 | 0.65 | NoneType | None | 0 | {} | 2023-06-18 19:22:36 | |
| ¶ | pypath.inputs.instruct.get_instruct_offsets | 2023-06-18 19:22:36 | 2023-06-18 19:22:37 | 0.42 | NoneType | None | 0 | {} | 2023-06-18 19:22:36 | |
| ¶ | pypath.inputs.intact._try_isoform |
Not calling `pypath.inputs.intact._try_isoform`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.intact.intact_interactions | 2023-06-18 19:22:37 | 2023-06-18 19:23:42 | 65.47 | list | [IntactInteraction(id_a='P49418', id_b='Q05193', id_type_a='uniprot', id_type_b='uniprot', pubmeds={'10542231'}, methods={'peptide array'}, interaction_types={'direct interaction'}, mi_score=0.77, isoform_a=None, isoform_b=None), IntactInteraction(id_a='P49418', id_b='Q05193', id_type_a='uniprot', i...(truncated) | 71,496 | {} | 2023-06-18 19:22:37 | |
| ¶ | pypath.inputs.integrins.get_integrins | 2023-06-18 19:23:42 | 2023-06-18 19:23:43 | 0.86 | set | {'P20702', 'P08648', 'P16144', 'Q9UKX5', 'P26010', 'P20701', 'P23229', 'P26012', 'P38570', 'P05556', 'P05106', 'P18084', 'P26006', 'P05107', 'Q13683', 'P53708', 'P56199', 'Q13349', 'P06756', 'Q13797', 'P08514', 'P18564', 'P17301', 'P11215', 'O75578'} | 25 | {} | 2023-06-18 19:23:42 | |
| ¶ | pypath.inputs.interpro.interpro2go_annotations | 2023-06-18 19:23:43 | 2023-06-18 19:23:44 | 0.97 | defaultdict | defaultdict(<class 'set'>, {'IPR000003': {Interpro2GOAnnotation(go_term_id='GO:0003677', go_term_name='DNA binding'), Interpro2GOAnnotation(go_term_id='GO:0008270', go_term_name='zinc ion binding'), Interpro2GOAnnotation(go_term_id='GO:0005634', go_term_name='nucleus'), Interpro2GOAnnotation(go_term...(truncated) | 14,657 | {} | 2023-06-18 19:23:43 | |
| ¶ | pypath.inputs.interpro.interpro_annotations | 2023-06-18 19:23:44 | 2023-06-18 19:24:45 | 60.19 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/interpro.py", line 274, in interpro_annotations
totalrec = int(res['count'])
TypeError: 'NoneType' object is not subscriptable
|
{} | 2023-06-12 19:22:37 | |||
| ¶ | pypath.inputs.interpro.interpro_entries | 2023-06-18 19:24:45 | 2023-06-18 19:25:06 | 21.19 | list | [InterproEntry(interpro_id='IPR000001', protein_count='18450', name='Kringle', type='Domain', publications=['PUB00000803', 'PUB00001541', 'PUB00001620', 'PUB00002414', 'PUB00003257', 'PUB00003400'], parent_list='', child_list='', member_list={'PFAM': ['PF00051'], 'PROFILE': ['PS50070'], 'SMART': ['S...(truncated) | 38,816 | {} | 2023-06-18 19:24:45 | |
| ¶ | pypath.inputs.interpro.interpro_xrefs |
Not calling `pypath.inputs.interpro.interpro_xrefs`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.intogen.intogen_annotations | 2023-06-18 19:25:06 | 2023-06-18 19:25:06 | 0.62 | dict | {'P00519': {IntogenAnnotation(type='FUSION', role='Activating', curated=False, oncodrive_role_prob=nan)}, 'P42684': {IntogenAnnotation(type='MUTATION', role='Activating', curated=False, oncodrive_role_prob=0.811)}, 'Q13085': {IntogenAnnotation(type='MUTATION', role='Activating', curated=False, oncod...(truncated) | 483 | {} | 2023-06-18 19:25:06 | |
| ¶ | pypath.inputs.ipi._ipi_uniprot_pairs |
Not calling `pypath.inputs.ipi._ipi_uniprot_pairs`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ipi.ipi_uniprot | 2023-06-18 19:25:06 | 2023-06-18 19:25:07 | 0.31 | dict | {'IPI00807623': {'A0A183'}, 'IPI00396341': {'A0AUZ9'}, 'IPI00884975': {'A0AUZ9'}, 'IPI00884987': {'A0AUZ9'}, 'IPI00885003': {'A0AUZ9'}, 'IPI00855723': {'A0AV02'}, 'IPI00867607': {'A0AV02'}, 'IPI00793608': {'A0AV02'}, 'IPI00867726': {'A0AV02'}, 'IPI00867740': {'A0AV02'}, 'IPI00169342': {'A0AV96'}, 'I...(truncated) | 51,106 | {} | 2023-06-18 19:25:06 | |
| ¶ | pypath.inputs.iptmnet.iptmnet_interactions | 2023-06-18 19:25:07 | 2023-06-18 19:30:55 | 348.26 | list | [IptmnetInteraction(enzyme='Q92793', substrate='O15265', enzyme_isoform=None, substrate_isoform=1, ptm_type='acetylation', resaa='257', resnum='K', score=None, references=['19955365']), IptmnetInteraction(enzyme='Q09472', substrate='O15527', enzyme_isoform=None, substrate_isoform=1, ptm_type='acetyl...(truncated) | 34,158 | {'size': 17077} | 2023-06-18 19:25:07 | |
| ¶ | pypath.inputs.italk.italk_annotations | 2023-06-18 19:30:55 | 2023-06-18 19:30:56 | 1.37 | dict | {'P01023': {ItalkAnnotation(mainclass='ligand', subclass='other')}, 'Q07954': {ItalkAnnotation(mainclass='receptor', subclass='growth factor'), ItalkAnnotation(mainclass='receptor', subclass='other')}, 'Q16613': {ItalkAnnotation(mainclass='ligand', subclass='other')}, 'P48039': {ItalkAnnotation(main...(truncated) | 1,414 | {} | 2023-06-18 19:30:55 | |
| ¶ | pypath.inputs.italk.italk_interactions | 2023-06-18 19:30:56 | 2023-06-18 19:30:56 | 0.02 | list | [ItalkInteraction(ligand='P01023', receptor='Q07954', classification='other'), ItalkInteraction(ligand='Q16613', receptor='P48039', classification='other'), ItalkInteraction(ligand='Q16613', receptor='P49286', classification='other'), ItalkInteraction(ligand='P12821', receptor='P50052', classificati...(truncated) | 2,706 | {} | 2023-06-18 19:30:56 | |
| ¶ | pypath.inputs.italk.italk_raw | 2023-06-18 19:30:56 | 2023-06-18 19:30:56 | 0.01 | DataFrame | Pair.Name ... Classification 0 A2M_LRP1 ... other 1 AANAT_MTNR1A ... other 2 AANAT_MTNR1B ... other 3 ACE_AGTR2 ... other 4 ACE_BDKRB2 ... other ... ... ... ... 2644 CXCL8_KSHV ...(truncated) | 2,649 | {} | 2023-06-18 19:30:56 | |
| ¶ | pypath.inputs.kea.kea_enzyme_substrate | 2023-06-18 19:30:56 | 2023-06-18 19:30:59 | 2.42 | list | [{'start': None, 'end': None, 'instance': None, 'substrate': 'P08581', 'kinase': 'P00519', 'resaa': 'Y', 'resnum': 1349, 'references': {'15475459'}, 'typ': 'phosphorylation'}, {'start': None, 'end': None, 'instance': None, 'substrate': 'P98161', 'kinase': 'P00519', 'resaa': 'Y', 'resnum': 432, 'refe...(truncated) | 35,252 | {} | 2023-06-18 19:30:56 | |
| ¶ | pypath.inputs.kea.kea_interactions | 2023-06-18 19:30:59 | 2023-06-18 19:30:59 | 0.17 | list | [KeaRecord(enzyme='P00519', substrate='P08581', residue_type='Y', residue_offset=1349, pmid='15475459', resource='Kinexus'), KeaRecord(enzyme='P00519', substrate='P98161', residue_type='Y', residue_offset=432, pmid='12637538', resource='Kinexus'), KeaRecord(enzyme='P00519', substrate='P98161', resid...(truncated) | 35,252 | {} | 2023-06-18 19:30:59 | |
| ¶ | pypath.inputs.kegg.kegg_dbget |
Not calling `pypath.inputs.kegg.kegg_dbget`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg.kegg_interactions | 2023-06-18 19:30:59 | 2023-06-18 19:35:03 | 243.83 | list | [KeggInteraction(id_a='Q03113', id_b='Q15283', effect='activation', pathway='MAPK signaling pathway', mechanism='', is_direct=True, transcriptional=False), KeggInteraction(id_a='O94763', id_b='Q15283', effect='activation', pathway='MAPK signaling pathway', mechanism='', is_direct=True, transcription...(truncated) | 14,566 | {} | 2023-06-18 19:30:59 | |
| ¶ | pypath.inputs.kegg.kegg_medicus | 2023-06-18 19:35:03 | 2023-06-18 19:35:19 | 16.28 | set | {KeggMedicusRawInteraction(id_a='54205', id_b='317', name_a='CYCS', name_b='APAF1', effect='missing', itype='post_translational', pw_type='reference', type_a='gene', type_b='gene', network_id='N00984'), KeggMedicusRawInteraction(id_a='293', id_b='54205', name_a='SLC25A6', name_b='CYCS', effect='stim...(truncated) | 12,578 | {} | 2023-06-18 19:35:03 | |
| ¶ | pypath.inputs.kegg.kegg_medicus_complexes | 2023-06-18 19:35:19 | 2023-06-18 19:35:20 | 0.85 | dict | {'COMPLEX:O14640_O75474': Complex: COMPLEX:O14640_O75474, 'COMPLEX:P28702_P37231': Complex: COMPLEX:P28702_P37231, 'COMPLEX:O14521_P21912_P31040_Q99643': Complex: COMPLEX:O14521_P21912_P31040_Q99643, 'COMPLEX:P06493_Q8WWL7': Complex: COMPLEX:P06493_Q8WWL7, 'COMPLEX:O95352_Q9H1Y0': Complex: COMPLEX:O...(truncated) | 501 | {} | 2023-06-18 19:35:19 | |
| ¶ | pypath.inputs.kegg.kegg_medicus_interactions | 2023-06-18 19:35:20 | 2023-06-18 19:35:21 | 0.39 | list | [KeggMedicusInteraction(id_a='P99999', id_b='O14727', entity_type_a='protein', entity_type_b='protein', interaction_type='post_translational', effect='missing'), KeggMedicusInteraction(id_a='P12236', id_b='P99999', entity_type_a='protein', entity_type_b='protein', interaction_type='post_translationa...(truncated) | 9,363 | {} | 2023-06-18 19:35:20 | |
| ¶ | pypath.inputs.kegg.kegg_pathway_annotations | 2023-06-18 19:35:21 | 2023-06-18 19:35:25 | 4.33 | dict | {'Q03701': {KeggPathway(pathway='Parkinson disease'), KeggPathway(pathway='MAPK signaling pathway'), KeggPathway(pathway='Apoptosis'), KeggPathway(pathway='Alzheimer disease'), KeggPathway(pathway='Lipid and atherosclerosis'), KeggPathway(pathway='Prion disease'), KeggPathway(pathway='Amyotrophic la...(truncated) | 2,585 | {} | 2023-06-18 19:35:21 | |
| ¶ | pypath.inputs.kegg.kegg_pathway_annotations_pathwaycommons | 2023-06-18 19:35:25 | 2023-06-18 19:35:25 | 0.43 | dict | {'A8K7J7': {KeggPathway(pathway='Butirosin and neomycin biosynthesis'), KeggPathway(pathway='Fructose and mannose metabolism'), KeggPathway(pathway='Metabolic pathways'), KeggPathway(pathway='Glycolysis / Gluconeogenesis'), KeggPathway(pathway='Galactose metabolism'), KeggPathway(pathway='Amino suga...(truncated) | 813 | {} | 2023-06-18 19:35:25 | |
| ¶ | pypath.inputs.kegg.kegg_pathways | 2023-06-18 19:35:25 | 2023-06-18 19:35:30 | 4.77 | tuple | ({'MAPK signaling pathway': {'Q03701', 'O94763', 'Q13153', 'Q8IVH8', 'P01375', 'Q9HBH9', 'P61244', 'Q12968', 'O95267', 'P01137', 'Q9Y3M2', 'P46734', 'Q03112', 'P45985', 'O95382', 'P04792', 'Q07889', 'P35557', 'P36896', 'P28482', 'Q9UPT6', 'O95257', 'Q9Y6R4', 'P17980', 'Q9NRY4', 'Q99836', 'Q99683', '...(truncated) | 2 | {} | 2023-06-18 19:35:25 | |
| ¶ | pypath.inputs.kegg_api. |
Not calling `pypath.inputs.kegg_api.`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._generate_conv_functions | 2023-06-18 19:35:30 | 2023-06-18 19:35:30 | 0.00 | NoneType | None | 0 | {} | 2023-06-18 19:35:30 | |
| ¶ | pypath.inputs.kegg_api._generate_relation_functions | 2023-06-18 19:35:30 | 2023-06-18 19:35:30 | 0.00 | NoneType | None | 0 | {} | 2023-06-18 19:35:30 | |
| ¶ | pypath.inputs.kegg_api._kegg_conv |
Not calling `pypath.inputs.kegg_api._kegg_conv`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_ddi |
Not calling `pypath.inputs.kegg_api._kegg_ddi`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_ddi_async |
Not calling `pypath.inputs.kegg_api._kegg_ddi_async`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_ddi_sync |
Not calling `pypath.inputs.kegg_api._kegg_ddi_sync`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_general |
Not calling `pypath.inputs.kegg_api._kegg_general`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_general_async |
Not calling `pypath.inputs.kegg_api._kegg_general_async`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_link |
Not calling `pypath.inputs.kegg_api._kegg_link`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_list |
Not calling `pypath.inputs.kegg_api._kegg_list`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api._kegg_relations |
Not calling `pypath.inputs.kegg_api._kegg_relations`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.disease_to_drug |
Not calling `pypath.inputs.kegg_api.disease_to_drug`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.disease_to_gene |
Not calling `pypath.inputs.kegg_api.disease_to_gene`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.disease_to_pathway |
Not calling `pypath.inputs.kegg_api.disease_to_pathway`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.drug_to_disease |
Not calling `pypath.inputs.kegg_api.drug_to_disease`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.drug_to_drug | 2023-06-18 19:35:30 | 2023-06-18 19:35:30 | 0.00 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/kegg_api.py", line 133, in drug_to_drug
entry_dbs = {'drug': _Drug(), 'compound': _Compound()}
TypeError: Can't instantiate abstract class _Drug with abstract methods __init__, load
|
{} | 2023-06-12 19:35:59 | |||
| ¶ | pypath.inputs.kegg_api.drug_to_gene |
Not calling `pypath.inputs.kegg_api.drug_to_gene`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.drug_to_pathway |
Not calling `pypath.inputs.kegg_api.drug_to_pathway`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.gene_to_disease |
Not calling `pypath.inputs.kegg_api.gene_to_disease`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.gene_to_drug |
Not calling `pypath.inputs.kegg_api.gene_to_drug`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.gene_to_pathway |
Not calling `pypath.inputs.kegg_api.gene_to_pathway`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.kegg_drug_to_chebi |
Not calling `pypath.inputs.kegg_api.kegg_drug_to_chebi`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.kegg_gene_to_ncbi_geneid |
Not calling `pypath.inputs.kegg_api.kegg_gene_to_ncbi_geneid`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.kegg_gene_to_uniprot |
Not calling `pypath.inputs.kegg_api.kegg_gene_to_uniprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.pathway_to_disease |
Not calling `pypath.inputs.kegg_api.pathway_to_disease`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.pathway_to_drug |
Not calling `pypath.inputs.kegg_api.pathway_to_drug`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kegg_api.pathway_to_gene |
Not calling `pypath.inputs.kegg_api.pathway_to_gene`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.kinasedotcom.kinasedotcom_annotations | 2023-06-18 19:35:30 | 2023-06-18 19:35:31 | 0.49 | dict | {'P31749': {KinasedotcomAnnotation(group='AGC', family='Akt', subfamily=None)}, 'P31751': {KinasedotcomAnnotation(group='AGC', family='Akt', subfamily=None)}, 'Q9Y243': {KinasedotcomAnnotation(group='AGC', family='Akt', subfamily=None)}, 'O14578': {KinasedotcomAnnotation(group='AGC', family='DMPK', ...(truncated) | 504 | {} | 2023-06-18 19:35:30 | |
| ¶ | pypath.inputs.kirouac2010.kirouac2010_interactions | 2023-06-18 19:35:31 | 2023-06-18 19:35:33 | 2.29 | list | [Kiruac2010Interaction(ligand='ADIPOQ', receptor='ADIPOR'), Kiruac2010Interaction(ligand='AGRP', receptor='ATRN'), Kiruac2010Interaction(ligand='AREG', receptor='EGFR'), Kiruac2010Interaction(ligand='ANGPTL1', receptor='TEK'), Kiruac2010Interaction(ligand='ANGPTL2', receptor='TEK'), Kiruac2010Intera...(truncated) | 267 | {} | 2023-06-18 19:35:31 | |
| ¶ | pypath.inputs.lambert2018.lambert2018_annotations | 2023-06-18 19:35:33 | 2023-06-18 19:35:33 | 0.12 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/lambert2018.py", line 104, in lambert2018_annotations
for r in lambert2018_s1_raw():
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/lambert2018.py", line 44, in lambert2018_s1_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:36:00 | |||
| ¶ | pypath.inputs.lambert2018.lambert2018_s1_raw | 2023-06-18 19:35:33 | 2023-06-18 19:35:33 | 0.12 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/lambert2018.py", line 44, in lambert2018_s1_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 19:36:00 | |||
| ¶ | pypath.inputs.laudanna.laudanna_directions | 2023-06-18 19:35:33 | 2023-06-18 19:35:34 | 0.36 | list | [LaudannaDirection(source_genesymbol='F2R', target_genesymbol='PAWR'), LaudannaDirection(source_genesymbol='PPP1R13B', target_genesymbol='PIK3CB'), LaudannaDirection(source_genesymbol='ATP8A2', target_genesymbol='CASP9'), LaudannaDirection(source_genesymbol='ATP8A2', target_genesymbol='CAMP'), Lauda...(truncated) | 77,555 | {} | 2023-06-18 19:35:33 | |
| ¶ | pypath.inputs.laudanna.laudanna_effects | 2023-06-18 19:35:34 | 2023-06-18 19:35:34 | 0.71 | list | [LaudannaEffect(source_genesymbol='EDNRA', target_genesymbol='NBN', effect='activation'), LaudannaEffect(source_genesymbol='TGFB1', target_genesymbol='TGFB1', effect='inhibition'), LaudannaEffect(source_genesymbol='EIF5B', target_genesymbol='RPL11', effect='activation'), LaudannaEffect(source_genesy...(truncated) | 63,438 | {} | 2023-06-18 19:35:34 | |
| ¶ | pypath.inputs.li2012.get_li2012 | 2023-06-18 19:35:34 | 2023-06-18 19:35:42 | 8.08 | list | [['BCR', 'BCR/177', 'ABL', 'PTPN SH2', 'CTK_Cytoplasm', 'ubiquitous', 'PPP'], ['BCR', 'BCR/177', 'ABL', 'GRB2 SH2', 'CTK_Cytoplasm', 'ubiquitous', 'PPP'], ['CAV', 'CAV1/14', 'ABL', 'GRB7 SH2', 'CTK_Membrane', 'ubiquitous', 'PPP'], ['CBL', 'CBL/700', 'ABL', 'CRK SH2', 'CTK_Cytoplasm', 'ubiquitous', '...(truncated) | 583 | {} | 2023-06-18 19:35:34 | |
| ¶ | pypath.inputs.li2012.li2012_dmi | 2023-06-18 19:35:42 | 2023-06-18 19:35:43 | 0.31 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/li2012.py", line 133, in li2012_dmi
se = seq.swissprot_seq(isoforms = True)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/seq.py", line 55, in swissprot_seq
data = data.split('\n')
AttributeError: 'NoneType' object has no attribute 'split'
|
{} | 2023-06-12 19:36:10 | |||
| ¶ | pypath.inputs.li2012.li2012_enzyme_substrate | 2023-06-18 19:35:43 | 2023-06-18 19:35:43 | 0.03 | list | [{'substrate': 'BCR', 'kinase': 'ABL', 'instance': None, 'start': None, 'end': None, 'resaa': 'Y', 'resnum': 177}, {'substrate': 'CAV1', 'kinase': 'ABL', 'instance': None, 'start': None, 'end': None, 'resaa': 'Y', 'resnum': 14}, {'substrate': 'CBL', 'kinase': 'ABL', 'instance': None, 'start': None, ...(truncated) | 349 | {} | 2023-06-18 19:35:43 | |
| ¶ | pypath.inputs.li2012.li2012_interactions | 2023-06-18 19:35:43 | 2023-06-18 19:35:43 | 0.03 | list | [['ABL', 'BCR', 'CTK_Cytoplasm', 'phosphorylation'], ['BCR', 'PTPN', 'CTK_Cytoplasm', 'phosphomotif_binding'], ['BCR', 'GRB2', 'CTK_Cytoplasm', 'phosphomotif_binding'], ['ABL', 'CAV1', 'CTK_Membrane', 'phosphorylation'], ['CAV1', 'GRB7', 'CTK_Membrane', 'phosphomotif_binding'], ['ABL', 'CBL', 'CTK_C...(truncated) | 503 | {} | 2023-06-18 19:35:43 | |
| ¶ | pypath.inputs.lincs.lincs_compounds | 2023-06-18 19:35:43 | 2023-06-18 19:35:46 | 3.63 | dict | {'10001': LincsCompound(lincs='LSM-1001', chembl='CHEMBL14762', chebi='CHEBI:354.22', inchi='InChI=1S/C19H26N6O/c1-4-15(11-26)22-19-23-17(20-10-14-8-6-5-7-9-14)16-18(24-19)25(12-21-16)13(2)3/h5-9,12-13,15,26H,4,10-11H2,1-3H3,(H2,20,22,23,24)/t15-/m1/s1', inchi_key='BTIHMVBBUGXLCJ-OAHLLOKOSA-N', smil...(truncated) | 1,320 | {} | 2023-06-18 19:35:43 | |
| ¶ | pypath.inputs.lmpid.lmpid_dmi | 2023-06-18 19:35:46 | 2023-06-18 19:35:47 | 0.62 | list | [] | 0 | {} | 2023-06-18 19:35:46 | |
| ¶ | pypath.inputs.lmpid.lmpid_interactions | 2023-06-18 19:35:47 | 2023-06-18 19:35:47 | 0.37 | list | [] | 0 | {} | 2023-06-18 19:35:47 | |
| ¶ | pypath.inputs.lmpid.load_lmpid | 2023-06-18 19:35:47 | 2023-06-18 19:35:48 | 0.78 | list | [] | 0 | {} | 2023-06-18 19:35:47 | |
| ¶ | pypath.inputs.lncdisease.lncdisease_interactions | 2023-06-18 19:35:48 | 2023-06-18 19:35:48 | 0.19 | list | [LncdiseaseInteraction(source='7SK', target='ABO', source_type='RNA', target_type='RNA', mechanism='regulatory', organism='human', pmid='22522162'), LncdiseaseInteraction(source='7SK', target='Ars2', source_type='RNA', target_type='Protein', mechanism='regulatory', organism='human', pmid='22244333')...(truncated) | 478 | {} | 2023-06-18 19:35:48 | |
| ¶ | pypath.inputs.lncrnadb.lncrnadb_interactions | 2023-06-18 19:35:48 | 2023-06-18 19:35:49 | 0.34 | list | [] | 0 | {} | 2023-06-18 19:35:48 | |
| ¶ | pypath.inputs.locate.locate_localizations | 2023-06-18 19:35:49 | 2023-06-18 19:36:27 | 38.47 | dict | {'P27824': {LocateAnnotation(source='HPRD', location='golgi apparatus', cls='typeI', pmid=None, score=None), LocateAnnotation(source='UniProt/SPTrEMBL', location='melanosome', cls='typeI', pmid=None, score=None), LocateAnnotation(source='UniProt/SPTrEMBL', location='endoplasmic reticulum', cls='type...(truncated) | 9,496 | {} | 2023-06-18 19:35:49 | |
| ¶ | pypath.inputs.lrdb.lrdb_annotations | 2023-06-18 19:36:27 | 2023-06-18 19:36:28 | 0.77 | dict | {'P01023': {LrdbAnnotation(role='ligand', cell_type=None, sources=('Fantom5', 'HPMR', 'HPRD'), references=('10652313',))}, 'Q07954': {LrdbAnnotation(role='receptor', cell_type=None, sources=('Fantom5', 'HPMR'), references=('9388254',)), LrdbAnnotation(role='receptor', cell_type=None, sources=('Fanto...(truncated) | 1,536 | {} | 2023-06-18 19:36:27 | |
| ¶ | pypath.inputs.lrdb.lrdb_interactions | 2023-06-18 19:36:28 | 2023-06-18 19:36:28 | 0.03 | list | [LrdbRecord(ligand_genesymbol='A2M', receptor_genesymbol='LRP1', sources=['Fantom5', 'HPMR', 'HPRD'], references=['10652313'], ligand_cells=[], receptor_cells=[]), LrdbRecord(ligand_genesymbol='AANAT', receptor_genesymbol='MTNR1A', sources=['Fantom5', 'HPMR'], references=['12943195'], ligand_cells=[...(truncated) | 3,251 | {} | 2023-06-18 19:36:28 | |
| ¶ | pypath.inputs.macrophage._trim_gname |
Not calling `pypath.inputs.macrophage._trim_gname`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.macrophage.macrophage_interactions | 2023-06-18 19:36:28 | 2023-06-18 19:36:28 | 0.19 | list | [MacrophageInteraction(source_genesymbol='ATM', target_genesymbol='IKBKG', mechanism='Binding', directed='0', location='nucleus', pmid='16497931'), MacrophageInteraction(source_genesymbol='ATM', target_genesymbol='IKBKG', mechanism='Binding', directed='0', location='nucleus', pmid='16965765'), Macro...(truncated) | 4,516 | {} | 2023-06-18 19:36:28 | |
| ¶ | pypath.inputs.matrisome.__matrisome_annotations_2 | 2023-06-18 19:36:28 | 2023-06-18 19:36:29 | 0.96 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/matrisome.py", line 91, in __matrisome_annotations_2
_ = next(c.result)
TypeError: 'NoneType' object is not an iterator
|
{} | 2023-06-12 19:36:56 | |||
| ¶ | pypath.inputs.matrisome.matrisome_annotations | 2023-06-18 19:36:29 | 2023-06-18 19:36:30 | 0.28 | dict | {'Q7Z7G0': {MatrisomeAnnotation(mainclass='Core matrisome', subclass='ECM Glycoproteins', subsubclass=None)}, 'Q5JPC9': {MatrisomeAnnotation(mainclass='Core matrisome', subclass='ECM Glycoproteins', subsubclass=None)}, 'B4DSV9': {MatrisomeAnnotation(mainclass='Core matrisome', subclass='ECM Glycopro...(truncated) | 1,067 | {} | 2023-06-18 19:36:29 | |
| ¶ | pypath.inputs.matrixdb._matrixdb_protein_list |
Not calling `pypath.inputs.matrixdb._matrixdb_protein_list`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.matrixdb.matrixdb_annotations | 2023-06-18 19:36:30 | 2023-06-18 19:36:33 | 3.09 | dict | {'Q8IZY2': {MatrixdbAnnotation(mainclass='membrane')}, 'Q9Y644': {MatrixdbAnnotation(mainclass='membrane'), MatrixdbAnnotation(mainclass='secreted')}, 'P57768': {MatrixdbAnnotation(mainclass='membrane')}, 'Q8IZ81': {MatrixdbAnnotation(mainclass='membrane')}, 'Q5JX69': {MatrixdbAnnotation(mainclass='...(truncated) | 10,094 | {} | 2023-06-18 19:36:30 | |
| ¶ | pypath.inputs.matrixdb.matrixdb_ecm_proteins | 2023-06-18 19:36:33 | 2023-06-18 19:36:33 | 0.00 | set | {'Q5KU26', 'Q13201', 'Q14112', 'Q14515', 'P02818', 'O43854', 'P22692', 'Q9ULZ9', 'P80108', 'Q9UBV4', 'Q8N8U9', 'Q9Y251', 'Q86XX4', 'Q9BXY4', 'A6NHN0', 'Q14766', 'P28300', 'Q66K79', 'Q96HD1', 'Q86UW8', 'Q6W4X9', 'Q9BQ16', 'Q8TER0', 'Q9Y215', 'Q6UXM1', 'Q86Y22', 'O75443', 'Q75N90', 'P25067', 'Q6WRI0',...(truncated) | 483 | {} | 2023-06-18 19:36:33 | |
| ¶ | pypath.inputs.matrixdb.matrixdb_interactions | 2023-06-18 19:36:33 | 2023-06-18 19:36:33 | 0.12 | list | [['P13497', 'Q15113', '20979576', 'protease assay'], ['O00206', 'P21810', '24480070', 'microscale thermophoresis'], ['P49747', 'O15232', '22521401', 'enzyme linked immunosorbent assay'], ['O60568', 'O60568', '20955792', 'molecular sieving'], ['O60568', 'O60568', '20955792', 'molecular sieving'], ['O...(truncated) | 425 | {} | 2023-06-18 19:36:33 | |
| ¶ | pypath.inputs.matrixdb.matrixdb_membrane_proteins | 2023-06-18 19:36:33 | 2023-06-18 19:36:35 | 2.03 | set | {'Q8IZY2', 'Q9Y644', 'P57768', 'Q8IZ81', 'Q5JX69', 'Q92608', 'Q9UMZ2', 'O43597', 'O94759', 'P63126', 'O95279', 'A6NC51', 'Q9NPC4', 'Q12980', 'O95249', 'P16422', 'P48764', 'Q9UNW8', 'Q9H7F0', 'Q8TDD1', 'Q4U2R8', 'Q5SSG8', 'Q15796', 'O75131', 'P14207', 'Q9Y5I2', 'Q8NET5', 'Q86Y22', 'Q6PJI9', 'O75324',...(truncated) | 8,238 | {} | 2023-06-18 19:36:33 | |
| ¶ | pypath.inputs.matrixdb.matrixdb_secreted_proteins | 2023-06-18 19:36:35 | 2023-06-18 19:36:35 | 0.35 | set | {'P0DML2', 'Q96SL4', 'Q14112', 'Q5QGZ9', 'Q9Y644', 'Q8NFQ5', 'P04808', 'Q92608', 'Q01459', 'Q13253', 'P22692', 'P07498', 'P01008', 'Q86T13', 'Q16674', 'Q6UWQ7', 'O00295', 'P09525', 'Q8N302', 'Q99466', 'O95445', 'P29622', 'A1L4H1', 'Q9Y6W8', 'P55290', 'Q8WXX5', 'P17980', 'P13473', 'Q5SSG8', 'P06858',...(truncated) | 2,922 | {} | 2023-06-18 19:36:35 | |
| ¶ | pypath.inputs.mcam.mcam_cell_adhesion_molecules | 2023-06-18 19:36:35 | 2023-06-18 19:36:43 | 7.50 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/mcam.py", line 36, in mcam_cell_adhesion_molecules
_ = next(c.result)
TypeError: 'NoneType' object is not an iterator
|
{} | 2023-06-16 19:29:59 | |||
| ¶ | pypath.inputs.membranome.membranome_annotations | 2023-06-18 19:36:43 | 2023-06-18 19:37:08 | 24.92 | list | [('P08575', 'Plasma membrane', 'extracellular side'), ('P23468', 'Plasma membrane', 'extracellular side'), ('P10586', 'Plasma membrane', 'extracellular side'), ('P23470', 'Plasma membrane', 'extracellular side'), ('Q13332', 'Plasma membrane', 'extracellular side'), ('P23471', 'Plasma membrane', 'ext...(truncated) | 2,384 | {} | 2023-06-18 19:36:43 | |
| ¶ | pypath.inputs.mimp.get_kinase_class | 2023-06-18 19:37:08 | 2023-06-18 19:37:08 | 0.13 | dict | {'groups': {'AGC': ['AKT1', 'AKT2', 'AKT3', 'DMPK1', 'DMPK2', 'MRCKb', 'MRCKa', 'MRCK', 'ROCK2', 'ROCK1', 'CRIK', 'BARK1', 'BARK2', 'GPRK4', 'GPRK5', 'GPRK6', 'RHOK', 'GPRK6', 'GPRK7', 'MAST3', 'MAST2', 'MAST1', 'MASTL', 'MAST4', 'NDR1', 'LATS1', 'LATS2', 'NDR2', 'PKACa', 'PKACb', 'PKACg', 'PRKX', '...(truncated) | 4 | {} | 2023-06-18 19:37:08 | |
| ¶ | pypath.inputs.mimp.mimp_enzyme_substrate | 2023-06-18 19:37:08 | 2023-06-18 19:37:11 | 3.15 | list | [{'instance': 'VVGARRSSWRVISSI', 'kinase': 'PDKC', 'resaa': 'S', 'resnum': 60, 'npmid': 8, 'substrate_refseq': 'NM_003404', 'substrate': 'YWHAB', 'start': 53, 'end': 67, 'databases': ['HPRD', 'phosphoELM', 'PhosphoSite']}, {'instance': 'VVGARRSSWRVISSI', 'kinase': 'PRKCD', 'resaa': 'S', 'resnum': 60...(truncated) | 17,030 | {} | 2023-06-18 19:37:08 | |
| ¶ | pypath.inputs.mimp.mimp_interactions | 2023-06-18 19:37:11 | 2023-06-18 19:37:11 | 0.52 | list | [['PDKC', 'YWHAB', ['HPRD', 'phosphoELM', 'PhosphoSite']], ['PRKCD', 'YWHAB', ['HPRD', 'phosphoELM', 'PhosphoSite']], ['PRKCZ', 'YWHAB', ['HPRD', 'phosphoELM', 'PhosphoSite']], ['PDKC', 'YWHAH', ['phosphoELM', 'PhosphoSite']], ['ATM', 'EIF4EBP1', ['phosphoELM', 'PhosphoSite']], ['RORC', 'EIF4EBP1', ...(truncated) | 17,030 | {} | 2023-06-18 19:37:11 | |
| ¶ | pypath.inputs.mir2disease.mir2disease_interactions | 2023-06-18 19:37:11 | 2023-06-18 19:37:12 | 0.20 | list | [Mir2diseaseInteraction(mirna='hsa-let-7a', target_genesymbol='KRAS', year='2008', sentence="A SNP in a let-7 microRNA complementary site in the KRAS 3' untranslated region increases non-small cell lung cancer risk."), Mir2diseaseInteraction(mirna='hsa-let-7a', target_genesymbol='HMGA2', year='2008'...(truncated) | 805 | {} | 2023-06-18 19:37:11 | |
| ¶ | pypath.inputs.mirbase.get_mirbase_aliases | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.06 | tuple | ({'MIMAT0000062': {'hsa-let-7a', 'hsa-let-7a-5p'}, 'MIMAT0000063': {'hsa-let-7b-5p', 'hsa-let-7b'}, 'MIMAT0000064': {'hsa-let-7c', 'hsa-let-7c-5p'}, 'MIMAT0000065': {'hsa-let-7d-5p', 'hsa-let-7d'}, 'MIMAT0000066': {'hsa-let-7e-5p', 'hsa-let-7e'}, 'MIMAT0000067': {'hsa-let-7f-5p', 'hsa-let-7f'}, 'MIM...(truncated) | 2 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirbase.mirbase_ids | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.09 | list | [('MIMAT0000062', 'MI0000062'), ('MIMAT0000062', 'MI0000060'), ('MIMAT0000062', 'MI0000061'), ('MIMAT0000063', 'MI0000063'), ('MIMAT0000064', 'MI0000064'), ('MIMAT0000065', 'MI0000065'), ('MIMAT0000066', 'MI0000066'), ('MIMAT0000067', 'MI0000067'), ('MIMAT0000067', 'MI0000068'), ('MIMAT0000068', 'MI...(truncated) | 3,027 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirbase.mirbase_mature | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.06 | list | [('MIMAT0000062', 'hsa-let-7a'), ('MIMAT0000062', 'hsa-let-7a-5p'), ('MIMAT0000063', 'hsa-let-7b-5p'), ('MIMAT0000063', 'hsa-let-7b'), ('MIMAT0000064', 'hsa-let-7c'), ('MIMAT0000064', 'hsa-let-7c-5p'), ('MIMAT0000065', 'hsa-let-7d-5p'), ('MIMAT0000065', 'hsa-let-7d'), ('MIMAT0000066', 'hsa-let-7e-5p...(truncated) | 3,487 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirbase.mirbase_mature_all | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.08 | list | ['MIMAT0000062', 'MIMAT0000062', 'MIMAT0000062', 'MIMAT0000063', 'MIMAT0000064', 'MIMAT0000065', 'MIMAT0000066', 'MIMAT0000067', 'MIMAT0000067', 'MIMAT0000068', 'MIMAT0000069', 'MIMAT0000069', 'MIMAT0000070', 'MIMAT0000071', 'MIMAT0000072', 'MIMAT0000073', 'MIMAT0000074', 'MIMAT0000074', 'MIMAT00000...(truncated) | 3,027 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirbase.mirbase_precursor | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.06 | list | [('MI0000060', 'hsa-let-7a-1L'), ('MI0000060', 'hsa-let-7a-1'), ('MI0000061', 'hsa-let-7a-2L'), ('MI0000061', 'hsa-let-7a-2'), ('MI0000062', 'hsa-let-7a-3L'), ('MI0000062', 'hsa-let-7a-3'), ('MI0000063', 'hsa-let-7b'), ('MI0000063', 'hsa-let-7bL'), ('MI0000064', 'hsa-let-7cL'), ('MI0000064', 'hsa-le...(truncated) | 2,173 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirbase.mirbase_precursor_all | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.08 | list | ['MI0000062', 'MI0000060', 'MI0000061', 'MI0000063', 'MI0000064', 'MI0000065', 'MI0000066', 'MI0000067', 'MI0000068', 'MI0000069', 'MI0000115', 'MI0000070', 'MI0000071', 'MI0000071', 'MI0000072', 'MI0000073', 'MI0000075', 'MI0000074', 'MI0000076', 'MI0000077', 'MI0000078', 'MI0000079', 'MI0000080', ...(truncated) | 3,027 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirbase.mirbase_precursor_to_mature | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.14 | list | [('hsa-let-7a-1L', 'MIMAT0000062'), ('hsa-let-7a-1L', 'MIMAT0004481'), ('hsa-let-7a-1', 'MIMAT0000062'), ('hsa-let-7a-1', 'MIMAT0004481'), ('hsa-let-7a-2L', 'MIMAT0010195'), ('hsa-let-7a-2L', 'MIMAT0000062'), ('hsa-let-7a-2L', 'MIMAT0004481'), ('hsa-let-7a-2', 'MIMAT0010195'), ('hsa-let-7a-2', 'MIMA...(truncated) | 3,361 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirdeathdb.mirdeathdb_interactions | 2023-06-18 19:37:12 | 2023-06-18 19:37:12 | 0.20 | list | [MirdeathdbInteraction(mirna='MIMAT0020823', target_entrez='40009', organism=7227, pubmed='12679032', function='apoptosis_down'), MirdeathdbInteraction(mirna='MIMAT0000365', target_entrez='40009', organism=7227, pubmed='12679032', function='apoptosis_down'), MirdeathdbInteraction(mirna='MIMAT0020823...(truncated) | 462 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirecords.mirecords_interactions | 2023-06-18 19:37:12 | 2023-06-18 19:37:13 | 0.45 | list | [MirecordsInteraction(mirna_name='hsa-miR-23a', target_refseq='NM_198155', target_genesymbol='C21orf33', mirna_organism='Homo sapiens', target_organism='Homo sapiens', pmid='12808467'), MirecordsInteraction(mirna_name='mmu-miR-434-3p', target_refseq='NM_184109', target_genesymbol='Rtl1', mirna_organ...(truncated) | 3,106 | {} | 2023-06-18 19:37:12 | |
| ¶ | pypath.inputs.mirtarbase._mirtarbase_interactions |
Not calling `pypath.inputs.mirtarbase._mirtarbase_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.mirtarbase.mirtarbase_interactions | 2023-06-18 19:37:13 | 2023-06-18 19:37:29 | 16.14 | list | [MirtarbaseInteraction(mirtarbase_id='MIRT003135', mirna_name='mmu-miR-122-5p', mirna_organism='Mus musculus', target_genesymbol='Cd320', target_entrez='54219', target_organism='Mus musculus', target_site='AGAGACTGGGGTCCTCAGACACTCCC', method='Luciferase reporter assay//qRT-PCR//Western blot', catego...(truncated) | 21,560 | {} | 2023-06-18 19:37:13 | |
| ¶ | pypath.inputs.mitab.mitab_field_list |
Not calling `pypath.inputs.mitab.mitab_field_list`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.mitab.mitab_field_uniprot |
Not calling `pypath.inputs.mitab.mitab_field_uniprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.mppi.mppi_interactions | 2023-06-18 19:37:29 | 2023-06-18 19:37:29 | 0.28 | list | [['9867828', '9867828', 'P05109', 'SP', 'S100A8;CAGA;MRP8; calgranulin A (migration inhibitory factor-related protein 8)', '9606', 'P06702', 'SP', 'S100A9;CAGB;MRP14; calgranulin B (migration inhibitory factor-related protein 14)', '9606'], ['9867828', '9867828', 'P06702', 'SP', 'S100A9;CAGB;MRP14; ...(truncated) | 777 | {} | 2023-06-18 19:37:29 | |
| ¶ | pypath.inputs.msigdb.msigdb_annotations | 2023-06-18 19:37:29 | 2023-06-18 19:38:28 | 58.31 | dict | {'Q9UDY4': {MsigdbAnnotation(collection='mirna_targets_mirdb', geneset='MIR16_5P'), MsigdbAnnotation(collection='mirna_targets_mirdb', geneset='MIR12136'), MsigdbAnnotation(collection='immunesigdb', geneset='GSE24142_DN2_VS_DN3_THYMOCYTE_FETAL_DN'), MsigdbAnnotation(collection='tf_targets_gtrf', gen...(truncated) | 20,100 | {} | 2023-06-18 19:37:29 | |
| ¶ | pypath.inputs.msigdb.msigdb_download | 2023-06-18 19:38:29 | 2023-06-18 19:38:44 | 14.29 | dict | {'chr1p11': {'SRGAP2C', 'EMBP1', 'NBPF8', 'PFN1P2', 'LINC01691', 'RNVU1-19', 'MTIF2P1', 'H3P4', 'PDE4DIPP4', 'PPIAL4A', 'FCGR1BP', 'LINC00623', 'RPL22P6', 'PDE4DIPP2', 'H2BP1', 'LINC02798', 'NBPF26', 'SRGAP2-AS1', 'NOTCH2NLR', 'RNVU1-4', 'FAM72B'}, 'chr1p12': {'HSD3B1', 'HSD3B2', 'VDAC2P3', 'LINC015...(truncated) | 33,591 | {} | 2023-06-18 19:38:29 | |
| ¶ | pypath.inputs.msigdb.msigdb_download_collections | 2023-06-18 19:38:44 | 2023-06-18 19:38:45 | 0.48 | dict | {('hallmark', 'h.all'): {'HALLMARK_TNFA_SIGNALING_VIA_NFKB': {'PLAUR', 'PANX1', 'PLK2', 'DENND5A', 'BTG3', 'PDE4B', 'REL', 'CXCL6', 'IL12B', 'LIF', 'FOSL1', 'IL23A', 'SOCS3', 'JAG1', 'PHLDA1', 'ATF3', 'ICOSLG', 'LITAF', 'CCL2', 'TANK', 'CEBPD', 'SERPINB2', 'ETS2', 'CDKN1A', 'FOSL2', 'PTPRE', 'TIPARP...(truncated) | 18 | {} | 2023-06-18 19:38:44 | |
| ¶ | pypath.inputs.ncrdeathdb.ncrdeathdb_interactions | 2023-06-18 19:38:45 | 2023-06-18 19:38:45 | 0.35 | list | [NcrdeathdbInteraction(ncrna='MIMAT0000062', target_gene='ain-1', ncrna_type='miRNA', pathway='autophagy', effect='down', pmid='23619095', organism=6239), NcrdeathdbInteraction(ncrna='MIMAT0000063', target_gene='ain-1', ncrna_type='miRNA', pathway='autophagy', effect='down', pmid='23619095', organis...(truncated) | 7,305 | {} | 2023-06-18 19:38:45 | |
| ¶ | pypath.inputs.negatome.negatome_interactions | 2023-06-18 19:38:45 | 2023-06-18 19:39:15 | 30.04 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/negatome.py", line 54, in negatome_interactions
for l in f:
TypeError: 'NoneType' object is not iterable
|
{} | 2023-06-12 19:39:07 | |||
| ¶ | pypath.inputs.netbiol._netbiol_interactions |
Not calling `pypath.inputs.netbiol._netbiol_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.netbiol.arn_interactions | 2023-06-18 19:39:15 | 2023-06-18 19:39:15 | 0.14 | list | [ArnInteraction(source_uniprot='O15350', target_uniprot='O95352', is_direct='0', is_directed='1', effect='0', source_autophagy='0', target_autophagy='1', references='19001857'), ArnInteraction(source_uniprot='O15350', target_uniprot='Q9H1Y0', is_direct='0', is_directed='1', effect='0', source_autoph...(truncated) | 95 | {} | 2023-06-18 19:39:15 | |
| ¶ | pypath.inputs.netbiol.nrf2ome_interactions | 2023-06-18 19:39:15 | 2023-06-18 19:39:16 | 0.14 | list | [Nrf2omeInteraction(source_uniprot='O00221', target_uniprot='O15379', is_direct='1', is_directed='0', effect='0', references='18241676'), Nrf2omeInteraction(source_uniprot='O00221', target_uniprot='Q16236', is_direct='0', is_directed='1', effect='-1', references='18241676'), Nrf2omeInteraction(sourc...(truncated) | 109 | {} | 2023-06-18 19:39:15 | |
| ¶ | pypath.inputs.netpath.netpath_interactions | 2023-06-18 19:39:16 | 2023-06-18 19:39:18 | 2.44 | list | [['IL4R', '3566', 'IL4R', '3566', '8266078', 'in vivo', 'physical interaction', 'Interleukin-4 (IL-4)'], ['IL4R', '3566', 'IL2RG', '3561', '8266078', 'in vivo', 'physical interaction', 'Interleukin-4 (IL-4)'], ['IL2RG', '3561', 'IL2RG', '3561', '8266078', 'in vivo', 'physical interaction', 'Interleu...(truncated) | 7,555 | {} | 2023-06-18 19:39:16 | |
| ¶ | pypath.inputs.netpath.netpath_names | 2023-06-18 19:39:18 | 2023-06-18 19:39:18 | 0.01 | dict | {'137': 'Advanced glycation end-products (AGE/RAGE)', '1': 'Alpha6 Beta4 Integrin', '2': 'Androgen receptor (AR)', '12': 'B cell receptor (BCR)', '76': 'Brain-derived neurotrophic factor (BDNF)', '129': 'Corticotropin-releasing hormone (CRH)', '4': 'Epidermal growth factor receptor (EGFR)', '25': 'F...(truncated) | 35 | {} | 2023-06-18 19:39:18 | |
| ¶ | pypath.inputs.netpath.netpath_pathway_annotations | 2023-06-18 19:39:18 | 2023-06-18 19:39:36 | 18.14 | dict | {'Q15109': {NetpathPathway(pathway='Advanced glycation end-products (AGE/RAGE)')}, 'O95831': {NetpathPathway(pathway='Advanced glycation end-products (AGE/RAGE)')}, 'P54819': {NetpathPathway(pathway='Advanced glycation end-products (AGE/RAGE)')}, 'P31749': {NetpathPathway(pathway='Advanced glycation...(truncated) | 1,870 | {} | 2023-06-18 19:39:18 | |
| ¶ | pypath.inputs.oma.oma_orthologs |
Not calling `pypath.inputs.oma.oma_orthologs`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ontology.listof_ontologies | 2023-06-18 19:39:36 | 2023-06-18 19:39:37 | 1.21 | dict | {'rs': 'Rat Strain Ontology', 'sbo': 'Systems Biology Ontology', 'scdo': 'Sickle Cell Disease Ontology', 'sdgio': 'Sustainable Development Goals Interface Ontology', 'sepio': 'Scientific Evidence and Provenance Information Ontology', 'sibo': 'Social Insect Behavior Ontology', 'spd': 'Spider Ontology...(truncated) | 280 | {} | 2023-06-18 19:39:36 | |
| ¶ | pypath.inputs.ontology.ontology |
Not calling `pypath.inputs.ontology.ontology`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.opm.opm_annotations | 2023-06-18 19:39:37 | 2023-06-18 19:40:00 | 22.51 | dict | {'O00168': {OpmAnnotation(membrane='Eykaryo. plasma', family='FXYD regulators', transmembrane=True)}, 'P08842': {OpmAnnotation(membrane='Endoplasm. reticulum', family='Sulfatase', transmembrane=True)}, 'P26678': {OpmAnnotation(membrane='Endoplasm. reticulum', family='Calcium ATPase regulators', tran...(truncated) | 87 | {} | 2023-06-18 19:39:37 | |
| ¶ | pypath.inputs.oreganno.oreganno_interactions | 2023-06-18 19:40:00 | 2023-06-18 19:42:12 | 131.93 | list | [OregannoInteraction(tf='ESR1', target='MACROD1', pmid='15691879'), OregannoInteraction(tf='ESR1', target='MACROD1', pmid='15691879'), OregannoInteraction(tf='ESR1', target='MACROD1', pmid='15691879'), OregannoInteraction(tf='SP1', target='MACROD1', pmid='15691879'), OregannoInteraction(tf='SP1', ta...(truncated) | 5,903 | {} | 2023-06-18 19:40:00 | |
| ¶ | pypath.inputs.oreganno.oreganno_raw | 2023-06-18 19:42:12 | 2023-06-18 19:42:24 | 11.97 | list | [('OREG0000000', 'Homo sapiens', 'POSITIVE OUTCOME', 'REGULATORY POLYMORPHISM', 'CTLA4', '1493', 'NCBI', 'N/A', 'N/A', 'N/A', 'rs3087243', '12724780', 'N/A', 'hg18', '1', 'chr2', '204447164', '204447164'), ('OREG0000000', 'Homo sapiens', 'POSITIVE OUTCOME', 'REGULATORY POLYMORPHISM', 'CTLA4', '1493'...(truncated) | 5,688,970 | {} | 2023-06-18 19:42:12 | |
| ¶ | pypath.inputs.panglaodb.panglaodb_annotations | 2023-06-18 19:42:24 | 2023-06-18 19:42:25 | 1.53 | defaultdict | defaultdict(<class 'set'>, {'P17538': {PanglaodbAnnotation(canonical_marker=False, cell_type='Enterocytes', organ='GI tract', germ_layer='Endoderm', entity_type='protein', human=(True,), mouse=(True,), human_sensitivity=0.0, mouse_sensitivity=0.00331126, human_specificity=0.00439422, mouse_specifici...(truncated) | 4,792 | {} | 2023-06-18 19:42:24 | |
| ¶ | pypath.inputs.panglaodb.panglaodb_raw | 2023-06-18 19:42:25 | 2023-06-18 19:42:25 | 0.04 | list | [{'species': 'Mm Hs', 'official gene symbol': 'CTRB1', 'cell type': 'Acinar cells', 'nicknames': 'CTRB', 'ubiquitousness index': '0.017', 'product description': 'chymotrypsinogen B1', 'gene type': 'protein-coding gene', 'canonical marker': '1', 'germ layer': 'Endoderm', 'organ': 'Pancreas', 'sensiti...(truncated) | 8,286 | {} | 2023-06-18 19:42:25 | |
| ¶ | pypath.inputs.pathophenodb.disease_pathogen_interactions | 2023-06-18 19:42:25 | 2023-06-18 19:42:25 | 0.00 | list | [] | 0 | {} | 2023-06-18 19:42:25 | |
| ¶ | pypath.inputs.pathwaycommons._create_single_resource_method |
Not calling `pypath.inputs.pathwaycommons._create_single_resource_method`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons.pathwaycommons_interactions | 2023-06-18 19:42:25 | 2023-06-18 19:42:42 | 16.32 | list | [PathwayCommonsInteraction(id_a='A2M', interaction_type='in-complex-with', id_b='BCL2L1', resource='WikiPathways'), PathwayCommonsInteraction(id_a='A2M', interaction_type='in-complex-with', id_b='CRP', resource='WikiPathways'), PathwayCommonsInteraction(id_a='A2M', interaction_type='in-complex-with'...(truncated) | 1,261,865 | {} | 2023-06-18 19:42:25 | |
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pathwaycommons._pc_single_resource |
Not calling `pypath.inputs.pathwaycommons._pc_single_resource`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pazar.pazar_interactions | 2023-06-18 19:42:43 | 2023-06-18 19:42:43 | 0.26 | list | [PazarInteraction(tf='ENST00000265354', target='ENSG00000143632', pmid='12760745'), PazarInteraction(tf='ENST00000265354', target='ENSG00000143632', pmid='9571041'), PazarInteraction(tf='ENST00000265354', target='ENSG00000143632', pmid='12760745'), PazarInteraction(tf='ENST00000265354', target='ENSG...(truncated) | 16,386 | {} | 2023-06-18 19:42:43 | |
| ¶ | pypath.inputs.pdb.pdb_chains | 2023-06-18 19:42:43 | 2023-06-18 19:42:51 | 8.08 | tuple | ({'P02185': [{'pdb': '101m', 'chain': 'A', 'chain_beg': 1, 'chain_end': 154, 'pdb_beg': 0, 'pdb_end': 153, 'uniprot_beg': 1, 'uniprot_end': 154, 'offset': 1}, {'pdb': '102m', 'chain': 'A', 'chain_beg': 1, 'chain_end': 154, 'pdb_beg': 0, 'pdb_end': 153, 'uniprot_beg': 1, 'uniprot_end': 154, 'offset':...(truncated) | 2 | {} | 2023-06-18 19:42:43 | |
| ¶ | pypath.inputs.pdb.pdb_complexes | 2023-06-18 19:42:53 | 2023-06-18 19:43:02 | 8.47 | dict | {'COMPLEX:P00720': Complex: COMPLEX:P00720, 'COMPLEX:P09211': Complex: COMPLEX:P09211, 'COMPLEX:P00817': Complex: COMPLEX:P00817, 'COMPLEX:P00963': Complex: COMPLEX:P00963, 'COMPLEX:P00669': Complex: COMPLEX:P00669, 'COMPLEX:P07378': Complex: COMPLEX:P07378, 'COMPLEX:P01837_P01869': Complex: COMPLEX...(truncated) | 42,870 | {} | 2023-06-18 19:42:53 | |
| ¶ | pypath.inputs.pdb.pdb_uniprot | 2023-06-18 19:43:02 | 2023-06-18 19:43:46 | 43.84 | tuple | ({'P02185': {('2ohb', 'X-ray', 1.8), ('5zzg', 'X-ray', 1.8), ('1co8', 'X-ray', 1.8), ('6m8f', 'X-ray', 1.1), ('1ofk', 'X-ray', 1.8), ('2mgf', 'X-ray', 1.8), ('5kkk', 'X-ray', 1.7), ('1mlf', 'X-ray', 2.0), ('1ch2', 'X-ray', 1.8), ('1mbd', 'X-ray', 1.4), ('1l2k', 'Neutron', 1.5), ('5m3s', 'X-ray', 1.8...(truncated) | 2 | {} | 2023-06-18 19:43:02 | |
| ¶ | pypath.inputs.pdzbase.pdzbase_interactions | 2023-06-18 19:43:46 | 2023-06-18 19:43:47 | 0.94 | list | [PDZbaseInteraction(uniprot_pdz='O14745', isoform_pdz=1, uniprot_ligand='P13569', isoform_ligand=1, genesymbol_pdz='NHERF-1', genesymbol_ligand='CFTR', pdz_domain=1, organism=9606, pubmed=9613608), PDZbaseInteraction(uniprot_pdz='O14745', isoform_pdz=1, uniprot_ligand='P40879', isoform_ligand=1, gen...(truncated) | 339 | {} | 2023-06-18 19:43:46 | |
| ¶ | pypath.inputs.pepcyber.pepcyber_details |
Not calling `pypath.inputs.pepcyber.pepcyber_details`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pepcyber.pepcyber_interactions | 2023-06-18 19:43:47 | 2023-06-18 19:55:30 | 703.49 | list | [PepcyberInteraction(ppdb_class='14-3-3', ppdb_genesymbol='LOC284100', substrate_genesymbol='Bad', binding_seq='SPFRGRSRpSAPPNLWAA', binding_pos=136, all_evidences='Inference', n_records=1, category='A', substrate_residue='S', ppdb_uniprot='A2RUB5', ppdb_refseq='XP_375443', substrate_uniprot='Q61337...(truncated) | 5,590 | {} | 2023-06-18 19:43:47 | |
| ¶ | pypath.inputs.pfam._pfam_uniprot |
Not calling `pypath.inputs.pfam._pfam_uniprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pfam.pfam_names | 2023-06-18 19:55:30 | 2023-06-18 19:55:32 | 1.13 | tuple | ({'PFAM_NAME': {'PFAM_ACCESSION'}, 'Globin': {'PF00042'}, 'Phage_lysozyme': {'PF00959'}, 'GST_N': {'PF02798'}, 'GST_C_3': {'PF14497'}, 'DNA_methylase': {'PF00145'}, 'Pyrophosphatase': {'PF00719'}, 'AsnA': {'PF03590'}, 'RnaseA': {'PF00074'}, 'Ras': {'PF00071'}, 'Carb_anhydrase': {'PF00194'}, 'Lys': {...(truncated) | 2 | {} | 2023-06-18 19:55:30 | |
| ¶ | pypath.inputs.pfam.pfam_pdb | 2023-06-18 19:55:32 | 2023-06-18 19:55:35 | 3.82 | tuple | ({'101m': {'PF00042': PfamDomain(chain='A', start=27, end=143)}, '102l': {'PF00959': PfamDomain(chain='A', start=24, end=149)}, '102m': {'PF00042': PfamDomain(chain='A', start=27, end=143)}, '103l': {'PF00959': PfamDomain(chain='A', start=24, end=151)}, '103m': {'PF00042': PfamDomain(chain='A', star...(truncated) | 2 | {} | 2023-06-18 19:55:32 | |
| ¶ | pypath.inputs.pfam.pfam_regions | 2023-06-18 19:55:36 | 2023-06-18 20:00:41 | 305.30 | tuple | ({}, {}) | 2 | {} | 2023-06-18 19:55:36 | |
| ¶ | pypath.inputs.pfam.pfam_uniprot | 2023-06-18 20:00:41 | 2023-06-18 20:00:42 | 0.64 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/pfam.py", line 100, in pfam_uniprot
data = data.split('\n')
AttributeError: 'NoneType' object has no attribute 'split'
|
{} | 2023-06-12 19:59:27 | |||
| ¶ | pypath.inputs.pharos._create_query_functions | 2023-06-18 20:00:42 | 2023-06-18 20:00:42 | 0.00 | NoneType | None | 0 | {} | 2023-06-18 20:00:42 | |
| ¶ | pypath.inputs.pharos.pharos_diseases | 2023-06-18 20:00:42 | 2023-06-18 20:01:45 | 62.67 | list | [{'name': 'Keratin-associated protein 9-6', 'sym': 'KRTAP9-6', 'uniprot': 'A8MVA2', 'diseases': []}, {'name': 'Keratin-associated protein 29-1', 'sym': 'KRTAP29-1', 'uniprot': 'A8MX34', 'diseases': [{'name': 'psoriasis', 'mondoID': 'MONDO:0005083', 'dids': [{'id': 'DOID:8893', 'dataSources': ['Expre...(truncated) | 20,412 | {} | 2023-06-18 20:00:42 | |
| ¶ | pypath.inputs.pharos.pharos_expression | 2023-06-18 20:01:46 | 2023-06-18 20:01:49 | 3.52 | list | [{'name': 'Keratin-associated protein 9-6', 'sym': 'KRTAP9-6', 'uniprot': 'A8MVA2', 'diseases': []}, {'name': 'Keratin-associated protein 29-1', 'sym': 'KRTAP29-1', 'uniprot': 'A8MX34', 'diseases': [{'name': 'psoriasis', 'mondoID': 'MONDO:0005083', 'dids': [{'id': 'DOID:8893', 'dataSources': ['Expre...(truncated) | 20,412 | {} | 2023-06-18 20:01:46 | |
| ¶ | pypath.inputs.pharos.pharos_general |
Not calling `pypath.inputs.pharos.pharos_general`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pharos.pharos_gtex | 2023-06-18 20:01:51 | 2023-06-18 20:01:54 | 3.25 | list | [{'name': 'Keratin-associated protein 9-6', 'sym': 'KRTAP9-6', 'uniprot': 'A8MVA2', 'diseases': []}, {'name': 'Keratin-associated protein 29-1', 'sym': 'KRTAP29-1', 'uniprot': 'A8MX34', 'diseases': [{'name': 'psoriasis', 'mondoID': 'MONDO:0005083', 'dids': [{'id': 'DOID:8893', 'dataSources': ['Expre...(truncated) | 20,412 | {} | 2023-06-18 20:01:51 | |
| ¶ | pypath.inputs.pharos.pharos_ligands | 2023-06-18 20:01:55 | 2023-06-18 20:01:58 | 3.48 | list | [{'name': 'Keratin-associated protein 9-6', 'sym': 'KRTAP9-6', 'uniprot': 'A8MVA2', 'diseases': []}, {'name': 'Keratin-associated protein 29-1', 'sym': 'KRTAP29-1', 'uniprot': 'A8MX34', 'diseases': [{'name': 'psoriasis', 'mondoID': 'MONDO:0005083', 'dids': [{'id': 'DOID:8893', 'dataSources': ['Expre...(truncated) | 20,412 | {} | 2023-06-18 20:01:55 | |
| ¶ | pypath.inputs.pharos.pharos_orthologs | 2023-06-18 20:02:00 | 2023-06-18 20:02:03 | 3.12 | list | [{'name': 'Keratin-associated protein 9-6', 'sym': 'KRTAP9-6', 'uniprot': 'A8MVA2', 'diseases': []}, {'name': 'Keratin-associated protein 29-1', 'sym': 'KRTAP29-1', 'uniprot': 'A8MX34', 'diseases': [{'name': 'psoriasis', 'mondoID': 'MONDO:0005083', 'dids': [{'id': 'DOID:8893', 'dataSources': ['Expre...(truncated) | 20,412 | {} | 2023-06-18 20:02:00 | |
| ¶ | pypath.inputs.pharos.pharos_targets | 2023-06-18 20:02:04 | 2023-06-18 20:02:38 | 34.72 | list | [{'name': 'Keratin-associated protein 9-6', 'sym': 'KRTAP9-6', 'uniprot': 'A8MVA2'}, {'name': 'Keratin-associated protein 29-1', 'sym': 'KRTAP29-1', 'uniprot': 'A8MX34'}, {'name': 'Keratin-associated protein 19-4', 'sym': 'KRTAP19-4', 'uniprot': 'Q3LI73'}, {'name': 'Keratin-associated protein 20-3',...(truncated) | 20,412 | {} | 2023-06-18 20:02:04 | |
| ¶ | pypath.inputs.pharos.pharos_xrefs | 2023-06-18 20:02:38 | 2023-06-18 20:02:42 | 3.86 | list | [{'name': 'Keratin-associated protein 9-6', 'sym': 'KRTAP9-6', 'uniprot': 'A8MVA2', 'diseases': []}, {'name': 'Keratin-associated protein 29-1', 'sym': 'KRTAP29-1', 'uniprot': 'A8MX34', 'diseases': [{'name': 'psoriasis', 'mondoID': 'MONDO:0005083', 'dids': [{'id': 'DOID:8893', 'dataSources': ['Expre...(truncated) | 20,412 | {} | 2023-06-18 20:02:38 | |
| ¶ | pypath.inputs.phobius.phobius_annotations | 2023-06-18 20:02:43 | 2023-06-18 20:02:44 | 0.40 | dict | {'P01920': {PhobiusAnnotation(tm_helices=1, signal_peptide=True, cytoplasmic=1, non_cytoplasmic=1)}, 'P18440': {PhobiusAnnotation(tm_helices=0, signal_peptide=False, cytoplasmic=0, non_cytoplasmic=1)}, 'P00740': {PhobiusAnnotation(tm_helices=0, signal_peptide=True, cytoplasmic=0, non_cytoplasmic=1)}...(truncated) | 20,350 | {} | 2023-06-18 20:02:43 | |
| ¶ | pypath.inputs.phosphatome.phosphatome_annotations | 2023-06-18 20:02:44 | 2023-06-18 20:02:50 | 5.79 | dict | {'P09923': {PhosphatomeAnnotation(fold='AP', family='AP', subfamily='AP', has_protein_substrates=True, has_non_protein_substrates=True, has_catalytic_activity=True)}, 'P05186': {PhosphatomeAnnotation(fold='AP', family='AP', subfamily='AP', has_protein_substrates=True, has_non_protein_substrates=True...(truncated) | 264 | {} | 2023-06-18 20:02:44 | |
| ¶ | pypath.inputs.phosphoelm.phosphoelm_enzyme_substrate | 2023-06-18 20:02:50 | 2023-06-18 20:02:51 | 1.48 | list | [{'instance': None, 'isoform': 1, 'resaa': 'Y', 'resnum': 204, 'start': None, 'end': None, 'substrate': 'O14543', 'kinase': 'P06239', 'references': ['12783885'], 'experiment': 'LTP', 'organism': 'Homo sapiens'}, {'instance': None, 'isoform': 1, 'resaa': 'Y', 'resnum': 221, 'start': None, 'end': None...(truncated) | 2,426 | {} | 2023-06-18 20:02:50 | |
| ¶ | pypath.inputs.phosphoelm.phosphoelm_interactions | 2023-06-18 20:02:51 | 2023-06-18 20:02:52 | 0.52 | list | [['P06239', 'O14543', '12783885', 'Homo sapiens'], ['P06239', 'O14543', '15173187', 'Homo sapiens'], ['P12931', 'O14746', '12808100', 'Homo sapiens'], ['P06241', 'O15117', '10409671', 'Homo sapiens'], ['P06241', 'O15117', '10570256', 'Homo sapiens'], ['P06241', 'O15117', '10409671', 'Homo sapiens'],...(truncated) | 2,426 | {} | 2023-06-18 20:02:51 | |
| ¶ | pypath.inputs.phosphoelm.phosphoelm_kinases | 2023-06-18 20:02:52 | 2023-06-18 20:02:52 | 0.11 | dict | {'AAK1': 'Q2M2I8', 'Abl': 'P00519', 'Abl2': 'P42684', 'Abl_drome': 'P00522', 'Ack_drome': 'Q9VZI2', 'AFK': 'P80197', 'Akt1_drome': 'Q8INB9', 'ALK': 'Q9UM73', 'Atg1_drome': 'Q9VU14', 'ATM': 'Q13315', 'ATR': 'Q13535', 'Aurora A': 'O14965', 'Aurora B': 'Q96GD4', 'Axl': 'P30530', 'BCKDK': 'O14874', 'BLK...(truncated) | 247 | {} | 2023-06-18 20:02:52 | |
| ¶ | pypath.inputs.phosphonetworks.phosphonetworks_enzyme_substrate | 2023-06-18 20:02:52 | 2023-06-18 20:02:54 | 1.80 | list | [{'instance': 'SSYGISETTLEEIFL', 'kinase': 'CSNK2A1', 'resaa': 'T', 'resnum': 1242, 'score': 1.0162, 'substrate': 'ABCA1', 'start': 1235, 'end': 1249}, {'instance': 'SYGISETTLEEIFLK', 'kinase': 'CSNK2A1', 'resaa': 'T', 'resnum': 1243, 'score': 1.0455, 'substrate': 'ABCA1', 'start': 1236, 'end': 1250...(truncated) | 4,417 | {} | 2023-06-18 20:02:52 | |
| ¶ | pypath.inputs.phosphonetworks.phosphonetworks_interactions | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.02 | list | [['DYRK2', 'CSDC2'], ['MAPK3', 'CALD1'], ['PRKCA', 'NCF1'], ['ZAP70', 'DBNL'], ['MAP3K7', 'RAP1A'], ['CSNK2A1', 'SRPK1'], ['SYK', 'BLNK'], ['MAPK1', 'TP53'], ['AURKB', 'INCENP'], ['FYN', 'CBL'], ['STK17A', 'ZFP36'], ['PAK1', 'ESR1'], ['PNCK', 'PPP2R5D'], ['CAMKK1', 'PPP1R13L'], ['LYN', 'CD79A'], ['S...(truncated) | 1,821 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphopoint.phosphopoint_directions | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.24 | list | [('AKT1', 'AKT1'), ('AKT1', 'AKT2'), ('AKT1', 'ESR2'), ('AKT1', 'PHLPP'), ('AKT1', 'APPL'), ('AKT1', 'TCL6'), ('AKT1', 'GRB10'), ('AKT1', 'HSP90AA1'), ('AKT1', 'HSP90AB1'), ('AKT1', 'APLP2'), ('AKT1', 'IKBKB'), ('AKT1', 'ILK'), ('AKT1', 'IMPDH2'), ('AKT1', 'IRS1'), ('AKT1', 'KRT10'), ('AKT1', 'MDM4'...(truncated) | 9,269 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphopoint.phosphopoint_interactions | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.02 | list | [PhosphopointInteraction(source_genesymbol='AKT1', source_entrez='207', target_genesymbol='AKT1', target_entrez='207', category='Category 2'), PhosphopointInteraction(source_genesymbol='AKT1', source_entrez='207', target_genesymbol='AKT2', target_entrez='208', category='Category 2'), PhosphopointInt...(truncated) | 9,269 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite._phosphosite_filter_organism |
Not calling `pypath.inputs.phosphosite._phosphosite_filter_organism`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.phosphosite.phosphosite_directions | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.01 | list | [['P28482', 'Q8N122'], ['Q9NYL2', 'Q9NYL2'], ['P12931', 'P00533'], ['O14757', 'P08631'], ['P45983', 'Q96I25'], ['Q02156', 'O14920'], ['P37173', 'P37173'], ['P31749', 'P49840'], ['Q13153', 'Q96P20'], ['P49840', 'P49840'], ['P45984', 'P46937'], ['P06493', 'Q9GZV5'], ['P11309', 'P52907'], ['O14757', 'Q...(truncated) | 8,971 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_enzyme_substrate | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.35 | list | [{'kinase': 'Q9BQI3', 'kinase_org': 'human', 'substrate': 'P05198', 'substrate_org': 'human', 'residue': 'S52', 'motif': 'MILLsELsRRRIRsI', 'resaa': 'S', 'resnum': 52, 'start': 45, 'end': 59, 'instance': 'MILLSELSRRRIRSI'}, {'kinase': 'Q9BQI3', 'kinase_org': 'human', 'substrate': 'P05198', 'substrat...(truncated) | 13,459 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_interactions | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.00 | tuple | ([['Q05513', 'P27448', '', 'human', 'AB;MS', '21983960;15174125;15084291;23312004;24719451'], ['P28482', 'Q8N122', 'human', 'human', 'MA', '21071439'], ['Q9NYL2', 'Q9NYL2', 'human', 'human', 'AB;MA', '15342622'], ['P12931', 'P00533', 'human', 'human', 'AB;WB;MS;MA', '20628053;11960379;21278788;14530...(truncated) | 2 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_interactions_all | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.01 | list | [['Q05513', 'P27448', '', 'human', 'AB;MS', '21983960;15174125;15084291;23312004;24719451'], ['P28482', 'Q8N122', 'human', 'human', 'MA', '21071439'], ['Q9NYL2', 'Q9NYL2', 'human', 'human', 'AB;MA', '15342622'], ['P12931', 'P00533', 'human', 'human', 'AB;WB;MS;MA', '20628053;11960379;21278788;145302...(truncated) | 9,041 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_interactions_curated | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.00 | list | [['Q05513', 'P27448', '', 'human', 'AB;MS', '21983960;15174125;15084291;23312004;24719451'], ['P28482', 'Q8N122', 'human', 'human', 'MA', '21071439'], ['Q9NYL2', 'Q9NYL2', 'human', 'human', 'AB;MA', '15342622'], ['P12931', 'P00533', 'human', 'human', 'AB;WB;MS;MA', '20628053;11960379;21278788;145302...(truncated) | 4,309 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_interactions_new | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.00 | tuple | ([['Q05513', 'P27448', '', 'human', 'AB;MS', '21983960;15174125;15084291;23312004;24719451'], ['P28482', 'Q8N122', 'human', 'human', 'MA', '21071439'], ['Q9NYL2', 'Q9NYL2', 'human', 'human', 'AB;MA', '15342622'], ['P12931', 'P00533', 'human', 'human', 'AB;WB;MS;MA', '20628053;11960379;21278788;14530...(truncated) | 2 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_interactions_noref | 2023-06-18 20:02:54 | 2023-06-18 20:02:54 | 0.00 | list | [['P51451', 'P31995', 'human', 'human', 'MS', ''], ['O14757', 'O60343', 'human', 'human', 'MS', ''], ['Q96GD4', 'Q09666', 'human', 'human', 'MS', ''], ['O14757', 'Q96QD9', 'human', 'human', 'MS', ''], ['P06493', 'O14715', 'human', 'human', 'MS', ''], ['Q5S007', 'P04637', 'human', 'human', 'AB;WB;MA'...(truncated) | 4,732 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_ptm_orthology | 2023-06-18 20:02:54 | 2023-06-18 20:03:00 | 5.31 | dict | {('P31946', 1, 'T', 2, 9606, 'phosphorylation'): {10090: {('Q9CQV8', 1, 'T', 2, 10090, 'phosphorylation')}}, ('Q9CQV8', 1, 'T', 2, 10090, 'phosphorylation'): {9606: {('P31946', 1, 'T', 2, 9606, 'phosphorylation')}}, ('P31946', 1, 'S', 6, 9606, 'phosphorylation'): {10090: {('Q9CQV8', 1, 'S', 6, 10090...(truncated) | 198,635 | {} | 2023-06-18 20:02:54 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_ptms | 2023-06-18 20:03:00 | 2023-06-18 20:03:15 | 14.42 | list | [<PTM Residue YWHAB-1:T2:20q13.12>, <PTM Residue YWHAB-1:S6:20q13.12>, <PTM Residue YWHAB-1:Y21:20q13.12>, <PTM Residue YWHAB-1:T32:20q13.12>, <PTM Residue YWHAB-1:S39:20q13.12>, <PTM Residue YWHAB-1:S47:20q13.12>, <PTM Residue YWHAB-1:Y50:20q13.12>, <PTM Residue YWHAB-1:S59:20q13.12>, <PTM Residue ...(truncated) | 239,789 | {} | 2023-06-18 20:03:00 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_regsites | 2023-06-18 20:03:15 | 2023-06-18 20:03:16 | 0.51 | dict | {'P41181': [{'aa': 'K', 'res': '270', 'modt': 'ub', 'organism': 'human', 'pmids': {'21209006'}, 'induces': [], 'disrupts': [], 'isoform': 1, 'function': {'protein degradation', 'intracellular localization', 'phosphorylation'}, 'process': {''}, 'comments': 'stimulates phosphorylation of S261', 'posit...(truncated) | 5,435 | {} | 2023-06-18 20:03:15 | |
| ¶ | pypath.inputs.phosphosite.phosphosite_regsites_one_organism | 2023-06-18 20:03:16 | 2023-06-18 20:04:34 | 78.46 | dict | {'P41181': {('K', 270, 'ubiquitination'): {'induces': set(), 'disrupts': set(), 'pmids': {'28052875', '21148409', '24876223', '21209006'}, 'isoforms': {1}, 'process': {''}, 'function': {'protein degradation', 'phosphorylation', 'ubiquitination', 'intracellular localization', 'protein stabilization'}...(truncated) | 3,619 | {} | 2023-06-18 20:03:16 | |
| ¶ | pypath.inputs.phosphosite.regsites_tab |
Not calling `pypath.inputs.phosphosite.regsites_tab`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pisa.pisa_bonds |
Not calling `pypath.inputs.pisa.pisa_bonds`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pisa.pisa_interfaces |
Not calling `pypath.inputs.pisa.pisa_interfaces`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pro.get_pro | 2023-06-18 20:04:34 | 2023-06-18 20:10:34 | 360.01 | Obo | <OBO file `https://proconsortium.org/download/current/pro_reasoned.obo`> | 0 | {} | 2023-06-18 20:04:34 | |
| ¶ | pypath.inputs.pro.pro_mapping | 2023-06-18 20:10:34 | 2023-06-18 20:10:35 | 0.41 | list | [('PR:000000005', 'P37173'), ('PR:000000005', 'P38438'), ('PR:000000005', 'Q62312'), ('PR:000000005', 'Q90999'), ('PR:000000007', 'A0A0G2KN81'), ('PR:000000009', 'Q16671'), ('PR:000000009', 'Q62893'), ('PR:000000009', 'Q8K592'), ('PR:000000010', 'O57472'), ('PR:000000010', 'Q24025'), ('PR:000000010'...(truncated) | 320,143 | {} | 2023-06-18 20:10:34 | |
| ¶ | pypath.inputs.progeny.progeny_annotations | 2023-06-18 20:10:35 | 2023-06-18 20:10:42 | 7.35 | dict | {'P35250': {ProgenyAnnotation(pathway='Estrogen', weight=2.40982404059, p_value=0.0238138596584), ProgenyAnnotation(pathway='p53', weight=-3.3513628049710005, p_value=0.000985568693599589), ProgenyAnnotation(pathway='VEGF', weight=-0.15684553639501156, p_value=0.8477560090795286), ProgenyAnnotation(...(truncated) | 18,593 | {} | 2023-06-18 20:10:35 | |
| ¶ | pypath.inputs.progeny.progeny_raw | 2023-06-18 20:10:43 | 2023-06-18 20:10:45 | 2.04 | DataFrame | gene pathway weight p.value 1 RFC2 EGFR 1.470647 0.001655 2 ESRRA EGFR 0.178590 0.211838 3 HNRNPK EGFR 0.306699 0.084560 4 CBX6 EGFR -0.675507 0.017641 5 ASRGL1 EGFR -0.252328 0.295430 ... ... ... ...(truncated) | 274,143 | {} | 2023-06-18 20:10:43 | |
| ¶ | pypath.inputs.proteinatlas.get_proteinatlas | 2023-06-18 20:10:45 | 2023-06-18 20:10:51 | 6.23 | dict | {'normal': {'adipose tissue:adipocytes': {'O43657': ('Not detected', 'Approved'), 'O60762': ('Medium', 'Approved'), 'Q8IZE3': ('Low', 'Approved'), 'Q9NSG2': ('Medium', 'Uncertain'), 'P09769': ('Not detected', 'Enhanced'), 'P08603': ('Not detected', 'Supported'), 'Q9BTY2': ('Not detected', 'Approved'...(truncated) | 2 | {} | 2023-06-18 20:10:45 | |
| ¶ | pypath.inputs.proteinatlas.proteinatlas_annotations | 2023-06-18 20:10:52 | 2023-06-18 20:11:06 | 14.05 | dict | {'O43657': {ProtainatlasAnnotation(organ='seminal vesicle', tissue='glandular cells', level='High', status='Approved', n_not_detected=None, n_low=None, n_medium=None, n_high=None, prognostic=False, favourable=False, score=None, pathology=False), ProtainatlasAnnotation(organ='prostate', tissue='gland...(truncated) | 19,401 | {} | 2023-06-18 20:10:52 | |
| ¶ | pypath.inputs.proteinatlas.proteinatlas_secretome_annotations | 2023-06-18 20:11:09 | 2023-06-18 20:11:11 | 2.71 | dict | {'P10646': {ProteinatlasSecretomeAnnotation(mainclass='Secreted to blood', secreted=True)}, 'P20701': {ProteinatlasSecretomeAnnotation(mainclass='Intracellular or membrane-bound', secreted=False)}, 'Q9NPA2': {ProteinatlasSecretomeAnnotation(mainclass='Secreted to blood', secreted=True)}, 'Q03405': {...(truncated) | 2,590 | {} | 2023-06-18 20:11:09 | |
| ¶ | pypath.inputs.proteinatlas.proteinatlas_subcellular_annotations | 2023-06-18 20:11:11 | 2023-06-18 20:11:12 | 0.38 | dict | {'Q8IZE3': {ProteinatlasSubcellularAnnotation(location='Microtubules', status='Uncertain'), ProteinatlasSubcellularAnnotation(location='Nuclear bodies', status='Uncertain')}, 'P23511': {ProteinatlasSubcellularAnnotation(location='Nucleoplasm', status='Supported')}, 'Q9Y4W2': {ProteinatlasSubcellular...(truncated) | 6,956 | {} | 2023-06-18 20:11:11 | |
| ¶ | pypath.inputs.proteins.variants | 2023-06-18 20:11:12 | 2023-06-18 20:23:47 | 754.81 | list | [VariationRecord(features=[{'type': 'VARIANT', 'begin': 86, 'end': 86, 'consequence': 'missense', 'wild_residue': 'K', 'mutated_residue': 'T', 'somatic': False, 'evidence': 'mixed'}], uniprot='A0A024QZ33'), VariationRecord(features=[{'type': 'VARIANT', 'begin': 90, 'end': 90, 'consequence': 'missens...(truncated) | 48,453 | {} | 2023-06-18 20:11:12 | |
| ¶ | pypath.inputs.protmapper.get_protmapper | 2023-06-18 20:23:47 | 2023-06-18 20:23:52 | 4.86 | tuple | ([{'ID': '0', 'CTRL_NS': 'UP', 'CTRL_ID': 'Q02156', 'CTRL_GENE_NAME': 'PRKCE', 'CTRL_IS_KINASE': 'True', 'TARGET_UP_ID': 'P15336', 'TARGET_GENE_NAME': 'ATF2', 'TARGET_RES': 'T', 'TARGET_POS': '52', 'SOURCES': 'psp,reach,signor,sparser'}, {'ID': '1', 'CTRL_NS': 'FPLX', 'CTRL_ID': 'PKC', 'CTRL_GENE_NA...(truncated) | 2 | {} | 2023-06-18 20:23:47 | |
| ¶ | pypath.inputs.protmapper.protmapper_enzyme_substrate | 2023-06-18 20:23:52 | 2023-06-18 20:23:53 | 0.60 | list | [{'kinase': 'Q02156', 'resaa': 'T', 'resnum': 52, 'references': {'25545367', '22304920', '24357804', '24727247', '25728676'}, 'substrate': 'P15336', 'databases': {'REACH', 'PhosphoSite', 'Sparser', 'SIGNOR'}}, {'kinase': 'Q02156', 'resaa': 'T', 'resnum': 280, 'references': {'24727247', '23708658'}, ...(truncated) | 22,139 | {} | 2023-06-18 20:23:52 | |
| ¶ | pypath.inputs.protmapper.protmapper_interactions |
Not calling `pypath.inputs.protmapper.protmapper_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pubchem.pubchem_mapping |
Not calling `pypath.inputs.pubchem.pubchem_mapping`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pubmed.get_pmid |
Not calling `pypath.inputs.pubmed.get_pmid`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pubmed.get_pubmeds |
Not calling `pypath.inputs.pubmed.get_pubmeds`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pubmed.only_pmids |
Not calling `pypath.inputs.pubmed.only_pmids`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pubmed.open_pubmed |
Not calling `pypath.inputs.pubmed.open_pubmed`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pubmed.pmids_dict |
Not calling `pypath.inputs.pubmed.pmids_dict`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.pubmed.pmids_list |
Not calling `pypath.inputs.pubmed.pmids_list`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ramilowski2015.ramilowski_interactions | 2023-06-18 20:23:53 | 2023-06-18 20:23:54 | 0.81 | list | [Ramilowski2015Interaction(ligand='A2M', receptor='LRP1', references='', resources='HPMR;HPRD;STRING.binding;STRING.experiment;literature supported'), Ramilowski2015Interaction(ligand='AANAT', receptor='MTNR1A', references='', resources='HPMR;literature supported'), Ramilowski2015Interaction(ligand=...(truncated) | 1,894 | {} | 2023-06-18 20:23:53 | |
| ¶ | pypath.inputs.ramilowski2015.ramilowski_locations | 2023-06-18 20:23:54 | 2023-06-18 20:23:58 | 4.42 | dict | {'P04217': {RamilowskiLocation(location='secreted', source='UniProt', tmh=0, note=None, long_note=None), RamilowskiLocation(location='secreted', source='Consensus', tmh=0, note=None, long_note=None), RamilowskiLocation(location='secreted', source='Consensus6', tmh=0, note=None, long_note=None), Rami...(truncated) | 18,852 | {} | 2023-06-18 20:23:54 | |
| ¶ | pypath.inputs.ramp._ramp_sqldump | 2023-06-18 20:23:58 | 2023-06-18 20:24:02 | 3.95 | TextIOWrapper | <_io.TextIOWrapper name='/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/cache/2ac9fe4b32649e946c59f28f74943748-38534654' encoding='utf-8'> | 0 | {} | 2023-06-18 20:23:58 | |
| ¶ | pypath.inputs.ramp.ramp_id_types | 2023-06-18 20:24:02 | 2023-06-18 20:32:04 | 482.02 | set | {'chebi', 'kegg', 'chemspider', 'CAS', 'ncbiprotein', 'swisslipids', 'uniprot', 'wikidata', 'LIPIDMAPS', 'gene_symbol', 'brenda', 'kegg_glycan', 'pubchem', 'EN', 'entrez', 'ensembl', 'lipidbank', 'hmdb', 'plantfa'} | 19 | {} | 2023-06-18 20:24:02 | |
| ¶ | pypath.inputs.ramp.ramp_id_types_2 | 2023-06-18 20:32:04 | 2023-06-18 20:32:12 | 7.45 | set | {'chebi', 'kegg', 'chemspider', 'CAS', 'ncbiprotein', 'swisslipids', 'uniprot', 'wikidata', 'LIPIDMAPS', 'gene_symbol', 'brenda', 'kegg_glycan', 'pubchem', 'EN', 'entrez', 'ensembl', 'lipidbank', 'hmdb', 'plantfa'} | 19 | {} | 2023-06-18 20:32:04 | |
| ¶ | pypath.inputs.ramp.ramp_list_tables | 2023-06-18 20:32:12 | 2023-06-18 20:32:14 | 2.54 | dict | {'analyte': ['rampId', 'type'], 'analytehasontology': ['rampCompoundId', 'rampOntologyId'], 'analytehaspathway': ['rampId', 'pathwayRampId', 'pathwaySource'], 'analytesynonym': ['Synonym', 'rampId', 'geneOrCompound', 'source'], 'catalyzed': ['rampCompoundId', 'rampGeneId'], 'chem_props': ['ramp_id',...(truncated) | 13 | {} | 2023-06-18 20:32:12 | |
| ¶ | pypath.inputs.ramp.ramp_mapping |
Not calling `pypath.inputs.ramp.ramp_mapping`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ramp.ramp_raw |
Not calling `pypath.inputs.ramp.ramp_raw`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.ramp.ramp_show_tables | 2023-06-18 20:32:14 | 2023-06-18 20:32:17 | 2.54 | NoneType | None | 0 | {} | 2023-06-18 20:32:14 | |
| ¶ | pypath.inputs.rdata._patch_rdata | 2023-06-18 20:32:17 | 2023-06-18 20:32:17 | 0.00 | NoneType | None | 0 | {} | 2023-06-18 20:32:17 | |
| ¶ | pypath.inputs.rdata._rdata_data_frame_get_rownames |
Not calling `pypath.inputs.rdata._rdata_data_frame_get_rownames`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.rdata._rdata_list_get_names |
Not calling `pypath.inputs.rdata._rdata_list_get_names`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._bp_collect_resources |
Not calling `pypath.inputs.reaction._bp_collect_resources`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._process_controls |
Not calling `pypath.inputs.reaction._process_controls`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_collect_resources |
Not calling `pypath.inputs.reaction._reactome_collect_resources`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_collect_species |
Not calling `pypath.inputs.reaction._reactome_collect_species`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_compartment |
Not calling `pypath.inputs.reaction._reactome_compartment`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_extract_id |
Not calling `pypath.inputs.reaction._reactome_extract_id`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_extract_res |
Not calling `pypath.inputs.reaction._reactome_extract_res`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_id |
Not calling `pypath.inputs.reaction._reactome_id`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_reaction |
Not calling `pypath.inputs.reaction._reactome_reaction`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_reactions | 2023-06-18 20:32:17 | 2023-06-18 20:32:45 | 28.12 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/reaction.py", line 986, in _reactome_reactions
for i in sp.find('bqbiol:haspart').find_all('rdf:li'):
AttributeError: 'NoneType' object has no attribute 'find_all'
|
{} | 2023-06-12 20:55:06 | |||
| ¶ | pypath.inputs.reaction._reactome_reactions_et | 2023-06-18 20:32:45 | 2023-06-18 20:32:47 | 2.28 | tuple | ({}, {}, {}) | 3 | {} | 2023-06-18 20:32:45 | |
| ¶ | pypath.inputs.reaction._reactome_res |
Not calling `pypath.inputs.reaction._reactome_res`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction._reactome_species |
Not calling `pypath.inputs.reaction._reactome_species`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.acsn_biopax | 2023-06-18 20:32:47 | 2023-06-18 20:32:48 | 0.84 | list | ['<?xml version="1.0" encoding="UTF-8"?>\n', '<rdf:RDF\n', ' xmlns:xsd="http://www.w3.org/2001/XMLSchema#"\n', ' xmlns:owl="http://www.w3.org/2002/07/owl#"\n', ' xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"\n', ' xmlns:bp="http://www.biopax.org/release/biopax-level3.owl#"\n', ' xml:base="...(truncated) | 190,854 | {} | 2023-06-18 20:32:47 | |
| ¶ | pypath.inputs.reaction.acsn_interactions_2 |
Not calling `pypath.inputs.reaction.acsn_interactions_2`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.get_acsn_effects | 2023-06-18 20:32:48 | 2023-06-18 20:32:49 | 0.48 | list | [['FOXO3', 'PIK3CA', '*'], ['FOXO3', 'PIK3CB', '*'], ['FOXO3', 'PIK3CD', '*'], ['FOXO3', 'PIK3CG', '*'], ['AKT1', 'HOMER3', '*'], ['AKT2', 'HOMER3', '*'], ['AKT3', 'HOMER3', '*'], ['CDH2', 'HOMER3', '*'], ['CDK6', 'CDKN2B', '*'], ['ANAPC2', 'RSPO3', '*'], ['AXIN1', 'RSPO3', '*'], ['AXIN2', 'RSPO3', ...(truncated) | 37,288 | {} | 2023-06-18 20:32:48 | |
| ¶ | pypath.inputs.reaction.get_controls |
Not calling `pypath.inputs.reaction.get_controls`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.get_interactions |
Not calling `pypath.inputs.reaction.get_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.get_reactions | 2023-06-18 20:32:49 | 2023-06-18 20:32:51 | 2.30 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 867, in test_input
for i, rec in enumerate(value_gen):
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/reaction.py", line 1187, in get_reactions
rea.load_all()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/pyreact.py", line 1300, in load_all
self.load_wikipathways()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/pyreact.py", line 1193, in load_wikipathways
self.add_dataset(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/pyreact.py", line 1314, in add_dataset
self.merge()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/pyreact.py", line 1350, in merge
self.merge_modifications()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/pyreact.py", line 1582, in merge_modifications
self.load_sequences()
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/pyreact.py", line 2333, in load_sequences
self.seq = seq.swissprot_seq(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/utils/seq.py", line 55, in swissprot_seq
data = data.split('\n')
AttributeError: 'NoneType' object has no attribute 'split'
|
{} | 2023-06-12 20:55:22 | |||
| ¶ | pypath.inputs.reaction.get_soup |
Not calling `pypath.inputs.reaction.get_soup`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.panther_biopax | 2023-06-18 20:32:51 | 2023-06-18 20:32:57 | 6.22 | dict | {'BioPAX/Fructose_galactose_metabolism.owl': <ExFileObject name='/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/cache/762ca0e0a7ee6d1f14203c6255cf9b3a-BioPAX.tar.gz'>, 'BioPAX/B_cell_activation.owl': <ExFileObject name='/mnt/disk0/build/omnipath-build/pypath_inputs_status__202...(truncated) | 178 | {} | 2023-06-18 20:32:51 | |
| ¶ | pypath.inputs.reaction.panther_interactions |
Not calling `pypath.inputs.reaction.panther_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.pid_biopax | 2023-06-18 20:32:57 | 2023-06-18 20:32:59 | 2.08 | NoneType | None | 0 | {} | 2023-06-18 20:32:57 | |
| ¶ | pypath.inputs.reaction.pid_interactions |
Not calling `pypath.inputs.reaction.pid_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.process_complex |
Not calling `pypath.inputs.reaction.process_complex`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.process_controls |
Not calling `pypath.inputs.reaction.process_controls`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.process_reactions |
Not calling `pypath.inputs.reaction.process_reactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.reactions_biopax |
Not calling `pypath.inputs.reaction.reactions_biopax`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.reactome_biopax | 2023-06-18 20:32:59 | 2023-06-18 20:33:27 | 27.38 | TextIOWrapper | <_io.TextIOWrapper name='/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/cache/reactome_biopax_Homo_sapiens.owl' mode='r' encoding='UTF-8'> | 0 | {} | 2023-06-18 20:32:59 | |
| ¶ | pypath.inputs.reaction.reactome_bs | 2023-06-18 20:33:27 | 2023-06-18 20:40:32 | 425.84 | list | [('R-HSA-1059683', <?xml version='1.0' encoding='utf-8' standalone='no'?> <sbml level="3" version="1" xmlns="http://www.sbml.org/sbml/level3/version1/core"> <notes> <annotation> <p xmlns="http://www.w3.org/1999/xhtml">SBML generated from Reactome version 85 on 5/30/23, 5:13 PM using JSBML version 1....(truncated) | 2,629 | {} | 2023-06-18 20:33:27 | |
| ¶ | pypath.inputs.reaction.reactome_interactions |
Not calling `pypath.inputs.reaction.reactome_interactions`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.reaction.reactome_sbml | 2023-06-18 20:40:56 | 2023-06-18 20:40:58 | 2.31 | dict | {'R-HSA-1059683.sbml': <ExFileObject name='/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/cache/9cfb9d56283cf7ad3077ba1f8a187542-homo_sapiens.3.1.sbml.tgz'>, 'R-HSA-109581.sbml': <ExFileObject name='/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/cache/9c...(truncated) | 2,629 | {} | 2023-06-18 20:40:56 | |
| ¶ | pypath.inputs.scconnect.scconnect_annotations | 2023-06-18 20:40:58 | 2023-06-18 20:41:03 | 4.26 | dict | {'P41273': {ScconnectAnnotation(role='ligand', family=None, type=None, inferred_from='human')}, 'P20292': {ScconnectAnnotation(role='ligand', family=None, type=None, inferred_from='human')}, 'P01189': {ScconnectAnnotation(role='ligand', family=None, type=None, inferred_from='human'), ScconnectAnnota...(truncated) | 3,286 | {} | 2023-06-18 20:40:58 | |
| ¶ | pypath.inputs.scconnect.scconnect_complexes | 2023-06-18 20:41:03 | 2023-06-18 20:41:03 | 0.03 | set | {Complex: COMPLEX:P01215_P01222, Complex: COMPLEX:P05496_P48201_Q06055, Complex: COMPLEX:P29460_Q9NPF7, Complex: COMPLEX:P01562, Complex: COMPLEX:P01215_P0DN86, Complex: COMPLEX:O75462_Q9UBD9, Complex: COMPLEX:P01374_Q06643, Complex: COMPLEX:Q16552_Q96PD4, Complex: COMPLEX:P01215_P01229, Complex: CO...(truncated) | 17 | {} | 2023-06-18 20:41:03 | |
| ¶ | pypath.inputs.scconnect.scconnect_interactions | 2023-06-18 20:41:03 | 2023-06-18 20:49:09 | 486.80 | list | [ScconnectInteraction(ligand_id='P41273', target_id='Q07011', ligand_organism=9606, target_organism=9606, ligand_type='protein', target_type='protein', effect='None', references=''), ScconnectInteraction(ligand_id='P20292', target_id='P09917', ligand_organism=9606, target_organism=9606, ligand_type=...(truncated) | 1,766 | {} | 2023-06-18 20:41:03 | |
| ¶ | pypath.inputs.science.science_download |
Not calling `pypath.inputs.science.science_download`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.signalink.signalink_annotations | 2023-06-18 20:49:09 | 2023-06-18 20:49:11 | 1.95 | dict | {'pathway': {'P20963': {SignalinkPathway(pathway='T-cell receptor')}, 'P43403': {SignalinkPathway(pathway='T-cell receptor'), SignalinkPathway(pathway='Receptor tyrosine kinase')}, 'Q9NYJ8': {SignalinkPathway(pathway='Toll-like receptor'), SignalinkPathway(pathway='JAK/STAT'), SignalinkPathway(pathw...(truncated) | 2 | {} | 2023-06-18 20:49:09 | |
| ¶ | pypath.inputs.signalink.signalink_function_annotations | 2023-06-18 20:49:11 | 2023-06-18 20:49:12 | 0.94 | dict | {'P43403': {SignalinkFunction(function='Mediator'), SignalinkFunction(function='Scaffold')}, 'Q9NYJ8': {SignalinkFunction(function='Co-factor'), SignalinkFunction(function='Scaffold')}, 'O43318': {SignalinkFunction(function='Mediator')}, 'P15018': {SignalinkFunction(function='Ligand')}, 'P42702': {S...(truncated) | 783 | {} | 2023-06-18 20:49:11 | |
| ¶ | pypath.inputs.signalink.signalink_interactions | 2023-06-18 20:49:12 | 2023-06-18 20:49:13 | 0.44 | list | [SignalinkInteraction(id_a='P20963', id_b='P43403', is_direct=True, is_directed=True, effect=0, pathways_a=['T-cell receptor'], pathways_b=['Receptor tyrosine kinase', 'T-cell receptor'], functions_a=[], functions_b=['Mediator', 'Scaffold'], references=['10358158', '10358164', '10562324', '10925299'...(truncated) | 1,939 | {} | 2023-06-18 20:49:12 | |
| ¶ | pypath.inputs.signalink.signalink_pathway_annotations | 2023-06-18 20:49:13 | 2023-06-18 20:49:13 | 0.47 | dict | {'P20963': {SignalinkPathway(pathway='T-cell receptor')}, 'P43403': {SignalinkPathway(pathway='T-cell receptor'), SignalinkPathway(pathway='Receptor tyrosine kinase')}, 'Q9NYJ8': {SignalinkPathway(pathway='Toll-like receptor'), SignalinkPathway(pathway='JAK/STAT'), SignalinkPathway(pathway='Innate i...(truncated) | 835 | {} | 2023-06-18 20:49:13 | |
| ¶ | pypath.inputs.signor.signor_complexes | 2023-06-18 20:49:13 | 2023-06-18 20:49:14 | 0.62 | dict | {'COMPLEX:P23511_P25208_Q13952': Complex NFY: COMPLEX:P23511_P25208_Q13952, 'COMPLEX:P42345_P68104_P85299_Q6R327_Q8TB45_Q9BVC4': Complex mTORC2: COMPLEX:P42345_P68104_P85299_Q6R327_Q8TB45_Q9BVC4, 'COMPLEX:P42345_Q8N122_Q8TB45_Q96B36_Q9BVC4': Complex mTORC1: COMPLEX:P42345_Q8N122_Q8TB45_Q96B36_Q9BVC4...(truncated) | 4,867 | {} | 2023-06-18 20:49:13 | |
| ¶ | pypath.inputs.signor.signor_enzyme_substrate | 2023-06-18 20:49:14 | 2023-06-18 20:49:16 | 2.49 | list | [{'typ': 'phosphorylation', 'resnum': 253, 'instance': 'APRRRAVSMDNSNKY', 'substrate': 'O43524', 'start': 246, 'end': 260, 'kinase': 'P31749', 'resaa': 'S', 'motif': 'APRRRAVSMDNSNKY', 'enzyme_isoform': None, 'substrate_isoform': None, 'references': {'19951971'}}, {'typ': 'phosphorylation', 'resnum'...(truncated) | 10,295 | {} | 2023-06-18 20:49:14 | |
| ¶ | pypath.inputs.signor.signor_interactions | 2023-06-18 20:49:16 | 2023-06-18 20:49:17 | 0.54 | list | [SignorInteraction(source='P31749', target='O43524', source_isoform=None, target_isoform=None, source_type='protein', target_type='protein', effect='down-regulates quantity by destabilization', mechanism='phosphorylation', ncbi_tax_id='', pubmeds='19951971', direct=True, ptm_type='phosphorylation', ...(truncated) | 90,172 | {} | 2023-06-18 20:49:16 | |
| ¶ | pypath.inputs.signor.signor_pathway_annotations | 2023-06-18 20:49:17 | 2023-06-18 20:49:33 | 16.08 | dict | {'P46527': {SignorPathway(pathway='Cell cycle: G1/S phase transition'), SignorPathway(pathway='Integrin Signaling'), SignorPathway(pathway='Acute Myeloid Leukemia')}, 'Q06124': {SignorPathway(pathway='Leptin Signaling'), SignorPathway(pathway='EGFR Signaling'), SignorPathway(pathway='Acute Myeloid L...(truncated) | 672 | {} | 2023-06-18 20:49:17 | |
| ¶ | pypath.inputs.signor.signor_pathways |
Not calling `pypath.inputs.signor.signor_pathways`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.signor.signor_protein_families | 2023-06-18 20:49:33 | 2023-06-18 20:49:33 | 0.00 | dict | {'SIGNOR-PF1': ['P27361', 'P28482'], 'SIGNOR-PF2': ['Q92633', 'Q9HBW0', 'Q9UBY5'], 'SIGNOR-PF3': ['O14610', 'O60262', 'P50150', 'P50151', 'P59768', 'P61952', 'P63211', 'P63215', 'P63218', 'Q9P2W3', 'Q9UBI6', 'Q9UK08'], 'SIGNOR-PF4': ['O14775', 'P16520', 'P62873', 'P62879', 'Q9HAV0'], 'SIGNOR-PF5': [...(truncated) | 90 | {} | 2023-06-18 20:49:33 | |
| ¶ | pypath.inputs.spike.spike_complexes | 2023-06-18 20:49:33 | 2023-06-18 20:49:44 | 10.97 | dict | {'COMPLEX:P67775_Q15172_Q15257': Complex PP2A: COMPLEX:P67775_Q15172_Q15257, 'COMPLEX:O43741_P54619_P54646_Q13131_Q9UGI9_Q9UGJ0_Q9Y478': Complex AMPK: COMPLEX:O43741_P54619_P54646_Q13131_Q9UGI9_Q9UGJ0_Q9Y478, 'COMPLEX:P67870_P68400': Complex CK2: COMPLEX:P67870_P68400, 'COMPLEX:P05412_P15336': Compl...(truncated) | 154 | {} | 2023-06-18 20:49:33 | |
| ¶ | pypath.inputs.spike.spike_interactions | 2023-06-18 20:49:44 | 2023-06-18 20:49:47 | 2.60 | list | [SpikeInteraction(entrez_a='554210', genesymbol_a='MIR429', entrez_b='55914', genesymbol_b='ERBB2IP', directed='1', pmids='20005803', integrity='2', effect='2', assay='', data_source='Published research', description='Luciferase activity assay', mechanism='N/A', regulation=True), SpikeInteraction(en...(truncated) | 8,903 | {} | 2023-06-18 20:49:44 | |
| ¶ | pypath.inputs.stitch.stitch_actions_interactions | 2023-06-18 20:49:47 | 2023-06-18 20:51:05 | 78.56 | list | [StitchActionsInteraction(partner_a='00010461', partner_b='ENSP00000170630', mechanism='expression', action=None, score=150), StitchActionsInteraction(partner_a='00010461', partner_b='ENSP00000170630', mechanism='expression', action=None, score=150), StitchActionsInteraction(partner_a='23627457', pa...(truncated) | 21,773,491 | {} | 2023-06-18 20:49:47 | |
| ¶ | pypath.inputs.stitch.stitch_links_interactions | 2023-06-18 20:51:05 | 2023-06-18 20:52:37 | 91.50 | list | [StitchLinksInteraction(partner_a='91663464', partner_b='ENSP00000354652', experimental=989, prediction=0, database=0, textmining=0, combined_score=989, physical_combined_score=996), StitchLinksInteraction(partner_a='90668081', partner_b='ENSP00000317985', experimental=933, prediction=0, database=0,...(truncated) | 150,645 | {} | 2023-06-18 20:51:05 | |
| ¶ | pypath.inputs.string.string_effects | 2023-06-18 20:52:37 | 2023-06-18 20:52:45 | 8.39 | list | [StringEffectsInteraction(source='ENSP00000216366', target='ENSP00000000233', effect='*'), StringEffectsInteraction(source='ENSP00000000233', target='ENSP00000216366', effect='*'), StringEffectsInteraction(source='ENSP00000222547', target='ENSP00000000233', effect='*'), StringEffectsInteraction(sour...(truncated) | 2,250,122 | {} | 2023-06-18 20:52:37 | |
| ¶ | pypath.inputs.string.string_links_interactions | 2023-06-18 20:52:47 | 2023-06-18 20:53:17 | 30.38 | list | [StringLinksInteraction(protein_a='ENSP00000000233', protein_b='ENSP00000440005', neighborhood_score=0, fusion=0, cooccurence=50, coexpression=99, experimental=679, database=900, textmining=59, combined_score=969, physical_combined_score=740), StringLinksInteraction(protein_a='ENSP00000000233', prot...(truncated) | 247,200 | {} | 2023-06-18 20:52:47 | |
| ¶ | pypath.inputs.string.string_physical_interactions | 2023-06-18 20:53:17 | 2023-06-18 20:53:19 | 1.72 | list | [StringPhysicalInteraction(protein_a='ENSP00000000412', protein_b='ENSP00000221957', experimental=483, database=600, textmining=821, combined_score=959), StringPhysicalInteraction(protein_a='ENSP00000000412', protein_b='ENSP00000438085', experimental=932, database=0, textmining=0, combined_score=932...(truncated) | 83,896 | {} | 2023-06-18 20:53:17 | |
| ¶ | pypath.inputs.string.string_species | 2023-06-18 20:53:19 | 2023-06-18 20:53:19 | 0.10 | dict | {'23': 'Shewanella colwelliana', '48': 'Archangium gephyra', '52': 'Chondromyces crocatus', '54': 'Nannocystis exedens', '69': 'Lysobacter enzymogenes', '140': 'Borrelia hermsii', '162': 'Treponema phagedenis', '163': 'Treponema bryantii', '183': 'Leptonema illini', '192': 'Azospirillum brasilense',...(truncated) | 14,094 | {} | 2023-06-18 20:53:19 | |
| ¶ | pypath.inputs.surfaceome.surfaceome_annotations | 2023-06-18 20:53:19 | 2023-06-18 20:53:22 | 3.45 | dict | {'A0AV02': (0.8363, 'Transporters', {'SLC12', 'APC', 'SLC'}), 'A0FGR9': (0.0465, 'Unclassified', {'Unclassified'}), 'A0PJK1': (0.8802, 'Transporters', {'SLC5', 'APC', 'SLC'}), 'A0PK11': (0.6108, 'Unclassified', {'Unclassified'}), 'A0ZSE6': (0.6327, 'Miscellaneous', {'TMEM30', 'Unknown_function'}), '...(truncated) | 2,808 | {} | 2023-06-18 20:53:19 | |
| ¶ | pypath.inputs.switches_elm.get_switches_elm | 2023-06-18 20:53:22 | 2023-06-18 20:53:31 | 8.55 | list | [{'intramol': False, 'bindingsite_a': {'elm': ['LIG_SH2_STAT5']}, 'bs_a_start': [['1'], ['6'], ['1']], 'bs_a_end': [['1'], ['6'], ['4']], 'uniprot_a': ('O43561',), 'uniprot_b': ('P19174',), 'bindingsite_b': {'pfam': ['PF00017']}, 'bs_b_start': [['5'], ['5'], ['0']], 'bs_b_end': [['6'], ['3'], ['9']]...(truncated) | 839 | {} | 2023-06-18 20:53:22 | |
| ¶ | pypath.inputs.talklr.talklr_annotations | 2023-06-18 20:53:31 | 2023-06-18 20:53:32 | 0.57 | dict | {'P01023': {TalklrAnnotation(role='ligand', pmid=None, putative=False)}, 'Q07954': {TalklrAnnotation(role='receptor', pmid=None, putative=False), TalklrAnnotation(role='receptor', pmid='21054788', putative=False), TalklrAnnotation(role='receptor', pmid='11560994', putative=False)}, 'Q16613': {Talklr...(truncated) | 1,345 | {} | 2023-06-18 20:53:31 | |
| ¶ | pypath.inputs.talklr.talklr_interactions | 2023-06-18 20:53:32 | 2023-06-18 20:53:32 | 0.04 | list | [TalklrInteraction(ligand='A2M', receptor='LRP1', pmids=(), resources=('HPRD', 'STRING', 'HPMR'), putative=False), TalklrInteraction(ligand='AANAT', receptor='MTNR1A', pmids=(), resources=('HPMR',), putative=False), TalklrInteraction(ligand='AANAT', receptor='MTNR1B', pmids=(), resources=('HPMR',), ...(truncated) | 2,422 | {} | 2023-06-18 20:53:32 | |
| ¶ | pypath.inputs.talklr.talklr_raw | 2023-06-18 20:53:32 | 2023-06-18 20:53:32 | 0.03 | DataFrame | Pair_Name Ligand_ApprovedSymbol ... Pair_Source Pair_Evidence 0 A2M_LRP1 A2M ... known literature supported 1 AANAT_MTNR1A AANAT ... known literature supported 2 AANAT_MTNR1B AANAT ... known l...(truncated) | 2,422 | {} | 2023-06-18 20:53:32 | |
| ¶ | pypath.inputs.tcdb.tcdb_annotations | 2023-06-18 20:53:32 | 2023-06-18 20:53:37 | 5.78 | dict | {'P60201': {TcdbAnnotation(family='Myelin Proteolipid Protein (MPLP)', tcid='9.B.38.1.2'), TcdbAnnotation(family='Myelin Proteolipid Protein (MPLP)', tcid='9.B.38.1.4')}, 'Q9NWF4': {TcdbAnnotation(family='Eukaryotic Riboflavin Transporter (E-RFT)', tcid='2.A.125.1.1')}, 'O00161': {TcdbAnnotation(fam...(truncated) | 2,223 | {} | 2023-06-18 20:53:32 | |
| ¶ | pypath.inputs.tcdb.tcdb_classes | 2023-06-18 20:53:37 | 2023-06-18 20:53:38 | 0.53 | dict | {'A0CIB0': ('1.A.17.1.13', '1.A.17'), 'A0CS82': ('9.B.82.1.5', '9.B.82'), 'A0CX44': ('1.A.3.2.4', '1.A.3'), 'A0D5K0': ('2.A.66.3.4', '2.A.66'), 'A0E9B5': ('9.B.38.2.1', '9.B.38'), 'A0ECD9': ('3.A.1.207.1', '3.A.1'), 'A0FKN5': ('2.A.53.2.9', '2.A.53'), 'A0JCJ5': ('1.B.1.1.7', '1.B.1'), 'A0JSP2': ('3....(truncated) | 23,110 | {} | 2023-06-18 20:53:37 | |
| ¶ | pypath.inputs.tcdb.tcdb_families | 2023-06-18 20:53:38 | 2023-06-18 20:53:38 | 0.01 | dict | {'1.A.1': 'Voltage-gated Ion Channel (VIC)', '1.A.10': 'Glutamate-gated Ion Channel (GIC) of Neurotransmitter Receptors', '1.A.100': 'Rhabdoviridae Putative Viroporin, U5 (RV-U5)', '1.A.101': 'Peroxisomal Pore-forming Pex11 (Pex11)', '1.A.102': 'Influenza A viroporin PB1-F2 (PB1-F2)', '1.A.103': 'Si...(truncated) | 1,823 | {} | 2023-06-18 20:53:38 | |
| ¶ | pypath.inputs.tfcensus.tfcensus_annotations | 2023-06-18 20:53:38 | 2023-06-18 20:53:38 | 0.21 | dict | {'P23511': {TfcensusAnnotation(tfcensus_class='a', tissue=None)}, 'Q96QS3': {TfcensusAnnotation(tfcensus_class='a', tissue=None)}, 'P31270': {TfcensusAnnotation(tfcensus_class='a', tissue='uterus')}, 'P57073': {TfcensusAnnotation(tfcensus_class='a', tissue=None)}, 'P17010': {TfcensusAnnotation(tfcen...(truncated) | 1,490 | {} | 2023-06-18 20:53:38 | |
| ¶ | pypath.inputs.threedcomplex.threedcomplex_chains | 2023-06-18 20:53:38 | 2023-06-18 20:53:43 | 4.58 | dict | {'code': {'ch_new': 'ch_old'}, '4b5m_1': {'L': 'L', 'A': 'A', 'V': 'V', 'U': 'U'}, '4b5m_2': {'W': 'W', 'M': 'M', 'B': 'B', 'X': 'X'}, '4b5m_3': {'N': 'N', 'Z': 'Z', 'C': 'C', 'Y': 'Y'}, '4abk_1': {'A': 'A'}, '1lsz_1': {'A': 'A'}, '3gll_1': {'C': 'A', 'A': 'A', 'B': 'A'}, '1hz6_4': {'C': 'C', 'A': '...(truncated) | 174,325 | {} | 2023-06-18 20:53:38 | |
| ¶ | pypath.inputs.threedcomplex.threedcomplex_contacts | 2023-06-18 20:53:43 | 2023-06-18 20:54:06 | 23.17 | set | {ThreedcomplexContact(pdb='4f3w_1', uniprot_1='B2HDU6', uniprot_2='B2HDU6', chain_1='A', chain_2='D', n_residues=11.5, length_1=119, length_2=120, domain_s1=('53927',), domain_p1=('PF00383.17',), domain_s2=('53927',), domain_p2=('PF00383.17',), ident=True, homo=True), ThreedcomplexContact(pdb='1j2g_...(truncated) | 259,809 | {} | 2023-06-18 20:53:43 | |
| ¶ | pypath.inputs.threedcomplex.threedcomplex_ddi | 2023-06-18 20:54:07 | 2023-06-18 20:56:57 | 170.02 | list | [<pypath.internals.intera.DomainDomain object at 0x7f5eb18198d0>, <pypath.internals.intera.DomainDomain object at 0x7f5eb1819a20>, <pypath.internals.intera.DomainDomain object at 0x7f5eb1819a80>, <pypath.internals.intera.DomainDomain object at 0x7f5eb1819ba0>, <pypath.internals.intera.DomainDomain o...(truncated) | 524,460 | {} | 2023-06-18 20:54:07 | |
| ¶ | pypath.inputs.threedcomplex.threedcomplex_nresidues | 2023-06-18 20:56:58 | 2023-06-18 20:57:07 | 9.21 | dict | {'4f3w_1': {('B2HDU6', 'B2HDU6'): 11.5}, '1j2g_1': {('Q45697', 'Q45697'): 58.0}, '3abm_2': {('P00426', 'P68530'): 6.5, ('P00415', 'P00429'): 4.0, ('P00415', 'P00428'): 20.0, ('P00430', 'P10175'): 14.0, ('P00423', 'P00426'): 25.0, ('P00396', 'P13183'): 8.5, ('P00423', 'P13183'): 31.0, ('P00423', 'P00...(truncated) | 81,193 | {} | 2023-06-18 20:56:58 | |
| ¶ | pypath.inputs.threedid.get_3did | 2023-06-18 20:57:07 | 2023-06-18 21:29:32 | 1,944.65 | tuple | ([<pypath.internals.intera.DomainDomain object at 0x7f5e523e1420>, <pypath.internals.intera.DomainDomain object at 0x7f5e523e08e0>, <pypath.internals.intera.DomainDomain object at 0x7f5e523e1a20>, <pypath.internals.intera.DomainDomain object at 0x7f5e523e3460>, <pypath.internals.intera.DomainDomain ...(truncated) | 2 | {} | 2023-06-18 20:57:07 | |
| ¶ | pypath.inputs.threedid.get_3did_ddi | 2023-06-18 21:29:32 | 2023-06-18 21:29:35 | 2.67 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/threedid.py", line 59, in get_3did_ddi
u_pfam, pfam_u = pfam_input.pfam_uniprot(organism = organism)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/pfam.py", line 100, in pfam_uniprot
data = data.split('\n')
AttributeError: 'NoneType' object has no attribute 'split'
|
{} | 2023-06-12 21:49:16 | |||
| ¶ | pypath.inputs.topdb.topdb_annotations | 2023-06-18 21:29:35 | 2023-06-18 21:29:39 | 4.68 | dict | {'P05067': {TopdbAnnotation(membrane='Cytoplasm', topology='Inside', score=89, tmregions=1), TopdbAnnotation(membrane='Extracellular', topology='Inside', score=89, tmregions=1), TopdbAnnotation(membrane='Plasma membrane', topology='Signal', score=89, tmregions=1), TopdbAnnotation(membrane='Extracell...(truncated) | 1,249 | {'size': 1} | 2023-06-18 21:29:35 | |
| ¶ | pypath.inputs.transmir.transmir_interactions | 2023-06-18 21:29:39 | 2023-06-18 21:29:40 | 0.73 | list | [TransmirInteraction(tf_genesymbol='AGO2', mirna='hsa-mir-155', effect='Repression', pubmed='24263100'), TransmirInteraction(tf_genesymbol='AHR', mirna='hsa-mir-106b', effect='Activation', pubmed='24798859'), TransmirInteraction(tf_genesymbol='AHR', mirna='hsa-mir-132', effect='Activation', pubmed='...(truncated) | 2,678 | {} | 2023-06-18 21:29:39 | |
| ¶ | pypath.inputs.trip.take_a_trip | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.01 | dict | {'sc': {('P48995', 'Q12791'): [['TRPC1', '', 'BKca', 'Inference', '', '', '', '', '', 'Prediction', '19168436']], ('P48995', 'Q13873'): [['TRPC1', '', 'BMPR-2', 'Affinity purification-mass spectrometry', 'Not used as a bait', '', 'Mouse', 'Leg muscle', 'C2C12 lysates', '', '15188402']], ('P48995', '...(truncated) | 5 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.trip.trip_find_uniprot |
Not calling `pypath.inputs.trip.trip_find_uniprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.trip.trip_get_uniprot |
Not calling `pypath.inputs.trip.trip_get_uniprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.trip.trip_interactions | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.01 | list | [['P48995', 'Q12791', '25139746;19168436', 'Co-immunofluorescence staining;Co-immunoprecipitation', 'unknown'], ['P48995', 'Q08209', '23228564', 'Co-immunoprecipitation', 'unknown'], ['P48995', 'P62158', '11290752;11983166;12601176', 'Calcium measurement;Fusion protein-pull down assay;Fluorescence p...(truncated) | 359 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.trip.trip_process | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.01 | dict | {('P48995', 'Q12791'): {'refs': {'25139746', '19168436'}, 'methods': {'Co-immunofluorescence staining', 'Co-immunoprecipitation'}, 'tissues': {'Rat vascular smooth muscle cell', 'HEK293', 'Porcine coronary artery', 'Rat aortic vascular smooth muscle cell'}, 'effect': set(), 'regions': set()}, ('P489...(truncated) | 359 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.trip.trip_process_table |
Not calling `pypath.inputs.trip.trip_process_table`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.unichem._unichem_mapping |
Not calling `pypath.inputs.unichem._unichem_mapping`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.unichem.info |
Not calling `pypath.inputs.unichem.info`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.unichem.unichem_info | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.02 | list | [UnichemSource(number='1', label='chembl', name='ChEMBL', description='A database of bioactive drug-like small molecules and bioactivities abstracted from the scientific literature.', acquisition='Standard InChIs and Keys provided on ftp site for each release.'), UnichemSource(number='2', label='dru...(truncated) | 41 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.unichem.unichem_mapping |
Not calling `pypath.inputs.unichem.unichem_mapping`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.unichem.unichem_sources | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.02 | dict | {'1': 'chembl', '2': 'drugbank', '3': 'pdb', '4': 'gtopdb', '5': 'pubchem_dotf', '6': 'kegg_ligand', '7': 'chebi', '8': 'nih_ncc', '9': 'zinc', '10': 'emolecules', '12': 'atlas', '14': 'fdasrs', '15': 'surechembl', '17': 'pharmgkb', '18': 'hmdb', '20': 'selleck', '21': 'pubchem_tpharma', '22': 'pubc...(truncated) | 41 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.uniprot._all_uniprots | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.05 | set | {'A0A1X9I5B8', 'H0YE12', 'Q7YEG3', 'A0A024RAE5', 'B0I1T3', 'B4DI24', 'H0Y778', 'A6NJ28', 'A0A8V8TMD6', 'A8KAJ2', 'B1PQ26', 'D5G3L9', 'B3CJC0', 'O94759', 'C9J8X5', 'Q6LBL1', 'Q16674', 'A0A0A7C673', 'C9WET7', 'A0A024RC20', 'H0YIF6', 'P47895', 'A0A8J8ZI57', 'A0A7I2V2H3', 'A0A1V0MAW8', 'Q9UK80', 'V9HW42...(truncated) | 207,780 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.uniprot._cleanup | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.00 | NoneType | None | 0 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.uniprot._protein_datasheet |
Not calling `pypath.inputs.uniprot._protein_datasheet`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot._remove |
Not calling `pypath.inputs.uniprot._remove`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot._swissprot_param |
Not calling `pypath.inputs.uniprot._swissprot_param`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.all_swissprots | 2023-06-18 21:29:40 | 2023-06-18 21:29:40 | 0.00 | set | {'P19878', 'O95881', 'P57768', 'Q8IZ81', 'Q9UMR3', 'Q92902', 'Q3B7I2', 'O75943', 'A7MCY6', 'O43597', 'O94759', 'Q16674', 'O00295', 'P47895', 'Q96B54', 'O95279', 'Q9UK80', 'O95249', 'P48764', 'A0A1W2PPE2', 'O75131', 'Q9NZC7', 'A0A1W2PP81', 'A8MWL6', 'A0A0J9YY54', 'Q8N4C9', 'P35218', 'Q9NW75', 'Q8TD47...(truncated) | 20,422 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.uniprot.all_trembls | 2023-06-18 21:29:40 | 2023-06-18 21:30:58 | 78.05 | set | {'A0A1X9I5B8', 'H0YE12', 'Q7YEG3', 'A0A024RAE5', 'B0I1T3', 'B4DI24', 'H0Y778', 'A6NJ28', 'A0A8V8TMD6', 'A8KAJ2', 'B1PQ26', 'D5G3L9', 'B3CJC0', 'C9J8X5', 'Q6LBL1', 'A0A0A7C673', 'C9WET7', 'A0A024RC20', 'H0YIF6', 'A0A8J8ZI57', 'A0A7I2V2H3', 'A0A1V0MAW8', 'V9HW42', 'A0A0E3DDW0', 'A0A8I5KSA5', 'C5IZR0',...(truncated) | 187,358 | {} | 2023-06-18 21:29:40 | |
| ¶ | pypath.inputs.uniprot.all_uniprots | 2023-06-18 21:30:58 | 2023-06-18 21:30:58 | 0.00 | set | {'A0A1X9I5B8', 'H0YE12', 'Q7YEG3', 'A0A024RAE5', 'B0I1T3', 'B4DI24', 'H0Y778', 'A6NJ28', 'A0A8V8TMD6', 'A8KAJ2', 'B1PQ26', 'D5G3L9', 'B3CJC0', 'O94759', 'C9J8X5', 'Q6LBL1', 'Q16674', 'A0A0A7C673', 'C9WET7', 'A0A024RC20', 'H0YIF6', 'P47895', 'A0A8J8ZI57', 'A0A7I2V2H3', 'A0A1V0MAW8', 'Q9UK80', 'V9HW42...(truncated) | 207,780 | {} | 2023-06-18 21:30:58 | |
| ¶ | pypath.inputs.uniprot.deleted_uniprot_genesymbol |
Not calling `pypath.inputs.uniprot.deleted_uniprot_genesymbol`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.get_db | 2023-06-18 21:30:58 | 2023-06-18 21:30:58 | 0.00 | set | {'A0A1X9I5B8', 'H0YE12', 'Q7YEG3', 'A0A024RAE5', 'B0I1T3', 'B4DI24', 'H0Y778', 'A6NJ28', 'A0A8V8TMD6', 'A8KAJ2', 'B1PQ26', 'D5G3L9', 'B3CJC0', 'O94759', 'C9J8X5', 'Q6LBL1', 'Q16674', 'A0A0A7C673', 'C9WET7', 'A0A024RC20', 'H0YIF6', 'P47895', 'A0A8J8ZI57', 'A0A7I2V2H3', 'A0A1V0MAW8', 'Q9UK80', 'V9HW42...(truncated) | 207,780 | {} | 2023-06-18 21:30:58 | |
| ¶ | pypath.inputs.uniprot.get_uniprot_sec | 2023-06-18 21:30:58 | 2023-06-18 21:30:59 | 0.79 | list | [['A0A023HHK9', 'Q8NFU7'], ['A0A023HHL0', 'Q8NFU7'], ['A0A023IN41', 'H0Y5F6'], ['A0A024QZ37', 'X5D2H9'], ['A0A024QZ45', 'Q9BX63'], ['A0A024QZA1', 'Q5TDG9'], ['A0A024QZG0', 'O75150'], ['A0A024QZG6', 'Q96A32'], ['A0A024QZR6', 'Q9UII6'], ['A0A024R056', 'A0A140VJJ8'], ['A0A024R072', 'Q96S94'], ['A0A024R...(truncated) | 72,055 | {} | 2023-06-18 21:30:58 | |
| ¶ | pypath.inputs.uniprot.init_db | 2023-06-18 21:30:59 | 2023-06-18 21:30:59 | 0.06 | NoneType | None | 0 | {} | 2023-06-18 21:30:59 | |
| ¶ | pypath.inputs.uniprot.is_swissprot |
Not calling `pypath.inputs.uniprot.is_swissprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.is_trembl |
Not calling `pypath.inputs.uniprot.is_trembl`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.is_uniprot |
Not calling `pypath.inputs.uniprot.is_uniprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.protein_datasheet |
Not calling `pypath.inputs.uniprot.protein_datasheet`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.uniprot_data |
Not calling `pypath.inputs.uniprot.uniprot_data`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.uniprot_families | 2023-06-18 21:30:59 | 2023-06-18 21:31:20 | 20.71 | dict | {'A0A087X1C5': {UniprotFamily(family='Cytochrome P450', subfamily=None)}, 'A0A0B4J2F2': {UniprotFamily(family='Protein kinase superfamily, CAMK Ser/Thr protein kinase', subfamily='AMPK')}, 'A0A0K2S4Q6': {UniprotFamily(family='CD300', subfamily=None)}, 'A0A1B0GTW7': {UniprotFamily(family='Peptidase M...(truncated) | 14,420 | {} | 2023-06-18 21:30:59 | |
| ¶ | pypath.inputs.uniprot.uniprot_history |
Not calling `pypath.inputs.uniprot.uniprot_history`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.uniprot_history_recent_datasheet |
Not calling `pypath.inputs.uniprot.uniprot_history_recent_datasheet`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.uniprot_keywords | 2023-06-18 21:31:20 | 2023-06-18 21:31:38 | 17.62 | dict | {'A0A087X1C5': {UniprotKeyword(keyword='Transmembrane'), UniprotKeyword(keyword='Iron'), UniprotKeyword(keyword='Metal-binding'), UniprotKeyword(keyword='Heme'), UniprotKeyword(keyword='Mitochondrion'), UniprotKeyword(keyword='Reference proteome'), UniprotKeyword(keyword='Transmembrane helix'), Unip...(truncated) | 20,422 | {} | 2023-06-18 21:31:20 | |
| ¶ | pypath.inputs.uniprot.uniprot_locations | 2023-06-18 21:31:38 | 2023-06-18 21:32:02 | 24.57 | dict | {'A0A087X1C5': {UniprotLocation(location='Mitochondrion', features=None), UniprotLocation(location='Cytoplasm', features=None), UniprotLocation(location='Membrane', features=('Multi-pass membrane protein',))}, 'A0A0B4J2F0': {UniprotLocation(location='Mitochondrion outer membrane', features=('Single-...(truncated) | 17,037 | {} | 2023-06-18 21:31:38 | |
| ¶ | pypath.inputs.uniprot.uniprot_ncbi_taxids_2 | 2023-06-18 21:32:02 | 2023-06-18 21:32:02 | 0.09 | dict | {648330: Taxon(ncbi_id=648330, latin='Aedes albopictus densovirus (isolate Boublik/1994)', english='AalDNV', latin_synonym=None), 10804: Taxon(ncbi_id=10804, latin='Adeno-associated virus 2', english='AAV-2', latin_synonym=None), 648242: Taxon(ncbi_id=648242, latin='Adeno-associated virus 2 (isolate...(truncated) | 27,305 | {} | 2023-06-18 21:32:02 | |
| ¶ | pypath.inputs.uniprot.uniprot_preprocess |
Not calling `pypath.inputs.uniprot.uniprot_preprocess`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.uniprot_recent_version |
Not calling `pypath.inputs.uniprot.uniprot_recent_version`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.uniprot.uniprot_taxonomy | 2023-06-18 21:32:02 | 2023-06-18 21:32:05 | 2.16 | dict | {'P00521': {'Abelson murine leukemia virus'}, 'P03333': {'Abelson murine leukemia virus'}, 'H8ZM73': {'Balsam fir', 'Abies balsamea', 'Pinus balsamea'}, 'H8ZM71': {'Balsam fir', 'Abies balsamea', 'Pinus balsamea'}, 'Q9MV51': {'Momi fir', 'Abies firma'}, 'O81086': {'Grand fir', 'Pinus grandis', 'Abie...(truncated) | 555,077 | {} | 2023-06-18 21:32:02 | |
| ¶ | pypath.inputs.uniprot.uniprot_tissues | 2023-06-18 21:32:05 | 2023-06-18 21:32:24 | 19.09 | dict | {'A0A087X1C5': {UniprotTissue(tissue='Brain cortex', level='undefined')}, 'A0A0C5B5G6': {UniprotTissue(tissue='Skeletal muscle', level='undefined'), UniprotTissue(tissue='Plasma', level='undefined')}, 'A0A0K2S4Q6': {UniprotTissue(tissue='Granulocytes', level='undefined'), UniprotTissue(tissue='Myelo...(truncated) | 10,047 | {} | 2023-06-18 21:32:05 | |
| ¶ | pypath.inputs.uniprot.uniprot_topology | 2023-06-18 21:32:24 | 2023-06-18 21:33:41 | 77.14 | dict | {'A0A087X1C5': {UniprotTopology(topology='Transmembrane', start=3, end=23), UniprotTopology(topology='Extracellular', start=1, end=2), UniprotTopology(topology='Cytoplasmic', start=24, end=301), UniprotTopology(topology='Extracellular', start=323, end=515), UniprotTopology(topology='Transmembrane', ...(truncated) | 5,237 | {} | 2023-06-18 21:32:24 | |
| ¶ | pypath.inputs.uniprot.valid_uniprot |
Not calling `pypath.inputs.uniprot.valid_uniprot`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.wang._wang_process |
Not calling `pypath.inputs.wang._wang_process`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.wang.cui_interactions | 2023-06-18 21:33:41 | 2023-06-18 21:33:44 | 3.14 | list | [WangInteraction(genesymbol_source='14-3-3', genesymbol_target='BAD', entrez_source='10971', entrez_target='572', effect='-', function_source='Anti-apoptotic', location_source='Intracellular', function_target='P-A', location_target='Intracellular'), WangInteraction(genesymbol_source='14-3-3', genesy...(truncated) | 5,089 | {} | 2023-06-18 21:33:41 | |
| ¶ | pypath.inputs.wang.hsn_interactions | 2023-06-18 21:33:44 | 2023-06-18 21:33:45 | 0.68 | list | [HsnInteraction(genesymbol_source='EDNRA', genesymbol_target='NBN', entrez_source='1909', entrez_target='4683', effect='+'), HsnInteraction(genesymbol_source='TGFB1', genesymbol_target='TGFB1', entrez_source='7040', entrez_target='7040', effect='-'), HsnInteraction(genesymbol_source='EIF5B', genesym...(truncated) | 62,937 | {} | 2023-06-18 21:33:44 | |
| ¶ | pypath.inputs.wang.wang_annotations | 2023-06-18 21:33:45 | 2023-06-18 21:33:46 | 1.11 | dict | {'NA': {WangAnnotation(function='Messenger', location='Cytosol'), WangAnnotation(function='Lipid', location='Membrane'), WangAnnotation(function='Phosphatase', location='Cytosol'), WangAnnotation(function='Lipid', location='Cytosol'), WangAnnotation(function='Adapter', location='Ribosomes'), WangAnn...(truncated) | 1,544 | {} | 2023-06-18 21:33:45 | |
| ¶ | pypath.inputs.wang.wang_interactions | 2023-06-18 21:33:46 | 2023-06-18 21:33:46 | 0.15 | list | [WangInteraction(genesymbol_source='EDNRA', genesymbol_target='NBN', entrez_source='1909', entrez_target='4683', effect='+', function_source='Multiple Domain Transmembrane Proteins', location_source='Membrane', function_target='Transcription Factor', location_target='Intracellular'), WangInteraction...(truncated) | 62,937 | {} | 2023-06-18 21:33:46 | |
| ¶ | pypath.inputs.wojtowicz2020._id_translate |
Not calling `pypath.inputs.wojtowicz2020._id_translate`, not enough arguments. |
{} | never | ||||||
| ¶ | pypath.inputs.wojtowicz2020.wojtowicz2020_interactions | 2023-06-18 21:33:47 | 2023-06-18 21:33:47 | 0.13 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/wojtowicz2020.py", line 84, in wojtowicz2020_interactions
for rec in wojtowicz2020_raw():
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/wojtowicz2020.py", line 42, in wojtowicz2020_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 21:52:42 | |||
| ¶ | pypath.inputs.wojtowicz2020.wojtowicz2020_raw | 2023-06-18 21:33:47 | 2023-06-18 21:33:47 | 0.13 |
Traceback (most recent call last):
File "/mnt/disk0/build/omnipath-build/status-report.py", line 847, in test_input
value = fun(*_args, **_kwargs)
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/wojtowicz2020.py", line 42, in wojtowicz2020_raw
path = cell_input.cell_supplementary(
File "/mnt/disk0/build/omnipath-build/pypath_inputs_status__20230618-182602/pypath_git/pypath/inputs/cell.py", line 133, in cell_supplementary
c_table.fileobj.close()
AttributeError: 'Curl' object has no attribute 'fileobj'
|
{} | 2023-06-12 21:52:42 | |||
| ¶ | pypath.inputs.zhong2015.zhong2015_annotations | 2023-06-18 21:33:47 | 2023-06-18 21:33:47 | 0.21 | dict | {'P12830': {Zhong2015Annotation(type='iCAM')}, 'Q9Y6N8': {Zhong2015Annotation(type='iCAM')}, 'P55287': {Zhong2015Annotation(type='iCAM')}, 'P55290': {Zhong2015Annotation(type='iCAM')}, 'P55291': {Zhong2015Annotation(type='iCAM')}, 'O75309': {Zhong2015Annotation(type='iCAM')}, 'Q12864': {Zhong2015Ann...(truncated) | 466 | {} | 2023-06-18 21:33:47 |
The OmniPath Team • Saez Lab • 2023-06-18